@import url("https://fonts.googleapis.com/css2?family=Inter:wght@400;500;600;700&family=JetBrains+Mono:wght@400;500;600;700&family=Playfair+Display:ital,wght@0,400;0,600;0,700;1,400;1,600&display=swap");.product-toolbar button.collection-filter-pill.shop-category-trigger { color: #202124; font-size: inherit; font-weight: inherit; letter-spacing: 0; text-transform: none; gap: 8px; }
.product-toolbar button.collection-filter-pill.shop-category-trigger:hover,
.product-toolbar button.collection-filter-pill.shop-category-trigger[aria-expanded="true"] { text-decoration: none; color: #111; }
.shop-category-panel { position: absolute; top: calc(100% + 8px); left: 0; z-index: 30; width: 264px; max-width: calc(100vw - 24px); padding: 8px; border: 1px solid #e7e9ec; border-radius: 16px; background: #fff; box-shadow: 0 12px 32px rgb(15 23 42 / 10%); }
.product-toolbar .shop-category-panel button.shop-category-option { display: flex; align-items: center; justify-content: space-between; width: 100%; min-height: 44px; padding: 10px 12px; border: 0; border-radius: 8px; background: transparent; color: #202124; font: 500 14px/1.4 "Helvetica Neue", Helvetica, Arial, sans-serif; letter-spacing: 0; text-transform: none; text-align: left; text-decoration: none; cursor: pointer; }
.product-toolbar .shop-category-panel button.shop-category-option:hover,
.product-toolbar .shop-category-panel button.shop-category-option[aria-pressed="true"] { background: #f3f4f5; }
.product-toolbar .shop-category-panel button.shop-category-option:focus-visible { outline: 2px solid #1f62e8; outline-offset: -2px; }
@media (max-width: 700px) {
  .product-toolbar.shop-browse-toolbar { grid-template-columns: minmax(0, 1fr); gap: 12px; }
  .shop-browse-toolbar .toolbar-actions { width: 100%; justify-self: stretch; }
  .shop-browse-toolbar .collection-filter-bar { width: 100%; justify-content: flex-start; gap: 16px; transform: none; }
  .shop-browse-toolbar .collection-filter-clear-slot:empty { display: none; }
  .shop-browse-toolbar .collection-filter-clear-slot { min-width: 0; order: 5; }
}

.shop-category-footer { display: flex; align-items: center; gap: 10px; padding: 12px 8px 4px; margin-top: 6px; border-top: 1px solid #e7e9ec; font: 400 12px/1.4 "Helvetica Neue", Helvetica, Arial, sans-serif; letter-spacing: 0; text-transform: none; }
.shop-category-footer > span { margin-right: auto; color: #606770; }
.product-toolbar .shop-category-footer button { min-height: 36px; padding: 8px 12px; font: 500 13px/1.4 "Helvetica Neue", Helvetica, Arial, sans-serif; letter-spacing: 0; text-transform: none; border: 0; cursor: pointer; }
.product-toolbar .shop-category-footer .shop-category-clear { background: transparent; color: #606770; }
.product-toolbar .shop-category-footer .shop-category-done { background: #1f62e8; color: #fff; border-radius: 18px; }
.product-toolbar .shop-category-footer .shop-category-done:hover { background: #1855cf; }
.product-toolbar .shop-category-footer button:focus-visible { outline: 2px solid #1f62e8; outline-offset: 2px; }
.product-toolbar .shop-category-footer button,
.product-toolbar .shop-category-footer button:hover,
.product-toolbar .shop-category-footer button:focus-visible { text-decoration: none; }
#cc-main{background:transparent;color:var(--cc-primary-color);font-family:var(--cc-font-family);font-size:16px;font-weight:400;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;line-height:1.15;position:relative;text-rendering:optimizeLegibility;-webkit-text-size-adjust:100%;position:fixed;z-index:var(--cc-z-index)}#cc-main :after,#cc-main :before,#cc-main a,#cc-main button,#cc-main div,#cc-main h2,#cc-main input,#cc-main p,#cc-main span{all:unset;box-sizing:border-box}#cc-main .pm__badge,#cc-main button{all:initial;box-sizing:border-box;color:unset;visibility:unset}#cc-main .pm__badge,#cc-main a,#cc-main button,#cc-main input{-webkit-appearance:none;appearance:none;cursor:pointer;font-family:inherit;font-size:100%;line-height:normal;margin:0;outline:revert;outline-offset:2px;overflow:hidden}#cc-main table,#cc-main tbody,#cc-main td,#cc-main th,#cc-main thead,#cc-main tr{all:revert;color:inherit;font-family:inherit;font-size:inherit;font-weight:inherit}:root{--cc-font-family:-apple-system,BlinkMacSystemFont,"Segoe UI",Roboto,Helvetica,Arial,sans-serif,"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol";--cc-modal-border-radius:.5rem;--cc-btn-border-radius:.4rem;--cc-modal-transition-duration:.25s;--cc-link-color:var(--cc-btn-primary-bg);--cc-modal-margin:1rem;--cc-z-index:2147483647;--cc-bg:#fff;--cc-primary-color:#2c2f31;--cc-secondary-color:#5e6266;--cc-btn-primary-bg:#30363c;--cc-btn-primary-color:#fff;--cc-btn-primary-border-color:var(--cc-btn-primary-bg);--cc-btn-primary-hover-bg:#000;--cc-btn-primary-hover-color:#fff;--cc-btn-primary-hover-border-color:var(--cc-btn-primary-hover-bg);--cc-btn-secondary-bg:#eaeff2;--cc-btn-secondary-color:var(--cc-primary-color);--cc-btn-secondary-border-color:var(--cc-btn-secondary-bg);--cc-btn-secondary-hover-bg:#d4dae0;--cc-btn-secondary-hover-color:#000;--cc-btn-secondary-hover-border-color:#d4dae0;--cc-separator-border-color:#f0f4f7;--cc-toggle-on-bg:var(--cc-btn-primary-bg);--cc-toggle-off-bg:#667481;--cc-toggle-on-knob-bg:#fff;--cc-toggle-off-knob-bg:var(--cc-toggle-on-knob-bg);--cc-toggle-enabled-icon-color:var(--cc-bg);--cc-toggle-disabled-icon-color:var(--cc-bg);--cc-toggle-readonly-bg:#d5dee2;--cc-toggle-readonly-knob-bg:#fff;--cc-toggle-readonly-knob-icon-color:var(--cc-toggle-readonly-bg);--cc-section-category-border:var(--cc-cookie-category-block-bg);--cc-cookie-category-block-bg:#f0f4f7;--cc-cookie-category-block-border:#f0f4f7;--cc-cookie-category-block-hover-bg:#e9eff4;--cc-cookie-category-block-hover-border:#e9eff4;--cc-cookie-category-expanded-block-bg:transparent;--cc-cookie-category-expanded-block-hover-bg:#dee4e9;--cc-overlay-bg:rgba(0,0,0,.65);--cc-webkit-scrollbar-bg:var(--cc-section-category-border);--cc-webkit-scrollbar-hover-bg:var(--cc-btn-primary-hover-bg);--cc-footer-bg:var(--cc-btn-secondary-bg);--cc-footer-color:var(--cc-secondary-color);--cc-footer-border-color:#e4eaed;--cc-pm-toggle-border-radius:4em}#cc-main.cc--rtl{direction:rtl}#cc-main .cm__title,#cc-main a,#cc-main b,#cc-main em,#cc-main strong{font-weight:600}#cc-main button>span{pointer-events:none}#cc-main .cc__link,#cc-main a{background-image:linear-gradient(currentColor,currentColor);background-position:0 100%;background-repeat:no-repeat;background-size:0 1px;font-weight:600;position:relative;transition:background-size .25s,color .25s ease}#cc-main .cc__link:hover,#cc-main a:hover{background-size:100% 1px;color:var(--cc-primary-color)}#cc-main .cc__link{color:var(--cc-link-color)}#cc-main .cm__desc,#cc-main .pm__body{overscroll-behavior:auto contain;scrollbar-width:thin}@media screen and (min-width:640px){#cc-main ::-webkit-scrollbar,#cc-main ::-webkit-scrollbar-thumb,#cc-main ::-webkit-scrollbar-track{all:revert}#cc-main ::-webkit-scrollbar-thumb{-webkit-background-clip:padding-box;background-clip:padding-box;background:var(--cc-toggle-readonly-bg);border:.25rem solid var(--cc-bg);border-radius:1rem}#cc-main ::-webkit-scrollbar-thumb:hover{background:var(--cc-toggle-off-bg)}#cc-main ::-webkit-scrollbar{background:transparent;width:12px}}html.disable--interaction.show--consent,html.disable--interaction.show--consent body{height:auto!important;overflow:hidden!important}@media (prefers-reduced-motion){#cc-main{--cc-modal-transition-duration:0s}}.cc--darkmode{--cc-bg:#161a1c;--cc-primary-color:#ebf3f6;--cc-secondary-color:#aebbc5;--cc-btn-primary-bg:#c2d0e0;--cc-btn-primary-color:var(--cc-bg);--cc-btn-primary-border-color:var(--cc-btn-primary-bg);--cc-btn-primary-hover-bg:#98a7b6;--cc-btn-primary-hover-color:#000;--cc-btn-primary-hover-border-color:var(--cc-btn-primary-hover-bg);--cc-btn-secondary-bg:#242c31;--cc-btn-secondary-color:var(--cc-primary-color);--cc-btn-secondary-border-color:var(--cc-btn-secondary-bg);--cc-btn-secondary-hover-bg:#353d43;--cc-btn-secondary-hover-color:#fff;--cc-btn-secondary-hover-border-color:var(--cc-btn-secondary-hover-bg);--cc-separator-border-color:#222a30;--cc-toggle-on-bg:var(--cc-btn-primary-bg);--cc-toggle-off-bg:#525f6b;--cc-toggle-on-knob-bg:var(--cc-btn-primary-color);--cc-toggle-off-knob-bg:var(--cc-btn-primary-color);--cc-toggle-enabled-icon-color:var(--cc-btn-primary-color);--cc-toggle-disabled-icon-color:var(--cc-btn-primary-color);--cc-toggle-readonly-bg:#343e45;--cc-toggle-readonly-knob-bg:#5f6b72;--cc-toggle-readonly-knob-icon-color:var(--cc-toggle-readonly-bg);--cc-section-category-border:#1e2428;--cc-cookie-category-block-bg:#1e2428;--cc-cookie-category-block-border:var(--cc-section-category-border);--cc-cookie-category-block-hover-bg:#242c31;--cc-cookie-category-block-hover-border:#232a2f;--cc-cookie-category-expanded-block-bg:transparent;--cc-cookie-category-expanded-block-hover-bg:var(--cc-toggle-readonly-bg);--cc-overlay-bg:rgba(0,0,0,.65);--cc-webkit-scrollbar-bg:var(--cc-section-category-border);--cc-webkit-scrollbar-hover-bg:var(--cc-btn-primary-hover-bg);--cc-footer-bg:#0c0e0f;--cc-footer-color:var(--cc-secondary-color);--cc-footer-border-color:#060809}.cc--darkmode #cc-main{color-scheme:dark}#cc-main .cm{background:var(--cc-bg);border-radius:var(--cc-modal-border-radius);box-shadow:0 .625em 1.875em rgba(0,0,2,.3);display:flex;flex-direction:column;max-width:24rem;opacity:0;overflow:hidden;position:fixed;transform:translateY(1.6em);visibility:hidden;z-index:1}#cc-main .cm--top{top:var(--cc-modal-margin)}#cc-main .cm--middle{top:50%;transform:translateY(calc(-50% + 1.6em))}#cc-main .cm--bottom{bottom:var(--cc-modal-margin)}#cc-main .cm--center{left:var(--cc-modal-margin);margin:0 auto;right:var(--cc-modal-margin);width:unset}#cc-main .cm--left{left:var(--cc-modal-margin);margin-right:var(--cc-modal-margin)}#cc-main .cm--right{margin-left:var(--cc-modal-margin);right:var(--cc-modal-margin)}#cc-main .cm__body{display:flex;flex-direction:column;justify-content:space-between;position:relative}#cc-main .cm__btns,#cc-main .cm__links{padding:1rem 1.3rem;width:unset}#cc-main .cm__texts{display:flex;flex:1;flex-direction:column;justify-content:center;padding:1rem 0 0}#cc-main .cm__desc,#cc-main .cm__title{padding:0 1.3rem}#cc-main .cm__title{font-size:1.05em}#cc-main .cm__title+.cm__desc{margin-top:1.1em}#cc-main .cm__desc{color:var(--cc-secondary-color);font-size:.9em;line-height:1.5;max-height:40vh;overflow-x:visible;overflow-y:auto;padding-bottom:1em}#cc-main .cm__btns{border-top:1px solid var(--cc-separator-border-color);display:flex;flex-direction:column;justify-content:center}#cc-main .cm__btn-group{display:grid;grid-auto-columns:minmax(0,1fr)}#cc-main .cm__btn+.cm__btn,#cc-main .cm__btn-group+.cm__btn-group{margin-top:.375rem}#cc-main .cm--flip .cm__btn+.cm__btn,#cc-main .cm--flip .cm__btn-group+.cm__btn-group{margin-bottom:.375rem;margin-top:0}#cc-main .cm--inline .cm__btn+.cm__btn{margin-left:.375rem;margin-top:0}#cc-main .cm--inline.cm--flip .cm__btn+.cm__btn{margin-bottom:0;margin-left:0;margin-right:.375rem}#cc-main .cm--inline.cm--flip .cm__btn-group+.cm__btn-group{margin-bottom:.375rem;margin-right:0}#cc-main .cm--wide .cm__btn+.cm__btn,#cc-main .cm--wide .cm__btn-group+.cm__btn-group{margin-left:.375rem;margin-top:0}#cc-main .cm--wide.cm--flip .cm__btn+.cm__btn,#cc-main .cm--wide.cm--flip .cm__btn-group+.cm__btn-group{margin-bottom:0;margin-right:.375rem}#cc-main .cm--bar:not(.cm--inline) .cm__btn-group--uneven,#cc-main .cm--wide .cm__btn-group--uneven{display:flex;flex:1;justify-content:space-between}#cc-main .cm--bar:not(.cm--inline).cm--flip .cm__btn-group--uneven,#cc-main .cm--wide.cm--flip .cm__btn-group--uneven{flex-direction:row-reverse}#cc-main .cm__btn{background:var(--cc-btn-primary-bg);border:1px solid var(--cc-btn-primary-border-color);border-radius:var(--cc-btn-border-radius);color:var(--cc-btn-primary-color);font-size:.82em;font-weight:600;min-height:42px;padding:.5em 1em;text-align:center}#cc-main .cm__btn:hover{background:var(--cc-btn-primary-hover-bg);border-color:var(--cc-btn-primary-hover-border-color);color:var(--cc-btn-primary-hover-color)}#cc-main .cm__btn--secondary{background:var(--cc-btn-secondary-bg);border-color:var(--cc-btn-secondary-border-color);color:var(--cc-btn-secondary-color)}#cc-main .cm__btn--secondary:hover{background:var(--cc-btn-secondary-hover-bg);border-color:var(--cc-btn-secondary-hover-border-color);color:var(--cc-btn-secondary-hover-color)}#cc-main .cm__btn--close{border-radius:0;border-bottom-left-radius:var(--cc-btn-border-radius);border-right:none;border-top:none;display:none;font-size:1em;height:42px;min-width:auto!important;overflow:hidden;padding:0!important;position:absolute;right:0;top:0;width:42px}#cc-main .cm__btn--close svg{stroke:var(--cc-btn-primary-color);transform:scale(.5);transition:stroke .15s ease}#cc-main .cm__btn--close:hover svg{stroke:var(--cc-btn-primary-hover-color)}#cc-main .cm__btn--close.cm__btn--secondary svg{stroke:var(--cc-btn-secondary-color)}#cc-main .cm__btn--close.cm__btn--secondary:hover svg{stroke:var(--cc-btn-secondary-hover-color)}#cc-main .cm__btn--close+.cm__texts .cm__title{padding-right:3rem}#cc-main .cm--inline .cm__btn-group{grid-auto-flow:column}#cc-main .cm__footer{background:var(--cc-footer-bg);border-top:1px solid var(--cc-footer-border-color);color:var(--cc-footer-color);padding:.4em 0 .5em}#cc-main .cm__links{display:flex;flex-direction:row;padding-bottom:0;padding-top:0}#cc-main .cm__link-group{display:flex;flex-direction:row;font-size:.8em;width:100%}#cc-main .cm__link-group>*+*{margin-left:1.3rem}#cc-main .cm--flip .cm__btn:last-child{grid-row:1}#cc-main .cm--inline.cm--flip .cm__btn:last-child{grid-column:1}#cc-main .cm--box .cm__btn--close{display:block}#cc-main .cm--box.cm--flip .cm__btns{flex-direction:column-reverse}#cc-main .cm--box.cm--wide{max-width:36em}#cc-main .cm--box.cm--wide .cm__btns{flex-direction:row;justify-content:space-between}#cc-main .cm--box.cm--wide .cm__btn-group{grid-auto-flow:column}#cc-main .cm--box.cm--wide .cm__btn{min-width:120px;padding-left:1.8em;padding-right:1.8em}#cc-main .cm--box.cm--wide.cm--flip .cm__btns{flex-direction:row-reverse}#cc-main .cm--box.cm--wide.cm--flip .cm__btn:last-child{grid-column:1}#cc-main .cm--cloud{max-width:54em;width:unset}#cc-main .cm--cloud .cm__body{flex-direction:row}#cc-main .cm--cloud .cm__texts{flex:1}#cc-main .cm--cloud .cm__desc{max-height:9.4em}#cc-main .cm--cloud .cm__btns{border-left:1px solid var(--cc-separator-border-color);border-top:none;max-width:23em}#cc-main .cm--cloud .cm__btn-group{flex-direction:column}#cc-main .cm--cloud .cm__btn{min-width:19em}#cc-main .cm--cloud.cm--flip .cm__btn-group,#cc-main .cm--cloud.cm--flip .cm__btns{flex-direction:column-reverse}#cc-main .cm--cloud.cm--inline .cm__btn-group{flex-direction:row}#cc-main .cm--cloud.cm--inline .cm__btn{min-width:10em}#cc-main .cm--cloud.cm--inline.cm--flip .cm__btn-group{flex-direction:row-reverse}#cc-main .cm--bar{border-radius:0;left:0;margin:0;max-width:unset;opacity:1;right:0;transform:translateY(0);width:100vw;--cc-modal-transition-duration:.35s}#cc-main .cm--bar.cm--top{top:0;transform:translateY(-100%)}#cc-main .cm--bar.cm--bottom{bottom:0;transform:translateY(100%)}#cc-main .cm--bar .cm__body,#cc-main .cm--bar .cm__links{margin:0 auto;max-width:55em;width:100%}#cc-main .cm--bar .cm__body{padding:.5em 0 .9em}#cc-main .cm--bar .cm__btns{border-top:none;flex-direction:row;justify-content:space-between}#cc-main .cm--bar .cm__btn-group{grid-auto-flow:column}#cc-main .cm--bar:not(.cm--inline) .cm__btn+.cm__btn,#cc-main .cm--bar:not(.cm--inline) .cm__btn-group+.cm__btn-group{margin-left:.375rem;margin-top:0}#cc-main .cm--bar .cm__btn{min-width:120px;padding-left:2em;padding-right:2em}#cc-main .cm--bar.cm--flip:not(.cm--inline) .cm__btn+.cm__btn,#cc-main .cm--bar.cm--flip:not(.cm--inline) .cm__btn-group+.cm__btn-group{margin-bottom:0;margin-left:0;margin-right:.375rem}#cc-main .cm--bar.cm--flip .cm__btns{flex-direction:row-reverse}#cc-main .cm--bar.cm--flip .cm__btn:last-child{grid-column:1}#cc-main .cm--bar.cm--inline .cm__body,#cc-main .cm--bar.cm--inline .cm__links{max-width:74em}#cc-main .cm--bar.cm--inline .cm__body{flex-direction:row;padding:0}#cc-main .cm--bar.cm--inline .cm__btns{flex-direction:column;justify-content:center;max-width:23em}#cc-main .cm--bar.cm--inline.cm--flip .cm__btns{flex-direction:column-reverse}#cc-main .cc--anim .cm,#cc-main .cc--anim.cm-wrapper:before{transition:opacity var(--cc-modal-transition-duration) ease,visibility var(--cc-modal-transition-duration) ease,transform var(--cc-modal-transition-duration) ease}#cc-main .cc--anim .cm__btn,#cc-main .cc--anim .cm__close{transition:background-color .15s ease,border-color .15s ease,color .15s ease}.disable--interaction #cc-main .cm-wrapper:before{background:var(--cc-overlay-bg);bottom:0;content:"";left:0;opacity:0;position:fixed;right:0;top:0;visibility:hidden;z-index:0}.show--consent #cc-main .cc--anim .cm{opacity:1;transform:translateY(0);visibility:visible!important}.show--consent #cc-main .cc--anim .cm--middle{transform:translateY(-50%)}.show--consent #cc-main .cc--anim .cm--bar{transform:translateY(0)}.show--consent #cc-main .cc--anim.cm-wrapper:before{opacity:1;visibility:visible}#cc-main.cc--rtl .cm__btn--close{border-bottom-left-radius:unset;border-bottom-right-radius:var(--cc-btn-border-radius);left:0;right:unset}#cc-main.cc--rtl .cm__btn--close+.cm__texts .cm__title{padding-left:3rem!important;padding-right:1.3rem}#cc-main.cc--rtl .cm--inline .cm__btn+.cm__btn{margin-left:0;margin-right:.375rem}#cc-main.cc--rtl .cm--inline.cm--flip .cm__btn+.cm__btn{margin-left:.375rem;margin-right:0}#cc-main.cc--rtl .cm:not(.cm--inline).cm--bar .cm__btn+.cm__btn,#cc-main.cc--rtl .cm:not(.cm--inline).cm--bar .cm__btn-group+.cm__btn-group,#cc-main.cc--rtl .cm:not(.cm--inline).cm--wide .cm__btn+.cm__btn,#cc-main.cc--rtl .cm:not(.cm--inline).cm--wide .cm__btn-group+.cm__btn-group{margin-left:0;margin-right:.375rem}#cc-main.cc--rtl .cm:not(.cm--inline).cm--bar.cm--flip .cm__btn+.cm__btn,#cc-main.cc--rtl .cm:not(.cm--inline).cm--wide.cm--flip .cm__btn+.cm__btn{margin-left:.375rem;margin-right:0}#cc-main.cc--rtl .cm__link-group>*+*{margin-left:0;margin-right:1.3rem}@media screen and (max-width:640px){#cc-main{--cc-modal-margin:.5em}#cc-main .cm{max-width:none!important;width:auto!important}#cc-main .cm__body{flex-direction:column!important;padding:0!important}#cc-main .cm__btns,#cc-main .cm__desc,#cc-main .cm__links,#cc-main .cm__title{padding-left:1.1rem!important;padding-right:1.1rem!important}#cc-main .cm__btns{border-left:none!important;border-top:1px solid var(--cc-separator-border-color)!important;flex-direction:column!important;max-width:none!important;min-width:auto!important}#cc-main .cm__btn+.cm__btn,#cc-main .cm__btn-group+.cm__btn-group{margin:.375rem 0 0!important}#cc-main .cm--flip .cm__btn+.cm__btn,#cc-main .cm--flip .cm__btn-group+.cm__btn-group{margin-bottom:.375rem!important;margin-top:0!important}#cc-main .cm__btn-group{display:flex!important;flex-direction:column!important;min-width:auto!important}#cc-main .cm__btn{flex:auto!important}#cc-main .cm__link-group{justify-content:center!important}#cc-main .cm--flip .cm__btn-group,#cc-main .cm--flip .cm__btns{flex-direction:column-reverse!important}}#cc-main .pm-wrapper{position:relative;z-index:2}#cc-main .pm{background:var(--cc-bg);border-radius:var(--cc-modal-border-radius);box-shadow:0 .625em 1.875em rgba(0,0,2,.3);display:flex;flex-direction:column;opacity:0;overflow:hidden;position:fixed;visibility:hidden;width:100%;width:unset;z-index:1}#cc-main svg{fill:none;width:100%}#cc-main .pm__body,#cc-main .pm__footer,#cc-main .pm__header{padding:1em 1.4em}#cc-main .pm__header{align-items:center;border-bottom:1px solid var(--cc-separator-border-color);display:flex;justify-content:space-between}#cc-main .pm__title{align-items:center;display:flex;flex:1;font-weight:600;margin-right:2em}#cc-main .pm__close-btn{background:var(--cc-btn-secondary-bg);border:1px solid var(--cc-btn-secondary-border-color);border-radius:var(--cc-btn-border-radius);height:40px;position:relative;transition:all .15s ease;width:40px}#cc-main .pm__close-btn span{display:flex;height:100%;width:100%}#cc-main .pm__close-btn svg{stroke:var(--cc-btn-secondary-color);transform:scale(.5);transition:stroke .15s ease}#cc-main .pm__close-btn:hover{background:var(--cc-btn-secondary-hover-bg);border-color:var(--cc-btn-secondary-hover-border-color)}#cc-main .pm__close-btn:hover svg{stroke:var(--cc-btn-secondary-hover-color)}#cc-main .pm__body{flex:1;overflow-y:auto;overflow-y:overlay}#cc-main .pm__section,#cc-main .pm__section--toggle{border-radius:var(--cc-btn-border-radius);display:flex;flex-direction:column;margin-bottom:.5em}#cc-main .pm__section--toggle .pm__section-desc-wrapper{border:1px solid var(--cc-cookie-category-block-border);border-radius:var(--cc-btn-border-radius);border-top:none;border-top-left-radius:0;border-top-right-radius:0;display:none;margin-top:0!important;overflow:hidden}#cc-main .pm__section{border:1px solid var(--cc-separator-border-color);padding:1em;transition:background-color .25s ease,border-color .25s ease}#cc-main .pm__section:first-child{border:none;margin-bottom:2em;margin-top:0;padding:0;transition:none}#cc-main .pm__section:not(:first-child):hover{background:var(--cc-cookie-category-block-bg);border-color:var(--cc-cookie-category-block-border)}#cc-main .pm__section-toggles+.pm__section{margin-top:2em}#cc-main .pm__section--toggle{background:var(--cc-cookie-category-block-bg);border-top:none;margin-bottom:.375rem}#cc-main .pm__section--toggle .pm__section-title{align-items:center;background:var(--cc-cookie-category-block-bg);border:1px solid var(--cc-cookie-category-block-border);display:flex;justify-content:space-between;min-height:58px;padding:1.1em 5.4em 1.1em 1.2em;position:relative;transition:background-color .25s ease,border-color .25s ease;width:100%}#cc-main .pm__section--toggle .pm__section-title:hover{background:var(--cc-cookie-category-block-hover-bg);border-color:var(--cc-cookie-category-block-hover-border)}#cc-main .pm__section--toggle .pm__section-desc{margin-top:0;padding:1em}#cc-main .pm__section--toggle.is-expanded{--cc-cookie-category-block-bg:var(--cc-cookie-category-expanded-block-bg);--cc-cookie-category-block-border:var(--cc-cookie-category-expanded-block-hover-bg)}#cc-main .pm__section--toggle.is-expanded .pm__section-title{border-bottom-left-radius:0;border-bottom-right-radius:0}#cc-main .pm__section--toggle.is-expanded .pm__section-arrow svg{transform:scale(.5) rotate(180deg)}#cc-main .pm__section--toggle.is-expanded .pm__section-desc-wrapper{display:flex}#cc-main .pm__section--expandable .pm__section-title{cursor:pointer;padding-left:3.4em}#cc-main .pm__section--expandable .pm__section-arrow{background:var(--cc-toggle-readonly-bg);border-radius:100%;display:flex;height:20px;justify-content:center;left:18px;pointer-events:none;position:absolute;width:20px}#cc-main .pm__section--expandable .pm__section-arrow svg{stroke:var(--cc-btn-secondary-color);transform:scale(.5)}#cc-main .pm__section-title-wrapper{align-items:center;display:flex;position:relative}#cc-main .pm__section-title-wrapper+.pm__section-desc-wrapper{margin-top:.85em}#cc-main .pm__section-title{border-radius:var(--cc-btn-border-radius);font-size:.95em;font-weight:600}#cc-main .pm__badge{align-items:center;background:var(--cc-btn-secondary-bg);border-radius:5em;color:var(--cc-secondary-color);display:flex;flex:none;font-size:.8em;font-weight:600;height:23px;justify-content:center;margin-left:1em;min-width:23px;overflow:hidden;padding:0 .6em 1px;position:relative;text-align:center;white-space:nowrap;width:auto}#cc-main .pm__service-counter{background:var(--cc-btn-primary-bg);color:var(--cc-btn-primary-color);padding:0;width:23px}#cc-main .pm__service-counter[data-counterlabel]{padding:0 .6em 1px;width:auto}#cc-main .section__toggle,#cc-main .section__toggle-wrapper,#cc-main .toggle__icon,#cc-main .toggle__label{border-radius:var(--cc-pm-toggle-border-radius);height:23px;transform:translateZ(0);width:50px}#cc-main .section__toggle-wrapper{cursor:pointer;position:absolute;right:18px;z-index:1}#cc-main .toggle-service{height:19px;position:relative;right:0;width:42px}#cc-main .toggle-service .section__toggle,#cc-main .toggle-service .toggle__icon,#cc-main .toggle-service .toggle__label{height:19px;width:42px}#cc-main .toggle-service .toggle__icon{position:relative}#cc-main .toggle-service .toggle__icon-circle{height:19px;width:19px}#cc-main .toggle-service .section__toggle:checked~.toggle__icon .toggle__icon-circle{transform:translateX(23px)}#cc-main .pm__section--toggle:nth-child(2) .section__toggle-wrapper:after{display:none!important}#cc-main .section__toggle{border:0;cursor:pointer;display:block;left:0;margin:0;position:absolute;top:0}#cc-main .section__toggle:disabled{cursor:not-allowed}#cc-main .toggle__icon{background:var(--cc-toggle-off-bg);box-shadow:0 0 0 1px var(--cc-toggle-off-bg);display:flex;flex-direction:row;pointer-events:none;position:absolute;transition:all .25s ease}#cc-main .toggle__icon-circle{background:var(--cc-toggle-off-knob-bg);border:none;border-radius:var(--cc-pm-toggle-border-radius);box-shadow:0 1px 2px rgba(24,32,3,.36);display:block;height:23px;left:0;position:absolute;top:0;transition:transform .25s ease,background-color .25s ease;width:23px}#cc-main .toggle__icon-off,#cc-main .toggle__icon-on{height:100%;position:absolute;transition:opacity .15s ease;width:100%}#cc-main .toggle__icon-on{opacity:0;transform:rotate(45deg)}#cc-main .toggle__icon-on svg{stroke:var(--cc-toggle-on-bg);transform:scale(.55) rotate(-45deg)}#cc-main .toggle__icon-off{opacity:1}#cc-main .toggle__icon-off svg{stroke:var(--cc-toggle-off-bg);transform:scale(.55)}#cc-main .section__toggle:checked~.toggle__icon{background:var(--cc-toggle-on-bg);box-shadow:0 0 0 1px var(--cc-toggle-on-bg)}#cc-main .section__toggle:checked~.toggle__icon .toggle__icon-circle{background-color:var(--cc-toggle-on-knob-bg);transform:translateX(27px)}#cc-main .section__toggle:checked~.toggle__icon .toggle__icon-on{opacity:1}#cc-main .section__toggle:checked~.toggle__icon .toggle__icon-off{opacity:0}#cc-main .section__toggle:checked:disabled~.toggle__icon{background:var(--cc-toggle-readonly-bg);box-shadow:0 0 0 1px var(--cc-toggle-readonly-bg)}#cc-main .section__toggle:checked:disabled~.toggle__icon .toggle__icon-circle{background:var(--cc-toggle-readonly-knob-bg);box-shadow:none}#cc-main .section__toggle:checked:disabled~.toggle__icon svg{stroke:var(--cc-toggle-readonly-knob-icon-color)}#cc-main .toggle__label{opacity:0;overflow:hidden;pointer-events:none;position:absolute;top:0;z-index:-1}#cc-main .pm__section-desc-wrapper{color:var(--cc-secondary-color);display:flex;flex-direction:column;font-size:.9em}#cc-main .pm__section-desc-wrapper>:not(:last-child){border-bottom:1px solid var(--cc-cookie-category-block-border)}#cc-main .pm__section-services{display:flex;flex-direction:column}#cc-main .pm__service{align-items:center;display:flex;justify-content:space-between;padding:.4em 1.2em;position:relative;transition:background-color .15s ease}#cc-main .pm__service:hover{background-color:var(--cc-cookie-category-block-hover-bg)}#cc-main .pm__service-header{align-items:center;display:flex;margin-right:1em;width:100%}#cc-main .pm__service-icon{border:2px solid;border-radius:100%;height:8px;margin-left:6px;margin-right:20px;margin-top:1px;min-width:8px}#cc-main .pm__service-title{font-size:.95em;width:100%;word-break:break-word}#cc-main .pm__section-desc{line-height:1.5em}#cc-main .pm__section-table{border-collapse:collapse;font-size:.9em;margin:0;overflow:hidden;padding:0;text-align:left;width:100%}#cc-main .pm__table-caption{text-align:left}#cc-main .pm__table-caption,#cc-main .pm__table-head>tr{border-bottom:1px dashed var(--cc-separator-border-color);color:var(--cc-primary-color);font-weight:600}#cc-main .pm__table-tr{transition:background-color .15s ease}#cc-main .pm__table-tr:hover{background:var(--cc-cookie-category-block-hover-bg)}#cc-main .pm__table-caption,#cc-main .pm__table-td,#cc-main .pm__table-th{padding:.625em .625em .625em 1.2em;vertical-align:top}#cc-main .pm__footer{border-top:1px solid var(--cc-separator-border-color);display:flex;justify-content:space-between}#cc-main .pm__btn-group{display:flex}#cc-main .pm__btn+.pm__btn,#cc-main .pm__btn-group+.pm__btn-group{margin-left:.375rem}#cc-main .pm--flip .pm__btn+.pm__btn,#cc-main .pm--flip .pm__btn-group+.pm__btn-group{margin-left:0;margin-right:.375rem}#cc-main .pm__btn{background:var(--cc-btn-primary-bg);border:1px solid var(--cc-btn-primary-border-color);border-radius:var(--cc-btn-border-radius);color:var(--cc-btn-primary-color);flex:auto;font-size:.82em;font-weight:600;min-height:42px;min-width:110px;padding:.5em 1.5em;text-align:center;transition:background-color .15s ease,border-color .15s ease,color .15s ease}#cc-main .pm__btn:hover{background:var(--cc-btn-primary-hover-bg);border-color:var(--cc-btn-primary-hover-border-color);color:var(--cc-btn-primary-hover-color)}#cc-main .pm__btn--secondary{background:var(--cc-btn-secondary-bg);border-color:var(--cc-btn-secondary-border-color);color:var(--cc-btn-secondary-color)}#cc-main .pm__btn--secondary:hover{background:var(--cc-btn-secondary-hover-bg);border-color:var(--cc-btn-secondary-hover-border-color);color:var(--cc-btn-secondary-hover-color)}#cc-main .pm--box{height:calc(100% - 2em);left:var(--cc-modal-margin);margin:0 auto;max-height:37.5em;max-width:43em;right:var(--cc-modal-margin);top:50%;transform:translateY(calc(-50% + 1.6em))}#cc-main .pm--box.pm--flip .pm__btn-group,#cc-main .pm--box.pm--flip .pm__footer{flex-direction:row-reverse}#cc-main .pm--bar{border-radius:0;bottom:0;height:100%;margin:0;max-height:none;max-width:29em;opacity:1;top:0;width:100%;--cc-modal-transition-duration:.35s}#cc-main .pm--bar .pm__section-table,#cc-main .pm--bar .pm__table-body,#cc-main .pm--bar .pm__table-td,#cc-main .pm--bar .pm__table-th,#cc-main .pm--bar .pm__table-tr{display:block}#cc-main .pm--bar .pm__table-head{display:none}#cc-main .pm--bar .pm__table-caption{display:block}#cc-main .pm--bar .pm__table-tr:not(:last-child){border-bottom:1px solid var(--cc-separator-border-color)}#cc-main .pm--bar .pm__table-td{display:flex;justify-content:space-between}#cc-main .pm--bar .pm__table-td:before{color:var(--cc-primary-color);content:attr(data-column);flex:1;font-weight:600;min-width:100px;overflow:hidden;padding-right:2em;text-overflow:ellipsis}#cc-main .pm--bar .pm__table-td>div{flex:3}#cc-main .pm--bar:not(.pm--wide) .pm__body,#cc-main .pm--bar:not(.pm--wide) .pm__footer,#cc-main .pm--bar:not(.pm--wide) .pm__header{padding:1em 1.3em}#cc-main .pm--bar:not(.pm--wide) .pm__btn-group,#cc-main .pm--bar:not(.pm--wide) .pm__footer{flex-direction:column}#cc-main .pm--bar:not(.pm--wide) .pm__btn+.pm__btn,#cc-main .pm--bar:not(.pm--wide) .pm__btn-group+.pm__btn-group{margin:.375rem 0 0}#cc-main .pm--bar:not(.pm--wide).pm--flip .pm__btn-group,#cc-main .pm--bar:not(.pm--wide).pm--flip .pm__footer{flex-direction:column-reverse}#cc-main .pm--bar:not(.pm--wide).pm--flip .pm__btn+.pm__btn,#cc-main .pm--bar:not(.pm--wide).pm--flip .pm__btn-group+.pm__btn-group{margin-bottom:.375rem;margin-top:0}#cc-main .pm--bar:not(.pm--wide) .pm__badge{display:none}#cc-main .pm--bar.pm--left{left:0;transform:translateX(-100%)}#cc-main .pm--bar.pm--right{right:0;transform:translateX(100%)}#cc-main .pm--bar.pm--wide{max-width:35em}#cc-main .pm--bar.pm--wide .pm__body,#cc-main .pm--bar.pm--wide .pm__footer,#cc-main .pm--bar.pm--wide .pm__header{padding:1em 1.4em}#cc-main .pm--bar.pm--wide.pm--flip .pm__btn-group,#cc-main .pm--bar.pm--wide.pm--flip .pm__footer{flex-direction:row-reverse}#cc-main .pm-overlay{background:var(--cc-overlay-bg);bottom:0;content:"";left:0;opacity:0;position:fixed;right:0;top:0;visibility:hidden;z-index:1}#cc-main .cc--anim .pm,#cc-main .cc--anim .pm-overlay{transition:opacity var(--cc-modal-transition-duration) ease,visibility var(--cc-modal-transition-duration) ease,transform var(--cc-modal-transition-duration) ease}.show--preferences #cc-main .cc--anim .pm{opacity:1;visibility:visible!important}.show--preferences #cc-main .cc--anim .pm--box{transform:translateY(-50%)}.show--preferences #cc-main .cc--anim .pm--bar{transform:translateX(0)}.show--preferences #cc-main .cc--anim .pm-overlay{opacity:1;visibility:visible}#cc-main.cc--rtl .pm__service-header{margin-left:1em;margin-right:0}#cc-main.cc--rtl .pm__section-arrow{left:unset;right:18px}#cc-main.cc--rtl .section__toggle-wrapper{left:18px;right:unset;transform-origin:left}#cc-main.cc--rtl .toggle-service{left:0}#cc-main.cc--rtl .pm__service-icon{margin-left:20px;margin-right:5px}#cc-main.cc--rtl .pm__section--toggle .pm__section-title{padding-left:5.4em;padding-right:1.2em}#cc-main.cc--rtl .pm__section--expandable .pm__section-title{padding-right:3.4em}#cc-main.cc--rtl .pm__badge{margin-left:unset;margin-right:1em}#cc-main.cc--rtl .toggle__icon-circle{transform:translateX(27px)}#cc-main.cc--rtl .toggle-service .toggle__icon-circle{transform:translateX(23px)}#cc-main.cc--rtl .section__toggle:checked~.toggle__icon .toggle__icon-circle{transform:translateX(0)}#cc-main.cc--rtl .pm__table-td,#cc-main.cc--rtl .pm__table-th{padding-left:unset;padding-right:1.2em;text-align:right}#cc-main.cc--rtl .pm__table-td{padding-left:unset;padding-right:1.2em}#cc-main.cc--rtl .pm__table-td:before{padding-left:2em;padding-right:unset}#cc-main.cc--rtl .pm__btn+.pm__btn,#cc-main.cc--rtl .pm__btn-group+.pm__btn-group{margin-left:0;margin-right:.375rem}#cc-main.cc--rtl .pm--flip .pm__btn+.pm__btn,#cc-main.cc--rtl .pm--flip .pm__btn-group+.pm__btn-group{margin-left:.375rem;margin-right:0}#cc-main.cc--rtl .pm--flip.pm--bar:not(.pm--wide) .pm__btn+.pm__btn,#cc-main.cc--rtl .pm--flip.pm--bar:not(.pm--wide) .pm__btn-group+.pm__btn-group{margin-left:0}@media screen and (max-width:640px){#cc-main .pm{border-radius:0;bottom:0;height:auto;left:0;max-height:100%;max-width:none!important;right:0;top:0;transform:translateY(1.6em)}#cc-main .pm__body,#cc-main .pm__footer,#cc-main .pm__header{padding:.9em!important}#cc-main .pm__badge{display:none}#cc-main .pm__section-table,#cc-main .pm__table-body,#cc-main .pm__table-caption,#cc-main .pm__table-td,#cc-main .pm__table-th,#cc-main .pm__table-tr{display:block}#cc-main .pm__table-head{display:none}#cc-main .pm__table-tr:not(:last-child){border-bottom:1px solid var(--cc-separator-border-color)}#cc-main .pm__table-td{display:flex;justify-content:space-between}#cc-main .pm__table-td:before{color:var(--cc-primary-color);content:attr(data-column);flex:1;font-weight:600;min-width:100px;overflow:hidden;padding-right:2em;text-overflow:ellipsis}#cc-main .pm__table-td>div{flex:3}#cc-main .pm__btn-group,#cc-main .pm__footer{flex-direction:column!important}#cc-main .pm__btn-group{display:flex!important}#cc-main .pm__btn+.pm__btn,#cc-main .pm__btn-group+.pm__btn-group{margin:.375rem 0 0!important}#cc-main .pm--flip .pm__btn+.pm__btn,#cc-main .pm--flip .pm__btn-group+.pm__btn-group{margin-bottom:.375rem!important;margin-top:0!important}#cc-main .pm--flip .pm__btn-group,#cc-main .pm--flip .pm__footer{flex-direction:column-reverse!important}.show--preferences #cc-main .cc--anim .pm{transform:translateY(0)!important}}#cc-main { --cc-font-family: Inter, "Helvetica Neue", Arial, sans-serif; --cc-bg: #fff; --cc-primary-color: #1c1e21; --cc-secondary-color: #65676b; --cc-modal-border-radius: 18px; --cc-btn-border-radius: 999px; --cc-btn-primary-bg: #1f62e8; --cc-btn-primary-border-color: #1f62e8; --cc-btn-primary-hover-bg: #1855ce; --cc-btn-primary-hover-border-color: #1855ce; --cc-btn-secondary-bg: #f1f3f5; --cc-btn-secondary-border-color: #f1f3f5; --cc-btn-secondary-hover-bg: #e9ecf0; --cc-btn-secondary-hover-border-color: #e9ecf0; --cc-toggle-on-bg: #1f62e8; --cc-cookie-category-block-bg: #f5f7fa; --cc-cookie-category-block-hover-bg: #eef1f5; --cc-overlay-bg: rgb(0 0 0 / 32%); }
#cc-main .cm.cm--bar { max-width: none; width: 100%; border-top: 1px solid #e5e7eb; border-radius: 0; box-shadow: 0 -4px 24px rgb(0 0 0 / 7%); }
#cc-main .cm.cm--bar .cm__body { display: flex; flex-direction: row; max-width: 1440px; padding: 20px 32px; gap: 28px; align-items: center; }
#cc-main .cm.cm--bar .cm__texts { padding: 0; }
#cc-main .cm.cm--bar .cm__btns { padding: 0; border: 0; gap: 8px; flex-shrink: 0; }
#cc-main .cm.cm--bar .cm__btn-group { gap: 8px; }
#cc-main .cm__title { font-size: 16px; font-weight: 600; letter-spacing: -.4px; }
#cc-main .cm__desc { font-size: 13px; line-height: 1.6; }
#cc-main .cm.cm--bar .cm__title { padding: 0 0 6px; }
#cc-main .cm.cm--bar .cm__desc { padding: 0; }
#cc-main .cm__btn, #cc-main .pm__btn { min-height: 42px; font-size: 12px; font-weight: 600; }
#cc-main .cm__footer { background: #fff; border-top: 1px solid #eceef1; }
#cc-main .cm__footer a { color: #65676b; font-size: 11px; }
#cc-main .pm { max-width: 540px; }
#cc-main .pm__title { font-size: 20px; letter-spacing: -.4px; }
#cc-main .pm__section-desc { font-size: 13px; line-height: 1.75; }
#cc-main .pm__section-title { font-size: 14px; font-weight: 600; }
#cc-main .pm__close-btn { border-radius: 50%; background: #f1f3f5; }
@media (max-width: 900px) {
  #cc-main .cm.cm--bar .cm__body { flex-direction: column; align-items: stretch; padding: 18px 20px; gap: 14px; }
  #cc-main .cm.cm--bar .cm__btns { flex-direction: row; }
  #cc-main .cm.cm--bar .cm__btn-group { flex-direction: row; flex: 1; }
  #cc-main .cm.cm--bar .cm__btn { padding: 10px 12px; min-width: 0; }
}
@media (max-width: 480px) {
  #cc-main .cm.cm--bar .cm__body { padding: 16px; }
  #cc-main .cm.cm--bar .cm__btns { flex-wrap: wrap; }
  #cc-main .cm.cm--bar .cm__btn-group { flex-basis: 100%; }
}
@media (prefers-reduced-motion: reduce) { #cc-main { --cc-modal-transition-duration: 0s; } }
/* Match the library's inline/mobile selectors without affecting preferences. */
#cc-main .cm.cm--bar.cm--bottom .cm__btns { flex-direction: row; gap: 8px; }
#cc-main .cm.cm--bar.cm--bottom .cm__btn-group { flex-direction: row; gap: 8px; }
#cc-main .cm.cm--bar.cm--bottom .cm__title { margin: 0 0 6px; padding: 0; }
#cc-main .cm.cm--bar.cm--bottom .cm__desc { margin: 0; padding: 0; }
@media (max-width: 900px) {
  #cc-main .cm.cm--bar.cm--bottom .cm__body { padding: 16px; gap: 14px; }
  #cc-main .cm.cm--bar.cm--bottom .cm__btns { width: 100%; padding: 0; }
  #cc-main .cm.cm--bar.cm--bottom .cm__btn { min-width: 0; margin: 0; }
}
#cc-main .cm.cm--bar.cm--inline .cm__btns { width: auto; min-width: 0; display: flex; gap: 8px; }
#cc-main .cm.cm--bar.cm--inline .cm__btn-group { display: flex; gap: 8px; }
#cc-main .cm.cm--bar.cm--inline .cm__btn { white-space: nowrap; padding: 10px 20px; }
@media (max-width: 900px) {
  #cc-main .cm.cm--bar.cm--inline .cm__body { padding: 16px; }
  #cc-main .cm.cm--bar.cm--inline .cm__texts { padding: 0; }
  #cc-main .cm.cm--bar.cm--inline .cm__btns { padding: 0; flex-direction: row; flex-wrap: wrap; gap: 8px; }
  #cc-main .cm.cm--bar.cm--inline .cm__btn-group { flex-direction: row; gap: 8px; }
}
.kaayd-footer { width: 100%; margin-top: auto; border-top: 1px solid #e8eaed; background: #fff; color: #747b85; font: 400 11px/1.6 Inter, "Helvetica Neue", Arial, sans-serif; text-transform: none; letter-spacing: 0; }
.kaayd-footer-inner { box-sizing: border-box; width: 100%; max-width: 1440px; margin: 0 auto; padding: 24px 32px; display: flex; align-items: center; justify-content: space-between; gap: 20px; }
.kaayd-footer nav { display: flex; align-items: center; justify-content: center; flex-wrap: wrap; gap: 20px; }
.kaayd-footer a { color: inherit; text-decoration: none; }
.kaayd-footer a:hover { color: #1c1e21; text-decoration: underline; text-underline-offset: 3px; }
.kaayd-footer a:focus-visible { outline: 2px solid #1f62e8; outline-offset: 4px; }
@media (max-width: 700px) { .kaayd-footer-inner { flex-direction: column; padding: 24px 20px; gap: 14px; text-align: center; } .kaayd-footer nav { gap: 12px 18px; } }
@media print { .kaayd-footer { display: none; } }

#root .kaayd-footer .cookie-settings-link { padding: 0; margin: 0; border: 0; border-radius: 0; background: transparent; color: inherit; font: inherit; text-transform: none; letter-spacing: 0; cursor: pointer; }
#root .kaayd-footer .cookie-settings-link:hover { color: #1c1e21; text-decoration: underline; text-underline-offset: 3px; }
#root .kaayd-footer .cookie-settings-link:focus-visible { outline: 2px solid #1f62e8; outline-offset: 4px; }
.ingestion-page { display: flex; flex-direction: column; min-height: 100dvh; background: #fff; color: #1c1e21; font-family: Inter, Arial, sans-serif; }
.ingestion-main { box-sizing: border-box; flex: 1 0 auto; width: 100%; max-width: 1320px; margin: 0 auto; padding: 56px 32px 80px; }
.ingestion-heading { display: flex; align-items: center; justify-content: space-between; gap: 20px; }
.ingestion-eyebrow { font-size: 10px; letter-spacing: .16em; color: #7c818a; }
.ingestion-heading h1 { font-size: 36px; letter-spacing: -1.3px; margin: 12px 0; }
.ingestion-heading p { font-size: 14px; color: #73777d; }
.ingestion-worker { padding: 9px 14px; border-radius: 999px; background: #f2f4f6; font-size: 12px; white-space: nowrap; }
.ingestion-worker.busy { background: #edf3ff; color: #1f62e8; }
.ingestion-note { font-size: 11px; color: #82868c; margin: 28px 0 20px; }
.ingestion-layout { display: grid; grid-template-columns: minmax(300px, 380px) minmax(0,1fr); gap: 32px; }
.ingestion-catalog { border: 1px solid #e7e9ed; border-radius: 16px; overflow: hidden; align-self: start; }
.ingestion-search { display: flex; align-items: center; gap: 10px; padding: 16px; border-bottom: 1px solid #eceef1; color: #73777d; }
#root .ingestion-search input { min-width: 0; width: 100%; border: 0; border-radius: 0; padding: 0; background: transparent; font: 13px Inter,Arial,sans-serif; color: #1c1e21; }
.ingestion-list { max-height: 650px; overflow: auto; padding: 6px; }
.ingestion-job { display: flex; align-items: center; gap: 8px; border-radius: 10px; padding: 8px; }
.ingestion-job.selected { background: #f1f5ff; }
#root .ingestion-job-info { display: grid; gap: 5px; text-align: left; padding: 5px 0; background: transparent; border: 0; flex: 1; min-width: 0; color: #1c1e21; border-radius: 0; text-transform: none; letter-spacing: 0; }
.ingestion-job-info strong { font-size: 12px; font-weight: 500; line-height: 1.5; }
.ingestion-job-info span { font-size: 11px; color: #777c84; }
.ingestion-job-info small { font-size: 10px; color: #1f62e8; }
#root .ingestion-run { display: inline-flex; align-items: center; gap: 5px; padding: 8px 12px; border: 0; border-radius: 999px; background: #1f62e8; color: white; font: 500 11px Inter,Arial,sans-serif; cursor: pointer; }
#root .ingestion-run:disabled { background: #f0f1f4; color: #90959c; cursor: not-allowed; }
.ingestion-history > header { display: flex; justify-content: space-between; align-items: center; gap: 12px; }
.ingestion-history h2 { font-size: 20px; letter-spacing: -.4px; margin: 0 0 8px; }
.ingestion-history header p { font-size: 12px; color: #73777d; margin: 0; }
.ingestion-history-hint { font-size: 11px; color: #82868c; line-height: 1.7; margin: 16px 0; }
#root .ingestion-text-button { font: 500 11px Inter,Arial,sans-serif; color: #1f62e8; background: transparent; border: 0; white-space: nowrap; }
.ingestion-empty { padding: 40px 20px; text-align: center; color: #73777d; font-size: 12px; }
.ingestion-empty h3 { color: #34383e; font-size: 16px; font-weight: 500; }
.ingestion-result { border: 1px solid #e7e9ed; border-radius: 14px; padding: 20px; margin-bottom: 12px; }
.ingestion-result-heading { display: flex; justify-content: space-between; gap: 14px; align-items: start; }
.ingestion-result-heading strong { display: block; font-size: 12px; line-height: 1.5; font-weight: 600; }
.ingestion-result-heading div > span { display: block; font-size: 10px; color: #7c818a; margin-top: 7px; }
.ingestion-status { font-size: 10px; text-transform: capitalize; padding: 5px 8px; border-radius: 999px; background: #f1f3f5; white-space: nowrap; }
.ingestion-status.succeeded { background: #edf7f0; color: #28723e; }
.ingestion-status.failed, .ingestion-status.interrupted { background: #fff1ef; color: #b23a2e; }
.ingestion-status.running { background: #edf3ff; color: #1f62e8; }
.ingestion-result dl { display: grid; grid-template-columns: repeat(5,1fr); gap: 8px; margin: 22px 0 16px; }
.ingestion-result dt { font-size: 10px; color: #73777d; }
.ingestion-result dd { font-size: 22px; font-weight: 500; margin: 6px 0 0; }
.ingestion-result details { font-size: 10px; color: #73777d; }
.ingestion-result summary { cursor: pointer; }
.ingestion-result code { overflow-wrap: anywhere; }
.ingestion-run-error { font-size: 11px; line-height: 1.7; color: #b23a2e; overflow-wrap: anywhere; }
.ingestion-error { display: flex; align-items: center; justify-content: space-between; gap: 12px; padding: 14px; background: #fff4ef; color: #96422a; border-radius: 10px; font-size: 12px; }
#root .ingestion-error button { display: flex; gap: 6px; border: 0; background: transparent; color: inherit; }
.ingestion-pagination { display: flex; justify-content: space-between; align-items: center; margin-top: 20px; font-size: 11px; color: #73777d; }
#root .ingestion-pagination button { padding: 7px 12px; border: 1px solid #e7e9ed; border-radius: 999px; background: white; font: 500 11px Inter,Arial,sans-serif; color: #45494f; }
#root .ingestion-pagination button:disabled { opacity: .4; }
#root .ingestion-main button:focus-visible { outline: 2px solid #1f62e8; outline-offset: 2px; }
@media(max-width: 800px) { .ingestion-main { padding: 32px 20px; } .ingestion-layout { grid-template-columns: 1fr; gap: 28px; } .ingestion-list { max-height: 330px; } .ingestion-heading h1 { font-size: 30px; } .ingestion-heading p { line-height: 1.6; } .ingestion-result { padding: 16px; } .ingestion-result dl { grid-template-columns: repeat(3,1fr); gap: 16px; } }
.ingestion-job-info .ingestion-job-status { text-transform: capitalize; color: #92969d; }
.ingestion-job-info .ingestion-job-status.succeeded { color: #28723e; }
.ingestion-job-info .ingestion-job-status.failed, .ingestion-job-info .ingestion-job-status.interrupted { color: #b23a2e; }
.ingestion-job-info .ingestion-job-status.running { color: #1f62e8; }
.ingestion-brand-grid { display: grid; grid-template-columns: repeat(3,minmax(0,1fr)); gap: 16px; }
#root .ingestion-brand-card { position: relative; display: flex; flex-direction: column; align-items: flex-start; justify-content: space-between; gap: 24px; min-height: 154px; padding: 24px 46px 24px 24px; border: 1px solid #e7e9ed; border-radius: 16px; background: #fff; color: #1c1e21; text-align: left; font-family: Inter,Arial,sans-serif; text-transform: none; letter-spacing: 0; cursor: pointer; transition: background 150ms ease,border-color 150ms ease; }
#root .ingestion-brand-card:hover { background: #f7f9fc; border-color: #cdd5e1; }
.ingestion-brand-title { font-size: 16px; line-height: 1.5; font-weight: 500; }
.ingestion-brand-meta { display: flex; flex-wrap: wrap; align-items: center; gap: 12px; font-size: 12px; color: #7c818a; }
.ingestion-brand-running { color: #1f62e8; }
.ingestion-brand-card > svg { position: absolute; right: 20px; top: 26px; color: #8b929d; }
#root .ingestion-back { display: inline-flex; align-items: center; gap: 8px; margin: 0 0 22px; padding: 6px 0; border: 0; border-radius: 0; background: none; color: #626974; font: 500 12px Inter,Arial,sans-serif; cursor: pointer; }
@media(max-width: 1000px) { .ingestion-brand-grid { grid-template-columns: repeat(2,minmax(0,1fr)); } }
@media(max-width: 600px) { .ingestion-brand-grid { grid-template-columns: 1fr; gap: 12px; } #root .ingestion-brand-card { min-height: 118px; padding: 20px 44px 20px 20px; gap: 16px; } }

.ingestion-brand-toolbar { display: flex; align-items: center; justify-content: space-between; gap: 16px; margin-bottom: 22px; }
#root .ingestion-brand-toolbar .ingestion-back { margin-bottom: 0; }
.ingestion-batch-action { display: flex; align-items: center; gap: 14px; }
.ingestion-batch-action > span { font-size: 11px; color: #73777d; }
#root .ingestion-run-all { padding: 11px 18px; font-size: 12px; white-space: nowrap; }
.ingestion-status.queued { background: #f5f1e7; color: #80632b; }
.ingestion-job-info .ingestion-job-status.queued { color: #80632b; }
@media(max-width: 600px) { .ingestion-brand-toolbar { align-items: flex-start; } .ingestion-batch-action { flex-direction: column-reverse; align-items: flex-end; gap: 8px; } .ingestion-batch-action > span { font-size: 10px; } .ingestion-heading { flex-wrap: wrap; } }

.ingestion-stock-option { display:flex; align-items:flex-start; gap:10px; margin:0 0 22px; padding:14px 16px; border:1px solid #dededb; border-radius:8px; cursor:pointer; }
.ingestion-stock-option input { width:16px; height:16px; margin:2px 0 0; flex-shrink:0; accent-color:#222; }
.ingestion-stock-option strong { display:block; font-size:13px; font-weight:500; }
.ingestion-stock-option small { display:block; margin-top:4px; font-size:12px; line-height:1.5; color:#666; }
.legal-page { min-height: 100dvh; background: #fff; color: #1c1e21; font-family: Inter, "Helvetica Neue", Arial, sans-serif; -webkit-font-smoothing: antialiased; }
.legal-page * { box-sizing: border-box; }
.legal-header { height: 80px; max-width: 1440px; margin: auto; padding: 0 48px; display: flex; align-items: center; justify-content: space-between; border-bottom: 1px solid #eceef1; }
.legal-page a { text-decoration: none; }
.legal-home-link { display: inline-flex; align-items: center; gap: 6px; font-size: 12px; color: #65676b; }
.legal-layout { display: grid; grid-template-columns: 230px minmax(0, 720px); gap: 80px; max-width: 1160px; margin: 0 auto; padding: 64px 32px 0; }
.legal-sidebar { position: sticky; top: 32px; align-self: start; max-height: calc(100dvh - 64px); overflow-y: auto; padding-bottom: 20px; }
.legal-eyebrow { margin: 0 0 24px 12px; font-size: 10px; font-weight: 600; letter-spacing: .12em; color: #777e87; }
.legal-pages { display: grid; gap: 5px; }
.legal-pages a { display: flex; gap: 12px; align-items: center; padding: 13px 12px; border-radius: 10px; color: #505660; font-size: 14px; font-weight: 500; }
.legal-pages a[aria-current="page"] { background: #eef4ff; color: #1f62e8; }
.legal-pages a:hover { background: #f2f4f7; }
.legal-contents { margin-top: 34px; padding-top: 24px; border-top: 1px solid #eceef1; }
.legal-contents > p { padding: 0 12px; margin: 0 0 14px; font-size: 11px; font-weight: 600; color: #747b85; }
.legal-contents a, .legal-mobile-contents nav a { display: flex; gap: 12px; padding: 9px 12px; font-size: 12px; line-height: 1.5; color: #68707a; border-radius: 7px; }
.legal-contents a span, .legal-mobile-contents nav a span { color: #8d949e; font-size: 10px; padding-top: 2px; font-variant-numeric: tabular-nums; }
.legal-contents a:hover, .legal-contents a[aria-current="location"] { background: #f5f6f8; color: #1c1e21; }
.legal-version { font-size: 11px; color: #767d87; }
.legal-intro h1 { margin: 16px 0; font-size: clamp(38px, 4vw, 52px); line-height: 1.1; letter-spacing: -1.8px; font-weight: 600; }
.legal-intro > p { margin: 0; font-size: 18px; line-height: 1.5; color: #747b85; letter-spacing: -.3px; }
.legal-draft-note { display: flex; flex-direction: column; gap: 5px; padding: 14px 16px; margin-top: 28px; border: 1px solid #e5e7eb; border-radius: 10px; font-size: 12px; line-height: 1.6; color: #646b75; }
.legal-draft-note strong { color: #333b45; font-weight: 600; }
.legal-summary { background: #f5f7fa; border-radius: 16px; padding: 24px; margin: 28px 0 10px; }
.legal-summary > span { font-size: 12px; font-weight: 600; }
.legal-summary p { margin: 10px 0 0; font-size: 14px; line-height: 1.8; color: #59616c; }
.legal-section { display: grid; grid-template-columns: 22px minmax(0, 1fr); gap: 16px; padding: 34px 0; border-bottom: 1px solid #eceef1; scroll-margin-top: 88px; }
.legal-section-number { font-size: 11px; color: #9198a1; padding-top: 6px; font-variant-numeric: tabular-nums; }
.legal-section h2, .legal-contact h2 { font-size: 21px; line-height: 1.4; font-weight: 550; letter-spacing: -.5px; margin: 0 0 16px; }
.legal-section p, .legal-section li { color: #555e69; font-size: 14px; line-height: 1.85; }
.legal-section p { margin: 0 0 14px; }
.legal-section p:last-child { margin-bottom: 0; }
.legal-section ul { padding-left: 19px; margin: 0 0 16px; }
.legal-section li { padding-left: 4px; margin-bottom: 10px; }
.legal-section strong { color: #333b45; font-weight: 600; }
.legal-section a { color: #1f62e8; text-decoration: underline; text-underline-offset: 3px; }
.legal-section .legal-review-note { font-size: 12px; border-left: 2px solid #d8dde5; padding: 3px 0 3px 14px; color: #7a6160; }
.legal-table-wrap { overflow-x: auto; margin: 20px 0; border: 1px solid #e5e7eb; border-radius: 10px; }
.legal-page table { width: 100%; border-collapse: collapse; font-size: 12px; line-height: 1.65; }
.legal-page caption { text-align: left; padding: 12px; font-weight: 500; color: #505660; }
.legal-page th { text-align: left; background: #f5f7fa; color: #333b45; font-weight: 600; }
.legal-page th, .legal-page td { padding: 12px; vertical-align: top; border-top: 1px solid #e5e7eb; }
.legal-page td { color: #59616c; }
.legal-contact { padding: 32px; background: #f5f7fa; border-radius: 16px; margin-top: 36px; }
.legal-contact h2 { margin-bottom: 6px; }
.legal-contact p { font-size: 13px; color: #68707a; margin: 0 0 20px; }
.legal-contact > a { display: inline-flex; align-items: center; gap: 10px; padding: 12px 20px; border-radius: 999px; font-size: 13px; font-weight: 500; background: #1f62e8; color: #fff; }
.legal-footer { display: flex; justify-content: space-between; align-items: center; gap: 16px; padding: 32px 0; font-size: 11px; color: #747b85; }
.legal-footer a { display: flex; gap: 6px; align-items: center; }
.legal-page a:focus-visible, .legal-page summary:focus-visible { outline: 2px solid #1f62e8; outline-offset: 3px; }
.legal-skip { position: absolute; left: 20px; top: -100px; padding: 12px; z-index: 10; background: #fff; }
.legal-skip:focus { top: 12px; }
.legal-mobile-contents { display: none; }
@media (max-width: 850px) { .legal-layout { gap: 32px; grid-template-columns: 190px minmax(0, 1fr); padding: 40px 24px 0; } }
@media (max-width: 640px) {
 .legal-header { height: 68px; padding: 0 24px; }
 .legal-layout { display: block; padding: 24px 24px 0; }
 .legal-sidebar { position: static; padding: 0; margin-bottom: 32px; max-height: none; }
 .legal-eyebrow, .legal-contents { display: none; }
 .legal-pages { grid-template-columns: 1fr 1fr; gap: 8px; }
 .legal-pages a { justify-content: center; font-size: 12px; padding: 12px 8px; gap: 8px; }
 .legal-intro h1 { font-size: 38px; }
 .legal-intro > p { font-size: 16px; }
 .legal-mobile-contents { display: block; border-bottom: 1px solid #e5e7eb; padding: 16px 0; margin-top: 12px; }
 .legal-mobile-contents summary { display: flex; align-items: center; justify-content: space-between; list-style: none; font-size: 13px; cursor: pointer; }
 .legal-mobile-contents summary::-webkit-details-marker { display: none; }
 .legal-mobile-contents nav { margin-top: 12px; }
 .legal-section { grid-template-columns: 16px minmax(0, 1fr); gap: 10px; padding: 28px 0; }
 .legal-section h2 { font-size: 19px; }
 .legal-summary, .legal-contact { padding: 20px; }
}
@media print { .legal-header, .legal-sidebar, .legal-draft-note, .legal-contact, .legal-footer, .legal-mobile-contents { display: none; } .legal-layout { display: block; padding: 0; } .legal-section { break-inside: avoid; } .legal-page { color: #000; } }

.legal-form-links { margin: 18px 0 0; color: #65676b; font: 400 12px/1.7 Inter, sans-serif; text-align: center; }
.legal-form-links a { color: inherit; text-decoration: underline; text-underline-offset: 3px; }

.legal-contact { margin-bottom: 48px; }
.legal-page { display: flex; flex-direction: column; }
.legal-header, .legal-layout { width: 100%; }


@font-face {
  font-family: "GT Standard";
  font-style: normal;
  font-weight: 400;
  src: url("https://shopify-assets.shopifycdn.com/shop-assets/static_uploads/shoplift/GTStandard-MRegular.woff2") format("woff2");
}

@font-face {
  font-family: "GT Standard";
  font-style: normal;
  font-weight: 500;
  src: url("https://shopify-assets.shopifycdn.com/shop-assets/static_uploads/shoplift/GTStandard-MMedium.woff2") format("woff2");
}

@font-face {
  font-family: "GT Standard";
  font-style: normal;
  font-weight: 600;
  src: url("https://shopify-assets.shopifycdn.com/shop-assets/static_uploads/shoplift/GTStandard-MSemibold.woff2") format("woff2");
}

@font-face {
  font-family: "GT Standard";
  font-style: normal;
  font-weight: 700;
  src: url("https://shopify-assets.shopifycdn.com/shop-assets/static_uploads/shoplift/GTStandard-MBold.woff2") format("woff2");
}

@font-face {
  font-family: "GT Standard";
  font-style: normal;
  font-weight: 800;
  src: url("https://shopify-assets.shopifycdn.com/shop-assets/static_uploads/shoplift/GTStandard-LHeavy.woff2") format("woff2");
}

@font-face {
  font-family: Akrobat;
  font-style: normal;
  font-weight: 400;
  src: url("https://www.hlorenzo.com/cdn/shop/t/105/assets/Akrobat-Regular.otf?v=177607536369873209931777992773") format("opentype");
}

.discovery-home {
  min-height: 100vh;
  overflow-x: hidden;
  background: #f5f5f7;
  color: #1d1d1f;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
}

.discovery-nav {
  position: sticky;
  top: 0;
  z-index: 20;
  display: grid;
  grid-template-columns: minmax(92px, 1fr) auto minmax(92px, 1fr);
  height: 54px;
  align-items: center;
  gap: 18px;
  padding: 0 36px;
  border-bottom: 1px solid rgba(29, 29, 31, 0.08);
  background: rgba(245, 245, 247, 0.78);
  backdrop-filter: blur(22px) saturate(1.35);
}

.discovery-logo {
  justify-self: start;
  padding: 0;
  border: 0;
  background: transparent;
  color: #1d1d1f;
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 15px;
  font-weight: 600;
  letter-spacing: 0.18em;
}

.discovery-nav-links {
  display: flex;
  align-items: center;
  gap: 2px;
}

.discovery-nav-links button,
.discovery-nav-actions button,
.discovery-nav-actions .auth-menu > button {
  border: 0;
  background: transparent;
  color: rgba(29, 29, 31, 0.56);
  font: inherit;
  font-size: 12px;
}

.discovery-nav-links button {
  min-height: 30px;
  padding: 0 11px;
  border-radius: 6px;
}

.discovery-nav-links button:hover,
.discovery-nav-links button.active,
.discovery-nav-actions button:hover,
.discovery-nav-actions .auth-menu > button:hover {
  color: #1d1d1f;
}

.discovery-nav-links button.active {
  background: rgba(255, 255, 255, 0.72);
  box-shadow: inset 0 0 0 1px rgba(29, 29, 31, 0.08);
}

.discovery-nav-actions {
  position: relative;
  display: flex;
  min-width: 0;
  align-items: center;
  justify-content: flex-end;
  gap: 14px;
  color: rgba(29, 29, 31, 0.56);
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  font-weight: 600;
  letter-spacing: 0.11em;
  text-transform: uppercase;
}

.discovery-icon-button {
  display: inline-flex;
  flex: 0 0 auto;
  align-items: center;
  justify-content: center;
  padding: 0;
}

.discovery-icon-button {
  width: 28px;
  height: 28px;
}

.discovery-nav-actions .auth-dropdown {
  top: calc(100% + 14px);
  z-index: 30;
  padding: 16px;
  border: 1px solid rgba(29, 29, 31, 0.1);
  border-radius: 8px;
  background: rgba(255, 255, 255, 0.9);
  box-shadow: 0 24px 54px rgba(29, 29, 31, 0.14);
  backdrop-filter: blur(18px);
  color: #1d1d1f;
}

.discovery-nav-actions .auth-dropdown-submit {
  color: rgba(29, 29, 31, 0.58);
}

.discovery-nav-actions .auth-dropdown-submit:hover,
.discovery-nav-actions .auth-dropdown-submit:focus-visible {
  color: #1d1d1f;
}

.discovery-nav-actions .auth-dropdown-field {
  border-bottom-color: rgba(29, 29, 31, 0.18);
  color: rgba(29, 29, 31, 0.58);
}

.discovery-nav-actions .auth-dropdown-field input {
  color: #1d1d1f;
  caret-color: #1d1d1f;
}

.discovery-nav-actions .auth-dropdown-field input::placeholder {
  color: rgba(29, 29, 31, 0.42);
}

.discovery-nav-actions .password-visibility-toggle {
  color: rgba(29, 29, 31, 0.52);
}

.discovery-nav-actions .password-visibility-toggle:hover,
.discovery-nav-actions .password-visibility-toggle:focus-visible,
.discovery-nav-actions .auth-dropdown-field:focus-within {
  color: #1d1d1f;
}

.discovery-nav-actions .auth-dropdown-field:focus-within {
  border-bottom-color: rgba(29, 29, 31, 0.32);
}

.discovery-nav-actions .auth-dropdown-field input:-webkit-autofill,
.discovery-nav-actions .auth-dropdown-field input:-webkit-autofill:hover,
.discovery-nav-actions .auth-dropdown-field input:-webkit-autofill:focus {
  -webkit-text-fill-color: #1d1d1f;
}

.discovery-account-menu {
  position: relative;
}

.discovery-wishlist-button {
  color: rgba(29, 29, 31, 0.72);
  cursor: pointer;
}

.discovery-wishlist-button:hover,
.discovery-wishlist-button:focus-visible {
  color: #1d1d1f;
}

.discovery-account-menu .top-nav-user {
  color: rgba(29, 29, 31, 0.72);
}

.discovery-account-menu .top-nav-user:hover,
.discovery-account-menu[open] .top-nav-user {
  color: #1d1d1f;
  cursor: pointer;
}

.discovery-account-menu .account-dropdown {
  top: calc(100% + 12px);
  right: 0;
  border-color: #dddfe2;
  background: #fff;
  box-shadow: 0 12px 28px rgb(0 0 0 / .12);
  color: #1c1e21;
  backdrop-filter: none;
}

.discovery-account-menu .account-dropdown-profile {
  border-color: #e4e6eb;
}

.discovery-account-menu .account-dropdown-avatar {
  background: #f0f2f5;
  filter: none;
}

.discovery-account-menu .account-dropdown-profile strong,
.discovery-account-menu .account-dropdown button {
  color: #1c1e21;
}

.discovery-account-menu .account-dropdown-profile span,
.discovery-account-menu .account-dropdown button svg {
  color: #606770;
}

.discovery-account-menu .account-dropdown-section {
  border-top-color: #e4e6eb;
}

.discovery-account-menu .account-dropdown button:hover {
  background: #f0f2f5;
  color: #1c1e21;
}

.discovery-account-menu .account-dropdown button:hover svg {
  color: #1c1e21;
}

.discovery-hero {
  position: relative;
  display: grid;
  min-height: auto;
  padding: 24px clamp(22px, 3.6vw, 56px) 42px;
}

.discovery-hero-frame {
  position: relative;
  width: 100%;
  min-height: 680px;
  height: calc(100svh - 150px);
  overflow: hidden;
  border: 1px solid rgba(29, 29, 31, 0.08);
  border-radius: 28px;
  background: #080808;
  box-shadow:
    0 36px 90px rgba(29, 29, 31, 0.18),
    0 2px 12px rgba(29, 29, 31, 0.08);
  isolation: isolate;
}

.discovery-hero-media {
  position: absolute;
  inset: 0;
  z-index: 0;
  overflow: hidden;
  background: #080808;
}

.discovery-hero-media video {
  width: 100%;
  height: 100%;
  object-fit: cover;
  object-position: center top;
}

.discovery-runway {
  position: absolute;
  inset: 0;
  display: grid;
  grid-template-columns: repeat(7, minmax(0, 1fr));
  gap: 3px;
  opacity: 0.42;
}

.discovery-runway-frame,
.discovery-card-image,
.discovery-listing-image,
.discovery-wanted-image {
  position: relative;
  display: flex;
  align-items: center;
  justify-content: center;
  overflow: hidden;
}

.tone-umber { background: #241f18; }
.tone-charcoal { background: #20201d; }
.tone-olive { background: #1b211c; }
.tone-steel { background: #1a2022; }
.tone-moss { background: #1c241f; }
.tone-ink { background: #18191f; }
.tone-taupe { background: #25211f; }
.tone-wine { background: #24191d; }
.tone-stone { background: #22211d; }

.discovery-hero-gradient {
  position: absolute;
  inset: 0;
  background:
    linear-gradient(90deg, rgba(8, 8, 8, 0.5), rgba(8, 8, 8, 0.18) 34%, rgba(8, 8, 8, 0.02) 64%, rgba(8, 8, 8, 0.22) 100%),
    linear-gradient(180deg, rgba(8, 8, 8, 0.06), rgba(8, 8, 8, 0.02) 46%, rgba(8, 8, 8, 0.72));
}

.discovery-hero-bottom {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  height: 410px;
  background: linear-gradient(0deg, rgba(8, 8, 8, 0.92), rgba(8, 8, 8, 0));
}

.discovery-hero-copy {
  position: absolute;
  right: clamp(26px, 4vw, 64px);
  bottom: clamp(30px, 5vw, 72px);
  left: clamp(26px, 4vw, 64px);
  z-index: 2;
  display: grid;
  width: auto;
  justify-items: center;
  padding: 0;
  text-align: center;
}

.discovery-kicker {
  margin: 0 0 12px;
  color: rgba(255, 255, 255, 0.62);
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  font-weight: 600;
  letter-spacing: 0.16em;
  text-transform: uppercase;
}

.discovery-hero-copy h1 {
  margin: 0;
  color: #fff;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: clamp(46px, 7vw, 96px);
  font-weight: 560;
  letter-spacing: 0;
  line-height: 0.96;
}

.discovery-hero-copy h1 span {
  display: block;
}

.discovery-hero-title-secondary {
  margin-top: 2px;
  color: rgba(255, 255, 255, 0.78);
  font-size: 0.64em;
  font-weight: 420;
}

.discovery-description {
  max-width: 560px;
  margin: 20px 0 0;
  color: rgba(255, 255, 255, 0.72);
  font-size: 17px;
  line-height: 1.55;
}

.discovery-hero-actions {
  display: flex;
  flex-wrap: wrap;
  gap: 8px;
  margin-top: 26px;
}

.discovery-primary-button,
.discovery-secondary-button {
  min-height: 48px;
  padding: 0 24px;
  font-size: 10px;
  border-radius: 999px;
}

.discovery-primary-button {
  display: inline-flex;
  align-items: center;
  gap: 16px;
  border: 1px solid rgba(255, 255, 255, 0.72);
  background: rgba(255, 255, 255, 0.92);
  color: #1d1d1f;
  font-family: "JetBrains Mono", monospace;
  font-weight: 500;
  letter-spacing: 0.12em;
  text-transform: uppercase;
}

.discovery-secondary-button {
  border: 1px solid rgba(255, 255, 255, 0.15);
  background: rgba(255, 255, 255, 0.08);
  color: #fff;
}

.discovery-primary-button:hover {
  border-color: #ffffff;
  background: #ffffff;
}

.discovery-primary-button span {
  display: block;
  width: 18px;
  height: 1px;
  background: currentColor;
  transition: width 160ms ease;
}

.discovery-primary-button:hover span {
  width: 28px;
}

.discovery-secondary-button:hover {
  border-color: rgba(255, 255, 255, 0.28);
  background: rgba(255, 255, 255, 0.13);
}

.discovery-hero-stats {
  display: flex;
  gap: 10px;
  margin-top: 24px;
  text-align: center;
}

.discovery-stat {
  min-width: 108px;
  padding: 12px 18px;
  border: 1px solid rgba(255, 255, 255, 0.16);
  border-radius: 999px;
  background: rgba(255, 255, 255, 0.08);
  backdrop-filter: blur(18px);
}

.discovery-stat strong {
  display: block;
  color: #fff;
  font-size: 22px;
  font-weight: 560;
  line-height: 1;
}

.discovery-stat span {
  display: block;
  margin-top: 4px;
  color: rgba(255, 255, 255, 0.58);
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  font-weight: 600;
  letter-spacing: 0.12em;
  text-transform: uppercase;
}

.discovery-sections {
  position: relative;
  z-index: 2;
  display: grid;
  gap: 84px;
  max-width: 1480px;
  margin: 0 auto;
  padding: 48px clamp(24px, 4.4vw, 64px) 88px;
}

.discovery-shelf {
  min-width: 0;
  padding-bottom: 84px;
  border-bottom: 1px solid rgba(29, 29, 31, 0.08);
}

.discovery-shelf:last-child {
  border-bottom: 0;
}

.discovery-shelf-head {
  display: flex;
  align-items: flex-end;
  justify-content: space-between;
  gap: 28px;
  margin-bottom: 28px;
}

.discovery-shelf-head h2 {
  display: block;
  margin: 0;
  color: #1d1d1f;
  font-size: clamp(32px, 4vw, 56px);
  font-weight: 650;
  letter-spacing: 0;
  line-height: 1.05;
}

.discovery-shelf.quiet-title .discovery-shelf-head h2 {
  color: #1d1d1f;
  font-weight: 650;
}

.discovery-shelf-head p {
  display: block;
  margin: 7px 0 0;
  color: rgba(29, 29, 31, 0.58);
  font-size: 15px;
  line-height: 1.5;
}

.discovery-shelf-head button {
  display: inline-flex;
  align-items: center;
  gap: 4px;
  padding: 0;
  border: 0;
  background: transparent;
  color: rgba(29, 29, 31, 0.46);
  font-size: 12px;
  white-space: nowrap;
}

.discovery-shelf-head button:hover {
  color: #1d1d1f;
}

.discovery-carousel-shell {
  position: relative;
  min-width: 0;
}

.discovery-carousel {
  display: flex;
  gap: 22px;
  min-width: 0;
  overflow-x: auto;
  padding-bottom: 4px;
  scroll-behavior: smooth;
  scrollbar-width: none;
}

.discovery-carousel::-webkit-scrollbar {
  display: none;
}

.discovery-carousel-prev,
.discovery-carousel-next {
  position: absolute;
  top: 50%;
  z-index: 3;
  display: grid;
  width: 46px;
  height: 76px;
  place-items: center;
  padding: 0;
  border: 0;
  border-radius: 999px;
  color: rgba(29, 29, 31, 0.72);
  transform: translateY(-50%);
  transition: color 180ms ease, opacity 180ms ease, transform 180ms ease;
}

.discovery-carousel-prev {
  left: 0;
  background: linear-gradient(270deg, rgba(245, 245, 247, 0.08), rgba(245, 245, 247, 0.86));
}

.discovery-carousel-next {
  right: 0;
  background: linear-gradient(90deg, rgba(245, 245, 247, 0.08), rgba(245, 245, 247, 0.86));
}

.discovery-carousel-prev:hover,
.discovery-carousel-next:hover {
  color: #1d1d1f;
  transform: translateY(-50%) scale(1.04);
}

.discovery-carousel-prev:focus-visible,
.discovery-carousel-next:focus-visible {
  outline: 1px solid rgba(29, 29, 31, 0.5);
  outline-offset: 3px;
}

.discovery-collection-card,
.discovery-line-card,
.discovery-listing-card,
.discovery-wanted-card {
  display: grid;
  flex: 0 0 auto;
  min-width: 0;
  padding: 0;
  border: 0;
  background: transparent;
  color: inherit;
  font: inherit;
  text-align: left;
}

.discovery-line-card {
  text-decoration: none;
}

.discovery-line-card:visited {
  color: inherit;
}

.discovery-collection-card {
  width: min(320px, 72vw);
}

.discovery-line-card {
  width: 340px;
}

.discovery-line-card.is-compact-label {
  width: 248px;
}

.discovery-line-card.is-compact-label .discovery-line-logo-card {
  height: 113px;
  aspect-ratio: auto;
}

.discovery-listing-card,
.discovery-wanted-card {
  width: min(224px, 58vw);
}

.discovery-listing-card {
  gap: 10px;
}

.discovery-card-image,
.discovery-listing-image,
.discovery-wanted-image {
  width: 100%;
  border-radius: 8px;
}

.discovery-card-image {
  aspect-ratio: 2 / 3;
  transition: transform 280ms ease;
}

.discovery-card-image img {
  position: absolute;
  inset: 0;
  width: 100%;
  height: 100%;
  filter: brightness(0.58) saturate(0.78) contrast(0.96);
  object-fit: cover;
  object-position: center top;
  transform: scale(1.01);
}

.discovery-listing-image,
.discovery-wanted-image {
  aspect-ratio: 3 / 4;
}

.discovery-listing-image img {
  position: absolute;
  inset: 0;
  width: 100%;
  height: 100%;
  filter: saturate(0.96) contrast(1.01);
  object-fit: cover;
  object-position: center top;
  transform: scale(1.01);
  transition: transform 260ms ease, filter 260ms ease;
}

.discovery-wanted-image {
  opacity: 0.62;
}

.discovery-collection-overlay {
  position: absolute;
  inset: 0;
  z-index: 3;
  display: grid;
  place-items: end stretch;
  padding: 12px;
  background: linear-gradient(0deg, rgba(0, 0, 0, 0.36), rgba(0, 0, 0, 0.02) 62%);
  opacity: 0;
  transition: opacity 180ms ease;
}

.discovery-collection-card:focus-visible .discovery-collection-overlay {
  opacity: 1;
}

.discovery-collection-overlay span {
  display: flex;
  min-height: 30px;
  align-items: center;
  justify-content: center;
  border-radius: 4px;
  background: #fff;
  color: #080808;
  font-size: 10px;
  font-weight: 700;
  line-height: 1.2;
}

.discovery-card-gradient {
  position: absolute;
  inset: 0;
  background:
    linear-gradient(0deg, rgba(0, 0, 0, 0.82), rgba(0, 0, 0, 0.44) 40%, rgba(0, 0, 0, 0.08) 76%, rgba(0, 0, 0, 0.02)),
    linear-gradient(90deg, rgba(0, 0, 0, 0.22), rgba(0, 0, 0, 0.02) 58%, rgba(0, 0, 0, 0.12));
}

.discovery-card-copy {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  display: grid;
  gap: 3px;
  padding: 12px 10px;
}

.discovery-card-brand {
  color: rgba(255, 255, 255, 0.62);
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  font-weight: 600;
  letter-spacing: 0.12em;
  line-height: 1.2;
  text-transform: uppercase;
}

.discovery-card-title {
  color: #fff;
  font-size: 13px;
  font-weight: 600;
  line-height: 1.2;
}

.discovery-card-season,
.discovery-card-stats,
.discovery-listing-overlay span {
  color: rgba(255, 255, 255, 0.62);
  font-size: 10px;
  font-style: normal;
  line-height: 1.35;
}

.discovery-card-stats {
  display: flex;
  flex-wrap: wrap;
  gap: 9px;
  margin-top: 4px;
}

.discovery-card-stats strong {
  color: rgba(255, 255, 255, 0.86);
}

.discovery-line-logo-card {
  position: relative;
  display: grid;
  width: 100%;
  aspect-ratio: 3 / 1;
  overflow: hidden;
  place-items: center;
  padding: 20px;
  border: 0;
  border-radius: 8px;
  background:
    linear-gradient(145deg, rgba(255, 255, 255, 0.92), rgba(248, 248, 248, 0.68)),
    #ffffff;
  box-shadow:
    inset 0 0 0 1px rgba(29, 29, 31, 0.08),
    0 16px 42px rgba(29, 29, 31, 0.06);
  transition: border-color 220ms ease, transform 220ms ease, background 220ms ease;
}

.discovery-line-logo-card.has-logo {
  padding: 0;
  background: transparent;
  box-shadow: none;
}

.discovery-line-logo-card.has-logo::after {
  opacity: 0;
}

.discovery-line-logo-card::after {
  position: absolute;
  inset: 0;
  border-radius: inherit;
  background:
    linear-gradient(90deg, transparent, rgba(29, 29, 31, 0.035), transparent),
    linear-gradient(180deg, rgba(255, 255, 255, 0), rgba(29, 29, 31, 0.035));
  content: "";
  opacity: 0.72;
  pointer-events: none;
}

.discovery-line-card:disabled {
  cursor: default;
}

.discovery-line-card:disabled .discovery-line-logo-card {
  opacity: 0.58;
  transform: none;
}

.discovery-line-card:disabled:hover .discovery-line-logo-card {
  background:
    linear-gradient(145deg, rgba(255, 255, 255, 0.92), rgba(248, 248, 248, 0.68)),
    #ffffff;
  transform: none;
}

.discovery-line-card:disabled:hover .discovery-line-logo-card.has-logo {
  background: transparent;
}

.discovery-line-card:disabled:hover .discovery-line-logo-card.has-logo img {
  opacity: 0.92;
  transform: none;
}

.discovery-line-card:disabled .discovery-line-card-copy {
  opacity: 0.58;
}

.discovery-line-logo-box {
  position: absolute;
  inset: 0;
  z-index: 1;
  display: grid;
  background: none;
  overflow: visible;
  place-items: center;
}

.discovery-line-logo-box img {
  position: absolute;
  inset: 0;
  width: 100%;
  height: 100%;
  object-fit: cover;
  object-position: center;
  opacity: 0.92;
  transition:
    opacity 220ms ease,
    transform 220ms ease;
}

.discovery-line-logo-placeholder {
  display: block;
  max-width: 88%;
  color: rgba(29, 29, 31, 0.82);
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 23px;
  font-weight: 600;
  letter-spacing: 0.12em;
  line-height: 1;
  text-align: center;
  text-transform: uppercase;
}

.discovery-line-card-copy {
  display: grid;
  gap: 5px;
  margin-top: 12px;
  overflow: hidden;
  justify-items: center;
  text-align: center;
}

.discovery-line-card-copy strong {
  overflow: hidden;
  color: rgba(29, 29, 31, 0.9);
  font-size: 13px;
  font-weight: 600;
  line-height: 1.2;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.discovery-line-card-copy span {
  color: rgba(29, 29, 31, 0.5);
  font-size: 11px;
  line-height: 1.3;
}

.discovery-pill {
  position: absolute;
  top: 6px;
  left: 6px;
  z-index: 2;
  max-width: calc(100% - 12px);
  overflow: hidden;
  padding: 3px 7px;
  border-radius: 999px;
  background: rgba(0, 0, 0, 0.5);
  color: rgba(255, 255, 255, 0.76);
  font-size: 9px;
  line-height: 1.2;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.discovery-card-image .discovery-pill {
  right: 8px;
  left: auto;
}

.discovery-pill.hot {
  background: rgba(220, 80, 60, 0.24);
  color: #e87060;
}

.discovery-pill.new {
  background: rgba(60, 160, 100, 0.25);
  color: #62d28a;
}

.discovery-pill.rare {
  background: rgba(200, 160, 40, 0.24);
  color: #d7b245;
}

.discovery-listing-figure {
  display: inline-flex;
  transition: transform 260ms ease;
}

.discovery-listing-overlay {
  position: absolute;
  inset: 0;
  display: grid;
  z-index: 3;
  padding: 10px;
  background: linear-gradient(0deg, rgba(0, 0, 0, 0.38), rgba(0, 0, 0, 0.02) 62%);
  opacity: 0;
  transition: opacity 180ms ease;
  place-items: end stretch;
}

.discovery-listing-overlay span {
  display: block;
  min-height: 28px;
  padding: 7px 8px;
  border-radius: 4px;
  background: #fff;
  color: #080808;
  font-size: 10px;
  font-style: normal;
  font-weight: 700;
  line-height: 1.2;
  text-align: center;
}

.discovery-listing-copy {
  display: grid;
  gap: 3px;
  min-width: 0;
  padding: 0 1px;
}

.discovery-listing-copy .discovery-card-brand {
  color: rgba(29, 29, 31, 0.48);
  font-size: 10px;
  font-weight: 700;
}

.discovery-listing-copy strong {
  color: #1d1d1f;
  overflow: hidden;
  font-size: 13px;
  font-weight: 650;
  line-height: 1.25;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.discovery-listing-copy span {
  overflow: hidden;
  color: rgba(29, 29, 31, 0.48);
  font-size: 10px;
  font-style: normal;
  line-height: 1.35;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.runway-figure {
  position: relative;
  display: inline-block;
  width: 38px;
  height: 72px;
  color: rgba(29, 29, 31, 0.16);
}

.runway-figure.small {
  width: 30px;
  height: 58px;
}

.runway-figure.large {
  width: 44px;
  height: 84px;
}

.runway-figure span {
  position: absolute;
  display: block;
  background: currentColor;
}

.figure-head {
  top: 0;
  left: 50%;
  width: 42%;
  aspect-ratio: 1;
  border-radius: 50%;
  transform: translateX(-50%);
}

.figure-body {
  top: 22%;
  left: 26%;
  width: 48%;
  height: 40%;
  border-radius: 18% 18% 8% 8%;
}

.figure-arm.left,
.figure-arm.right {
  top: 28%;
  width: 20%;
  height: 28%;
  border-radius: 30%;
}

.figure-arm.left {
  left: 2%;
}

.figure-arm.right {
  right: 2%;
}

.figure-leg.left,
.figure-leg.right {
  bottom: 0;
  width: 22%;
  height: 39%;
  border-radius: 22%;
}

.figure-leg.left {
  left: 24%;
}

.figure-leg.right {
  right: 24%;
}

.discovery-home > .site-footer.landing {
  position: static;
  width: auto;
  min-height: 42px;
  margin: 0;
  border-color: rgba(29, 29, 31, 0.08);
  background: #f5f5f7;
  color: rgba(29, 29, 31, 0.58);
}

@media (hover: hover) and (pointer: fine) {
  .discovery-collection-card:hover .discovery-card-image,
  .discovery-listing-card:hover .discovery-listing-figure,
  .discovery-listing-card:hover .discovery-listing-image img {
    transform: scale(1.04);
  }

  .discovery-listing-card:hover .discovery-listing-image img {
    filter: brightness(0.76) saturate(0.9) contrast(1);
  }

  .discovery-collection-card:hover .discovery-collection-overlay,
  .discovery-listing-card:hover .discovery-listing-overlay {
    opacity: 1;
  }

  .discovery-line-card:hover .discovery-line-logo-card {
    background:
      linear-gradient(145deg, rgba(255, 255, 255, 1), rgba(250, 250, 250, 0.86)),
      #ffffff;
    transform: translateY(-2px);
  }

  .discovery-line-card:hover .discovery-line-logo-card.has-logo {
    background: transparent;
  }

  .discovery-line-card:hover .discovery-line-logo-card.has-logo img {
    opacity: 1;
    transform: scale(1.045);
  }
}

@media (hover: none), (pointer: coarse) {
  .discovery-collection-overlay,
  .discovery-listing-overlay {
    display: none;
  }

  .listing-image-button .listing-hover-meta {
    display: none;
  }

  .listing-image-button {
    touch-action: pan-y;
  }

  .listing-runway-image.mobile-active {
    opacity: 1;
  }

  .listing-mobile-image-dots {
    display: flex;
  }

  .discovery-card-image,
  .discovery-listing-image img,
  .discovery-listing-figure,
  .discovery-line-logo-card {
    transition: none;
  }
}

@media (max-width: 760px) {
  .discovery-nav {
    grid-template-columns: auto 1fr auto;
    gap: 10px;
    padding: 0 16px;
  }

  .discovery-logo {
    font-size: 13px;
  }

  .discovery-nav-links {
    justify-content: center;
    overflow: hidden;
  }

  .discovery-nav-links button {
    padding: 0 6px;
    font-size: 11px;
  }

  .discovery-nav-actions {
    gap: 8px;
  }

  .discovery-icon-button {
    display: none;
  }

  .discovery-nav-actions .auth-dropdown {
    right: -4px;
    width: min(300px, calc(100vw - 32px));
  }

  .discovery-hero {
    padding: 12px 10px 22px;
  }

  .discovery-hero-frame {
    min-height: 0;
    height: clamp(560px, calc(100svh - 82px), 760px);
    border-radius: 16px;
  }

  .discovery-hero-media video {
    object-position: 58% top;
  }

  .discovery-hero-copy {
    bottom: 24px;
    left: 16px;
    right: 16px;
    width: auto;
  }

  .discovery-kicker {
    margin-bottom: 9px;
    font-size: 8px;
    line-height: 1.45;
  }

  .discovery-hero-copy h1 {
    font-size: 31px;
  }

  .discovery-description {
    max-width: 300px;
    margin-top: 12px;
    font-size: 12px;
    line-height: 1.48;
  }

  .discovery-hero-actions {
    margin-top: 18px;
  }

  .discovery-primary-button {
    min-height: 46px;
    padding: 0 20px;
    font-size: 9px;
  }

  .discovery-hero-stats {
    gap: 18px;
    margin-top: 16px;
  }

  .discovery-stat strong {
    font-size: 19px;
  }

  .discovery-stat span {
    font-size: 8px;
  }

  .discovery-sections {
    gap: 42px;
    padding: 36px 16px 42px;
  }

  .discovery-shelf {
    padding-bottom: 46px;
  }

  .discovery-shelf-head {
    align-items: flex-start;
    gap: 16px;
    margin-bottom: 18px;
  }

  .discovery-shelf-head h2 {
    font-size: 24px;
  }

  .discovery-shelf-head p {
    display: block;
    margin: 6px 0 0;
    font-size: 12px;
  }

  .discovery-collection-card {
    width: 162px;
  }

  .discovery-line-card {
    width: min(292px, calc(100vw - 52px));
  }

  .discovery-line-card.is-compact-label {
    width: min(232px, calc(100vw - 52px));
  }

  .discovery-line-card.is-compact-label .discovery-line-logo-card {
    height: 97px;
  }

  .discovery-line-logo-card {
    padding: 16px;
  }

  .discovery-line-logo-card.has-logo {
    padding: 0;
  }

  .discovery-line-logo-box {
    inset: 0;
  }

  .discovery-line-logo-placeholder {
    font-size: 20px;
  }

  .discovery-listing-card,
  .discovery-wanted-card {
    width: 144px;
  }

  .listing-image-button {
    touch-action: pan-y;
  }

  .listing-image-button:hover img {
    transform: none;
  }

  .listing-tile:hover .listing-runway-image:not(.mobile-active),
  .listing-image-button:focus-visible .listing-runway-image:not(.mobile-active) {
    opacity: 0;
  }

  .listing-runway-image.mobile-active {
    opacity: 1;
  }

  .listing-mobile-image-dots {
    display: flex;
  }

  .listing-image-button .listing-hover-meta {
    display: none;
  }

  .discovery-card-copy {
    gap: 2px;
    padding: 10px 9px;
  }

  .discovery-listing-copy {
    gap: 3px;
  }

  .discovery-card-brand {
    font-size: 8px;
    line-height: 1.3;
  }

  .discovery-card-title,
  .discovery-listing-copy strong {
    font-size: 12px;
  }

  .discovery-card-season,
  .discovery-card-stats,
  .discovery-listing-copy span {
    font-size: 9px;
  }

  .discovery-card-stats {
    gap: 7px;
    margin-top: 3px;
  }
}

@font-face {
  font-family: Akrobat;
  font-style: normal;
  font-weight: 600;
  src: url("https://www.hlorenzo.com/cdn/shop/t/105/assets/Akrobat-Bold.otf?v=81138174103905458901777992773") format("opentype");
}

@font-face {
  font-family: Akrobat;
  font-style: normal;
  font-weight: 700;
  src: url("https://www.hlorenzo.com/cdn/shop/t/105/assets/Akrobat-Bold.otf?v=81138174103905458901777992773") format("opentype");
}

:root {
  --button-radius: 8px;
  --kaayd-blue: #1f62e8;
  --kaayd-blue-hover: #164fbf;
  color: #121212;
  background: #fff;
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-synthesis: none;
  text-rendering: optimizeLegibility;
  -webkit-font-smoothing: antialiased;
}

* {
  box-sizing: border-box;
}

body {
  margin: 0;
  min-width: 320px;
  min-height: 100vh;
  background: #fff;
}

button,
input {
  font: inherit;
}

button {
  cursor: pointer;
}

h1,
h2,
h3,
p {
  margin: 0;
}

a {
  color: inherit;
}

.logo-link {
  display: inline-flex;
  align-items: center;
  margin: 0;
  padding: 0;
  border: 0;
  background: transparent;
  color: #121212;
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 24px;
  font-weight: 400;
  letter-spacing: 0;
}

.logo-link::before {
  display: none;
}

.back-link:hover,
.title-button:hover,
.back-button:hover {
  color: #ea3b0c;
}

.eyebrow {
  display: block;
  margin-bottom: 12px;
  color: #77736a;
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.brand-landing {
  min-height: 100vh;
  padding: 0 44px 76px;
  background: #fff;
}

.brand-landing.home-page {
  padding: 0;
  background: #121212;
}

.kayded-landing {
  min-height: 100vh;
  background: #fff;
  color: #211f1b;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
}

.kayded-hero {
  position: relative;
  display: grid;
  gap: 0;
  min-height: 100vh;
  padding: 0;
}

.kayded-hero-frame {
  position: relative;
  min-height: 100vh;
  overflow: hidden;
  background: #211f1b;
  isolation: isolate;
}

.kayded-wordmark {
  position: absolute;
  top: 32px;
  left: 36px;
  z-index: 3;
  padding: 0;
  border: 0;
  background: transparent;
  color: #f6f0e7;
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 38px;
  font-weight: 400;
  letter-spacing: 0.26em;
  text-transform: uppercase;
}

.kayded-floating-actions {
  position: absolute;
  top: 34px;
  right: 36px;
  z-index: 4;
  display: flex;
  align-items: center;
  justify-content: flex-end;
  gap: 18px;
  color: #f6f0e7;
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  font-weight: 500;
  letter-spacing: 0.12em;
  text-transform: uppercase;
}

.kayded-floating-actions button {
  border: 0;
  background: transparent;
  color: inherit;
}

.kayded-wordmark:hover,
.kayded-floating-actions button:hover {
  color: #f2a56b;
}

.kayded-hero-image {
  position: absolute;
  inset: 0;
  z-index: -2;
  background: #121212;
}

.kayded-hero-image video {
  width: 100%;
  height: 100%;
  object-fit: cover;
  object-position: center top;
}

.kayded-hero-image::after {
  position: absolute;
  inset: 0;
  content: "";
  background:
    linear-gradient(180deg, rgba(18, 18, 18, 0.22), rgba(18, 18, 18, 0.08) 38%, rgba(18, 18, 18, 0.58)),
    linear-gradient(90deg, rgba(18, 18, 18, 0.66), rgba(18, 18, 18, 0.04) 62%);
}

.kayded-hero-copy {
  position: absolute;
  right: 44px;
  bottom: 46px;
  left: 44px;
  z-index: 1;
  max-width: 980px;
  color: #f6f0e7;
  animation: kayded-fade-up 900ms cubic-bezier(0.19, 1, 0.22, 1) 180ms both;
}

.kayded-hero-copy h1 {
  font-family: "Playfair Display", Georgia, "Times New Roman", serif;
  font-size: 164px;
  font-weight: 700;
  letter-spacing: 0;
  line-height: 0.78;
}

.kayded-hero-copy h1 span {
  display: inline-block;
  margin-left: 128px;
  font-family: "Playfair Display", Georgia, "Times New Roman", serif;
  font-style: italic;
  font-weight: 400;
}

.kayded-hero-lower {
  display: flex;
  align-items: end;
  justify-content: space-between;
  gap: 32px;
  margin-top: 28px;
}

.kayded-hero-lower p {
  font-family: "JetBrains Mono", monospace;
  max-width: 360px;
  color: rgba(246, 240, 231, 0.74);
  font-size: 15px;
  line-height: 1.55;
}

.kayded-hero-cta {
  display: inline-flex;
  min-height: 52px;
  align-items: center;
  gap: 16px;
  padding: 0 28px;
  border: 0;
  background: #211f1b;
  color: #f6f0e7;
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  font-weight: 500;
  letter-spacing: 0.12em;
  text-transform: uppercase;
}

.kayded-hero-cta:hover {
  background: #c06f45;
}

.kayded-hero-cta span {
  display: block;
  width: 18px;
  height: 1px;
  background: currentColor;
  transition: width 160ms ease;
}

.kayded-hero-cta:hover span {
  width: 34px;
}

.kayded-artifacts {
  position: relative;
  isolation: isolate;
  display: grid;
  place-items: center;
  height: 100vh;
  min-height: 100vh;
  padding: 0 clamp(28px, 4vw, 54px);
  overflow: hidden;
  background: #fff;
}

.kayded-spotlight-copy {
  position: relative;
  z-index: 2;
  display: grid;
  justify-items: center;
  max-width: min(620px, 44vw);
  text-align: center;
}

.kayded-spotlight-copy span {
  margin-bottom: clamp(22px, 2.3vw, 34px);
  color: rgba(17, 17, 17, 0.38);
  font-family: "JetBrains Mono", monospace;
  font-size: clamp(10px, 0.78vw, 14px);
  font-weight: 600;
  letter-spacing: 0.24em;
  line-height: 1;
  text-transform: uppercase;
}

.kayded-spotlight-copy h2 {
  margin: 0;
  color: #111;
  font-family: "Playfair Display", Georgia, "Times New Roman", serif;
  font-size: clamp(76px, 7.1vw, 136px);
  font-style: normal;
  font-weight: 600;
  letter-spacing: 0;
  line-height: 0.89;
}

.kayded-spotlight-copy p {
  max-width: none;
  margin: clamp(30px, 3vw, 48px) 0 0;
  color: rgba(17, 17, 17, 0.48);
  font-family: "JetBrains Mono", monospace;
  font-size: clamp(10px, 0.78vw, 14px);
  font-weight: 600;
  letter-spacing: 0.16em;
  line-height: 1.2;
  text-transform: uppercase;
}

.kayded-landing-footer {
  position: relative;
  display: grid;
  min-height: 76vh;
  align-content: center;
  padding: 108px 44px 104px;
  background: #211f1b;
  color: #f6f0e7;
  text-align: center;
}

.kayded-landing-footer h2 {
  max-width: 760px;
  margin: 0 auto;
  font-family: "Playfair Display", Georgia, "Times New Roman", serif;
  font-size: 58px;
  font-weight: 400;
  line-height: 1.02;
}

.kayded-landing-footer p {
  max-width: 420px;
  margin: 34px auto 0;
  color: rgba(246, 240, 231, 0.56);
  font-family: "JetBrains Mono", monospace;
  font-size: 13px;
  font-weight: 500;
  letter-spacing: 0.08em;
  line-height: 1.6;
  text-transform: uppercase;
}

.kayded-landing-footer > button {
  min-height: 54px;
  margin-top: 44px;
  padding: 0 42px;
  border: 1px solid rgba(246, 240, 231, 0.78);
  background: transparent;
  color: #f6f0e7;
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  font-weight: 500;
  letter-spacing: 0.16em;
  text-transform: uppercase;
}

.kayded-landing-footer > button:hover {
  background: #f6f0e7;
  color: #211f1b;
}

.waitlist-modal-backdrop {
  position: fixed;
  inset: 0;
  z-index: 30;
  display: grid;
  place-items: center;
  padding: 28px;
  background:
    linear-gradient(180deg, rgba(18, 18, 18, 0.42), rgba(18, 18, 18, 0.76)),
    rgba(18, 18, 18, 0.34);
  backdrop-filter: blur(14px);
}

.change-password-modal-backdrop {
  padding: 18px;
  background:
    linear-gradient(180deg, rgba(8, 8, 8, 0.34), rgba(8, 8, 8, 0.72)),
    rgba(8, 8, 8, 0.38);
  backdrop-filter: blur(18px);
}

.waitlist-modal {
  position: relative;
  width: min(720px, 100%);
  max-height: min(860px, calc(100vh - 56px));
  overflow: auto;
  border: 1px solid rgba(246, 240, 231, 0.18);
  background:
    linear-gradient(135deg, rgba(246, 240, 231, 0.98), rgba(231, 220, 205, 0.96)),
    #f6f0e7;
  box-shadow: 0 36px 90px rgba(0, 0, 0, 0.38);
  color: #211f1b;
}

.waitlist-close-button {
  position: absolute;
  top: 18px;
  right: 18px;
  z-index: 1;
  display: inline-flex;
  width: 38px;
  height: 38px;
  align-items: center;
  justify-content: center;
  border: 1px solid rgba(33, 31, 27, 0.14);
  background: rgba(246, 240, 231, 0.64);
  color: #211f1b;
}

.waitlist-close-button:hover {
  background: #211f1b;
  color: #f6f0e7;
}

.change-password-modal {
  display: grid;
  gap: 14px;
  width: min(332px, 100%);
  padding: 16px;
  border: 1px solid rgba(255, 255, 255, 0.12);
  border-radius: 8px;
  background: rgba(10, 10, 10, 0.94);
  box-shadow: 0 24px 54px rgba(0, 0, 0, 0.44);
  color: #fefbf7;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
}

.change-password-heading {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 12px;
  padding-bottom: 2px;
}

.change-password-heading h2 {
  margin: 0;
  color: #fefbf7;
  font-size: 13px;
  font-weight: 600;
  line-height: 1.25;
}

.change-password-heading button {
  display: inline-flex;
  width: 28px;
  height: 28px;
  align-items: center;
  justify-content: center;
  border: 0;
  border-radius: 6px;
  background: transparent;
  color: rgba(254, 251, 247, 0.48);
}

.change-password-heading button svg {
  width: 15px;
  height: 15px;
  stroke-width: 1.7;
}

.change-password-heading button:hover,
.change-password-heading button:focus-visible {
  background: rgba(255, 255, 255, 0.06);
  color: #ffffff;
}

.change-password-modal .auth-dropdown-field {
  min-height: 36px;
  border-bottom-color: rgba(254, 251, 247, 0.18);
  color: rgba(254, 251, 247, 0.46);
}

.change-password-modal .auth-dropdown-field svg {
  width: 14px;
  height: 14px;
  stroke-width: 1.7;
}

.change-password-modal .auth-dropdown-field input {
  color: #fefbf7;
  font-family: inherit;
  font-size: 12px;
  caret-color: #fefbf7;
}

.change-password-modal .auth-dropdown-field input::placeholder {
  color: rgba(254, 251, 247, 0.42);
}

.change-password-modal .auth-dropdown-field:focus-within {
  border-bottom-color: rgba(254, 251, 247, 0.34);
  color: rgba(254, 251, 247, 0.68);
}

.change-password-modal .password-visibility-toggle,
.change-password-modal .auth-dropdown-submit {
  color: rgba(254, 251, 247, 0.54);
}

.change-password-modal .password-visibility-toggle:hover,
.change-password-modal .password-visibility-toggle:focus-visible,
.change-password-modal .auth-dropdown-submit:hover {
  color: #fefbf7;
}

.change-password-modal .password-visibility-toggle svg,
.change-password-modal .auth-dropdown-submit svg {
  width: 14px;
  height: 14px;
  stroke-width: 1.7;
}

.change-password-modal .auth-error {
  color: #ff8a66;
  font-size: 11px;
  text-align: left;
}

.change-password-modal .auth-dropdown-submit {
  margin-top: 2px;
  justify-content: center;
  min-height: 30px;
  padding: 0 13px;
  border: 1px solid rgba(254, 251, 247, 0.16);
  border-radius: 6px;
  background: rgba(254, 251, 247, 0.08);
  font-family: inherit;
  font-size: 11px;
  font-weight: 600;
  letter-spacing: 0;
  text-transform: none;
}

.change-password-modal .auth-dropdown-submit:not(:disabled) {
  cursor: pointer;
}

.change-password-modal .auth-dropdown-submit:hover {
  background: rgba(254, 251, 247, 0.13);
}

.change-password-modal .auth-dropdown-submit:disabled {
  cursor: default;
}

.delete-confirm-layer {
  position: fixed;
  right: 22px;
  bottom: 22px;
  z-index: 120;
  width: min(360px, calc(100vw - 32px));
  pointer-events: none;
}

.delete-confirm-modal {
  display: grid;
  gap: 14px;
  width: 100%;
  padding: 14px;
  border: 1px solid rgba(18, 18, 18, 0.1);
  border-radius: 10px;
  background: rgba(255, 255, 255, 0.97);
  box-shadow: 0 14px 42px rgba(18, 18, 18, 0.16), 0 1px 6px rgba(18, 18, 18, 0.08);
  color: #121212;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  pointer-events: auto;
}

.delete-confirm-heading {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 12px;
}

.delete-confirm-heading h2 {
  margin: 0;
  color: #121212;
  font-size: 13px;
  font-weight: 650;
  line-height: 1.25;
}

.delete-confirm-heading button {
  display: inline-flex;
  width: 28px;
  height: 28px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 0;
  background: transparent;
  color: rgba(18, 18, 18, 0.48);
}

.delete-confirm-heading button:hover:not(:disabled) {
  background: rgba(18, 18, 18, 0.06);
  color: #121212;
}

.delete-confirm-modal p {
  margin: 0;
  color: rgba(18, 18, 18, 0.62);
  font-size: 12px;
  line-height: 1.45;
}

.delete-confirm-actions {
  display: grid;
  grid-template-columns: 1fr 1fr;
  gap: 10px;
}

.delete-confirm-cancel,
.delete-confirm-primary {
  display: inline-flex;
  min-height: 40px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  padding: 0 14px;
  border: 0;
  font-size: 12px;
  font-weight: 750;
  letter-spacing: 0;
}

.delete-confirm-cancel {
  background: #f3f5f8;
  color: #121212;
}

.delete-confirm-primary {
  background: #f04438;
  color: #fff;
}

.delete-confirm-cancel:hover:not(:disabled) {
  background: #e8ebef;
}

.delete-confirm-primary:hover:not(:disabled) {
  background: #d92d20;
}

.delete-confirm-cancel:disabled,
.delete-confirm-primary:disabled {
  cursor: default;
  opacity: 0.58;
}

@media (max-width: 620px), (hover: none), (pointer: coarse) {
  .delete-confirm-layer {
    top: 0;
    right: 0;
    bottom: 0;
    left: 0;
    display: grid;
    width: auto;
    height: auto;
    max-height: none;
    align-items: center;
    justify-items: center;
    overflow: hidden;
    pointer-events: none;
    padding:
      max(16px, env(safe-area-inset-top))
      max(14px, env(safe-area-inset-right))
      max(16px, env(safe-area-inset-bottom))
      max(14px, env(safe-area-inset-left));
  }

  .delete-confirm-modal {
    width: min(340px, 100%);
    max-height: calc(100vh - 32px - env(safe-area-inset-top) - env(safe-area-inset-bottom));
    overflow: auto;
  }

  .delete-confirm-actions {
    grid-template-columns: 1fr;
  }
}

.waitlist-form,
.waitlist-success {
  display: grid;
  gap: 22px;
  padding: 42px;
}

.waitlist-heading {
  max-width: 520px;
  padding-right: 40px;
}

.waitlist-kicker,
.waitlist-choice-group legend,
.waitlist-field span {
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  font-weight: 600;
  letter-spacing: 0.14em;
  text-transform: uppercase;
}

.waitlist-kicker {
  margin: 0 0 12px;
  color: #9f5738;
}

.waitlist-heading h2,
.waitlist-success h2 {
  margin: 0;
  font-family: "Playfair Display", Georgia, "Times New Roman", serif;
  font-size: 54px;
  font-weight: 500;
  letter-spacing: 0;
  line-height: 0.96;
}

.waitlist-heading p,
.waitlist-success p {
  margin: 16px 0 0;
  max-width: 460px;
  color: rgba(33, 31, 27, 0.62);
  font-family: "JetBrains Mono", monospace;
  font-size: 12px;
  font-weight: 500;
  letter-spacing: 0.04em;
  line-height: 1.65;
  text-transform: uppercase;
}

.waitlist-field {
  display: grid;
  gap: 9px;
}

.waitlist-field span,
.waitlist-choice-group legend {
  color: rgba(33, 31, 27, 0.58);
}

.waitlist-field input,
.waitlist-field textarea {
  width: 100%;
  border: 1px solid rgba(33, 31, 27, 0.16);
  outline: 0;
  background: rgba(254, 251, 247, 0.68);
  color: #211f1b;
  font: inherit;
  font-size: 14px;
}

.waitlist-field input {
  min-height: 48px;
  padding: 0 14px;
}

.waitlist-field textarea {
  min-height: 112px;
  padding: 13px 14px;
  resize: vertical;
}

.waitlist-field input:focus,
.waitlist-field textarea:focus {
  border-color: #9f5738;
  box-shadow: 0 0 0 3px rgba(159, 87, 56, 0.12);
}

.waitlist-field input::placeholder,
.waitlist-field textarea::placeholder {
  color: rgba(33, 31, 27, 0.38);
}

.waitlist-choice-group {
  display: grid;
  gap: 12px;
  min-width: 0;
  margin: 0;
  padding: 0;
  border: 0;
}

.waitlist-segmented,
.waitlist-brand-grid {
  display: grid;
  gap: 8px;
}

.waitlist-segmented {
  grid-template-columns: repeat(3, minmax(0, 1fr));
  padding: 4px;
  background: rgba(33, 31, 27, 0.08);
}

.waitlist-brand-grid {
  grid-template-columns: repeat(3, minmax(0, 1fr));
}

.waitlist-segmented label,
.waitlist-brand-grid label {
  position: relative;
  display: flex;
  min-height: 42px;
  align-items: center;
  justify-content: center;
  border: 1px solid rgba(33, 31, 27, 0.12);
  background: rgba(254, 251, 247, 0.5);
  color: rgba(33, 31, 27, 0.68);
  cursor: pointer;
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  font-weight: 600;
  letter-spacing: 0.08em;
  line-height: 1.3;
  text-align: center;
  text-transform: uppercase;
}

.waitlist-segmented label.active,
.waitlist-brand-grid label.active {
  border-color: #211f1b;
  background: #211f1b;
  color: #f6f0e7;
}

.waitlist-segmented label:has(input:focus-visible),
.waitlist-brand-grid label:has(input:focus-visible) {
  box-shadow: 0 0 0 3px rgba(159, 87, 56, 0.18);
}

.waitlist-segmented input,
.waitlist-brand-grid input {
  position: absolute;
  opacity: 0;
  pointer-events: none;
}

.waitlist-submit-button,
.waitlist-success button {
  display: inline-flex;
  min-height: 52px;
  align-items: center;
  justify-content: center;
  gap: 10px;
  justify-self: start;
  padding: 0 28px;
  border: 0;
  background: #211f1b;
  color: #f6f0e7;
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  font-weight: 600;
  letter-spacing: 0.14em;
  text-transform: uppercase;
}

.waitlist-submit-button:hover,
.waitlist-success button:hover {
  background: #9f5738;
}

.waitlist-success {
  min-height: 460px;
  align-content: center;
}

.waitlist-success-icon {
  display: inline-flex;
  width: 54px;
  height: 54px;
  align-items: center;
  justify-content: center;
  border: 1px solid rgba(33, 31, 27, 0.18);
  background: #211f1b;
  color: #f6f0e7;
}

.site-footer {
  display: grid;
  grid-template-columns: minmax(0, 1fr) auto minmax(0, 1fr);
  width: 100vw;
  min-height: 38px;
  align-items: center;
  gap: 24px;
  margin: 0 0 0 calc(50% - 50vw);
  padding: 0 24px;
  border-top: 1px solid #e5e4e2;
  background: #fefbf7;
  color: #8a857d;
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  font-weight: 500;
  letter-spacing: 0.14em;
  line-height: 1.2;
  text-transform: uppercase;
}

.browse-area > .site-footer {
  margin-top: 64px;
  margin-bottom: -76px;
}

.listing-page > .site-footer {
  margin-top: 64px;
  margin-bottom: 0;
}

.wishlist-page > .site-footer {
  margin-top: 64px;
}

.manual-review-page > .site-footer {
  margin-top: 64px;
  margin-bottom: 0;
}

.manual-review-reason-page > .site-footer {
  margin-top: auto;
  margin-bottom: 0;
}

.site-footer.landing {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1;
  width: 100%;
  min-height: 38px;
  max-width: none;
  margin: 0;
  padding: 0 24px;
  border-top: 1px solid rgba(246, 240, 231, 0.12);
  background: transparent;
  color: rgba(246, 240, 231, 0.46);
}

.site-footer.browse {
  border-color: rgba(18, 18, 18, 0.12);
  color: #8a857d;
}

.site-footer nav {
  display: flex;
  flex-wrap: wrap;
  grid-column: 2;
  justify-content: center;
  gap: 0;
}

.site-footer > span {
  justify-self: start;
}

.site-footer > a {
  justify-self: end;
}

.site-footer a,
.site-footer button {
  padding: 0;
  border: 0;
  background: transparent;
  color: inherit;
  font: inherit;
  letter-spacing: inherit;
  text-decoration: none;
  text-transform: inherit;
}

.site-footer a:hover,
.site-footer button:hover {
  color: #111;
  text-decoration: underline;
  text-underline-offset: 3px;
}

.site-footer.landing a:hover,
.site-footer.landing button:hover {
  color: #f6f0e7;
}

.footer-separator {
  color: #8a857d;
  margin: 0 8px;
}

.site-footer.landing .footer-separator {
  color: rgba(246, 240, 231, 0.46);
}

@keyframes kayded-fade-up {
  from {
    opacity: 0;
    transform: translateY(20px);
  }

  to {
    opacity: 1;
    transform: translateY(0);
  }
}

@keyframes kayded-ticker {
  from {
    transform: translateX(0);
  }

  to {
    transform: translateX(-50%);
  }
}

@media (max-width: 980px) {
  .kayded-wordmark {
    top: 24px;
    left: 24px;
    font-size: 26px;
    letter-spacing: 0.2em;
  }

  .kayded-floating-actions {
    top: 24px;
    right: 24px;
    gap: 16px;
    font-size: 10px;
  }

  .kayded-hero {
    min-height: 100vh;
    padding: 0;
  }

  .kayded-hero-frame {
    min-height: 100vh;
  }

  .kayded-hero-copy {
    right: 24px;
    bottom: 28px;
    left: 24px;
  }

  .kayded-hero-copy h1 {
    font-size: 104px;
  }

  .kayded-hero-copy h1 span {
    margin-left: 54px;
  }

  .kayded-hero-lower {
    align-items: flex-start;
    flex-direction: column;
  }

  .kayded-landing-footer {
    padding-right: 20px;
    padding-left: 20px;
  }

  .kayded-landing-footer h2 {
    font-size: 42px;
  }
}

@media (max-width: 620px) {
  .kayded-floating-actions {
    gap: 12px;
  }

  .kayded-wordmark {
    font-size: 21px;
    letter-spacing: 0.16em;
  }

  .kayded-floating-actions .auth-dropdown {
    right: 0;
    left: auto;
  }

  .kayded-hero-frame {
    min-height: 100vh;
  }

  .kayded-hero-copy h1 {
    font-size: 68px;
  }

  .kayded-hero-copy h1 span {
    margin-left: 36px;
  }

  .kayded-hero-cta {
    width: 100%;
    justify-content: space-between;
  }

  .kayded-artifacts {
    height: 100svh;
    min-height: 100svh;
    padding: 0 18px;
  }

  .kayded-spotlight-copy {
    max-width: min(420px, 88vw);
    transform: translateY(2vh);
  }

  .kayded-spotlight-copy span {
    margin-bottom: 18px;
    font-size: 9px;
  }

  .kayded-spotlight-copy h2 {
    font-size: clamp(48px, 14.5vw, 78px);
  }

  .kayded-spotlight-copy p {
    max-width: 300px;
    font-size: 10px;
  }

  .kayded-landing-footer {
    min-height: 68vh;
  }

  .kayded-landing-footer h2 {
    font-size: 34px;
  }

  .waitlist-modal-backdrop {
    align-items: end;
    padding: 12px;
  }

  .waitlist-modal-backdrop.change-password-modal-backdrop {
    align-items: center;
    justify-items: center;
    padding: 18px;
  }

  .waitlist-modal {
    max-height: calc(100vh - 24px);
    width: 100%;
  }

  .waitlist-form,
  .waitlist-success {
    gap: 18px;
    padding: 30px 18px 22px;
  }

  .waitlist-heading {
    padding-right: 44px;
  }

  .waitlist-heading h2,
  .waitlist-success h2 {
    font-size: 38px;
  }

  .waitlist-segmented,
  .waitlist-brand-grid {
    grid-template-columns: 1fr;
  }

}

.brand-landing-hero {
  position: relative;
  display: grid;
  min-height: 92vh;
  margin: 0 -44px 44px;
  overflow: hidden;
  background:
    #121212 url("https://media.showstudio.com/images/Comme_des_Garcons_AW25_Menswear_035.width-2400_XuB3aLHJeMhDTcHi.jpg") center / cover;
  color: #fefbf7;
}

.home-page .brand-landing-hero {
  min-height: 100vh;
  margin: 0;
}

.landing-video {
  position: absolute;
  inset: 0;
  width: 100%;
  height: 100%;
  object-fit: cover;
}

.landing-video-shade {
  position: absolute;
  inset: 0;
  background:
    linear-gradient(180deg, rgba(18, 18, 18, 0.36), rgba(18, 18, 18, 0.06) 32%, rgba(18, 18, 18, 0.72)),
    linear-gradient(90deg, rgba(18, 18, 18, 0.72), rgba(18, 18, 18, 0.08) 62%);
}

.logged-out-video-shade {
  background:
    linear-gradient(180deg, rgba(18, 18, 18, 0.82), rgba(18, 18, 18, 0.72) 34%, rgba(18, 18, 18, 0.94)),
    linear-gradient(90deg, rgba(18, 18, 18, 0.92), rgba(18, 18, 18, 0.58) 58%, rgba(18, 18, 18, 0.82));
}

.brand-landing-nav {
  position: absolute;
  top: 0;
  right: 0;
  left: 0;
  z-index: 1;
  display: flex;
  align-items: center;
  justify-content: space-between;
  min-height: 96px;
  padding: 0 44px;
}

.brand-landing-nav .logo-link {
  color: #fefbf7;
}

.brand-landing-nav nav {
  display: flex;
  gap: 30px;
  align-items: center;
  color: rgba(254, 251, 247, 0.86);
  font-size: 12px;
  letter-spacing: 0.02em;
}

.brand-landing-nav nav button {
  padding: 0;
  border: 0;
  background: transparent;
  color: inherit;
  font-size: inherit;
  letter-spacing: inherit;
}

.brand-landing-nav nav button:hover {
  color: #fefbf7;
}

.brand-landing-nav .auth-links {
  display: inline-flex;
  align-items: center;
  gap: 8px;
}

.brand-landing-nav .auth-links span {
  color: rgba(254, 251, 247, 0.46);
}

.landing-logo {
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 1em;
  font-weight: 700;
  letter-spacing: 0.8em;
  text-transform: uppercase;
}

.brand-landing-copy {
  position: relative;
  z-index: 1;
  align-self: end;
  max-width: 860px;
  padding: 0 44px 72px;
}

.brand-landing-action {
  position: absolute;
  bottom: 54px;
  left: 50%;
  z-index: 1;
  padding-bottom: 0;
  transform: translateX(-50%);
}

.brand-landing-action::after {
  content: "";
  position: absolute;
  top: -30px;
  left: 100%;
  width: 34px;
  height: 86px;
}

.brand-landing-copy h1,
.collection-header h2,
.listing-detail-content h1 {
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-weight: 400;
  letter-spacing: 0;
}

.brand-landing-copy .eyebrow {
  color: rgba(254, 251, 247, 0.72);
}

.brand-landing-copy h1 {
  font-size: 82px;
  line-height: 0.94;
}

.brand-landing-copy p {
  max-width: 540px;
  margin-top: 20px;
  color: rgba(254, 251, 247, 0.82);
  font-size: 16px;
  line-height: 1.55;
}

.hero-link {
  display: inline-flex;
  margin-top: 30px;
  padding-bottom: 5px;
  border: 0;
  border-bottom: 1px solid currentColor;
  background: transparent;
  color: #fefbf7;
  font-size: 12px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-decoration: none;
  text-transform: uppercase;
}

.brand-landing-action .hero-link {
  margin-top: 0;
}

.home-brand-selector {
  position: absolute;
  top: 50%;
  left: calc(100% + 26px);
  display: grid;
  grid-template-columns: max-content auto;
  grid-template-rows: auto auto auto;
  align-items: center;
  column-gap: 7px;
  width: max-content;
  color: #fff;
  opacity: 0;
  pointer-events: none;
  transform: translateY(-50%) translateX(-8px);
  transition: opacity 180ms ease, transform 180ms ease;
}

.brand-landing-action:hover .home-brand-selector,
.brand-landing-action:focus-within .home-brand-selector {
  opacity: 1;
  pointer-events: auto;
  transform: translateY(-50%) translateX(0);
}

.home-brand-selector-window {
  grid-column: 1;
  grid-row: 1 / 4;
  display: grid;
  gap: 5px;
  max-width: 360px;
  overflow: hidden;
  mask-image: linear-gradient(180deg, transparent, #000 22%, #000 78%, transparent);
}

.home-brand-selector::before {
  content: "";
  position: absolute;
  top: 50%;
  left: -17px;
  width: 11px;
  height: 1px;
  background: rgba(254, 251, 247, 0.68);
  transform: translateY(-50%);
}

.home-brand-selector button {
  display: block;
  padding: 0;
  border: 0;
  background: transparent;
  color: inherit;
}

.home-brand-selector-arrow {
  grid-column: 2;
  width: 18px;
  height: 18px;
  color: rgba(254, 251, 247, 0.9);
  font-size: 13px;
  line-height: 18px;
  text-align: center;
  text-shadow: 0 1px 10px rgba(0, 0, 0, 0.36);
}

.home-brand-selector-arrow:first-child {
  grid-row: 1;
}

.home-brand-selector-arrow:last-child {
  grid-row: 3;
}

.home-brand-selector-arrow:hover {
  color: #fff;
}

.home-brand-selector-arrow:disabled {
  color: rgba(254, 251, 247, 0.28);
  cursor: default;
}

.home-brand-selector-option {
  height: 17px;
  color: rgba(254, 251, 247, 0.9);
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.08em;
  line-height: 17px;
  overflow: hidden;
  text-align: left;
  text-overflow: ellipsis;
  text-transform: uppercase;
  white-space: nowrap;
  text-shadow: 0 1px 12px rgba(0, 0, 0, 0.38);
}

.home-brand-selector-option.active {
  color: #fff;
}

.home-brand-selector-option.muted {
  color: rgba(254, 251, 247, 0.62);
}

.home-brand-selector-option:disabled {
  cursor: default;
}

.home-brand-selector-option.active:disabled {
  color: rgba(254, 251, 247, 0.68);
  cursor: not-allowed;
}

.home-brand-selector-option:not(:disabled):hover {
  color: #fff;
}

.auth-menu {
  position: relative;
  display: inline-flex;
  align-items: center;
  gap: 8px;
}

.auth-nav-button {
  display: inline-flex;
  min-height: 32px;
  align-items: center;
  justify-content: center;
  border-radius: 999px;
  letter-spacing: 0;
  text-transform: none;
}

.discovery-nav-actions .auth-menu > .auth-nav-button {
  min-height: 36px;
  padding: 0 18px;
  border: 1px solid transparent;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 13px;
  font-weight: 650;
  line-height: 1;
  transition:
    background-color 160ms ease,
    border-color 160ms ease,
    box-shadow 160ms ease,
    color 160ms ease,
    transform 160ms ease;
}

.discovery-nav-actions .auth-menu > .auth-nav-secondary {
  color: rgba(29, 29, 31, 0.56);
}

.discovery-nav-actions .auth-menu > .auth-nav-login {
  min-width: 78px;
  border-radius: 9999px;
  border-color: rgba(29, 29, 31, 0.12);
  background: #1d1d1f;
  color: #ffffff;
  box-shadow:
    0 10px 26px rgba(29, 29, 31, 0.12),
    inset 0 1px 0 rgba(255, 255, 255, 0.16);
  backdrop-filter: blur(16px);
}

.discovery-nav-actions .auth-menu > .auth-nav-login:hover,
.discovery-nav-actions .auth-menu > .auth-nav-login:focus-visible {
  border-color: #000000;
  background: #000000;
  color: #ffffff;
  box-shadow:
    0 14px 34px rgba(29, 29, 31, 0.18),
    inset 0 1px 0 rgba(255, 255, 255, 0.18);
  transform: translateY(-1px);
}

.auth-modal {
  width: min(332px, 100%);
}

.auth-screen-backdrop {
  position: fixed;
  inset: 0;
  z-index: 130;
  display: grid;
  place-items: center;
  padding: 24px;
  background: #fff;
}

.auth-screen-card {
  display: grid;
  gap: 14px;
  width: min(396px, 100%);
  padding: 20px;
  border: 1px solid #dddfe2;
  border-radius: 8px;
  background: #fff;
  box-shadow: 0 12px 28px rgb(0 0 0 / .12);
  color: #1c1e21;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
}

.auth-screen-card .change-password-heading {
  padding-bottom: 4px;
}

.auth-screen-card .change-password-heading h2 {
  color: #1c1e21;
  font-size: 20px;
  font-weight: 650;
  letter-spacing: 0;
}

.auth-screen-card .change-password-heading button {
  color: #606770;
  border-radius: 50%;
}

.auth-screen-card .change-password-heading button:hover,
.auth-screen-card .change-password-heading button:focus-visible {
  background: #f0f2f5;
  color: #1c1e21;
}

.auth-screen-card .auth-dropdown-field {
  min-height: 48px;
  padding: 0 13px;
  border: 1px solid #dddfe2;
  border-radius: 6px;
  color: #606770;
}

.auth-screen-card .auth-dropdown-field:focus-within {
  border-color: var(--kaayd-blue);
  color: var(--kaayd-blue);
  box-shadow: 0 0 0 2px rgb(31 98 232 / .12);
}

.auth-screen-card .auth-dropdown-field input {
  color: #1c1e21;
  -webkit-text-fill-color: #1c1e21;
  font-size: 15px;
  caret-color: var(--kaayd-blue);
}

.auth-screen-card .auth-dropdown-field input:-webkit-autofill,
.auth-screen-card .auth-dropdown-field input:-webkit-autofill:hover,
.auth-screen-card .auth-dropdown-field input:-webkit-autofill:focus {
  -webkit-text-fill-color: #1c1e21;
  caret-color: var(--kaayd-blue);
}

.auth-screen-card .auth-dropdown-field input::placeholder {
  color: #8a8d91;
  -webkit-text-fill-color: #8a8d91;
}

.auth-screen-card .password-visibility-toggle {
  color: #606770;
}

.auth-screen-card .password-visibility-toggle:hover,
.auth-screen-card .password-visibility-toggle:focus-visible {
  color: #1c1e21;
}

.auth-screen-card .auth-error {
  color: #b42318;
  font-size: 13px;
  text-align: left;
}

.auth-screen-card .auth-dropdown-submit {
  justify-self: stretch;
  justify-content: center;
  min-height: 48px;
  padding: 0 18px;
  border: 0;
  border-radius: 999px;
  background: var(--kaayd-blue);
  color: #fff;
  font-size: 15px;
  font-weight: 700;
  letter-spacing: 0;
  text-transform: none;
}

.auth-screen-card .auth-dropdown-submit:hover,
.auth-screen-card .auth-dropdown-submit:focus-visible {
  background: var(--kaayd-blue-hover);
  color: #fff;
}

.auth-screen-card .auth-dropdown-submit:disabled {
  cursor: wait;
  opacity: .72;
}

.auth-dropdown {
  position: absolute;
  top: calc(100% + 18px);
  right: 0;
  display: grid;
  gap: 12px;
  width: 300px;
  padding: 18px 0 0;
  color: #fefbf7;
}

.auth-dropdown-submit {
  padding: 0;
  border: 0;
  background: transparent;
  color: rgba(254, 251, 247, 0.66);
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.auth-dropdown-submit:hover {
  color: #fefbf7;
}

.auth-dropdown-field {
  display: flex;
  min-height: 34px;
  align-items: center;
  gap: 9px;
  border-bottom: 1px solid rgba(254, 251, 247, 0.32);
  color: rgba(254, 251, 247, 0.68);
}

.auth-dropdown-field input {
  min-width: 0;
  width: 100%;
  border: 0;
  outline: 0;
  box-shadow: none;
  background: transparent;
  color: #fefbf7;
  font-size: 12px;
  caret-color: #fefbf7;
  appearance: none;
}

.auth-dropdown-field input::placeholder {
  color: rgba(254, 251, 247, 0.52);
}

.password-visibility-toggle {
  display: inline-flex;
  width: 24px;
  height: 24px;
  flex: 0 0 auto;
  align-items: center;
  justify-content: center;
  border: 0;
  background: transparent;
  color: rgba(254, 251, 247, 0.62);
  padding: 0;
}

.password-visibility-toggle:hover,
.password-visibility-toggle:focus-visible {
  color: #fefbf7;
}

.password-visibility-toggle:disabled {
  cursor: wait;
  opacity: 0.54;
}

.auth-dropdown-field:focus-within {
  border-bottom-color: rgba(254, 251, 247, 0.32);
  color: #fefbf7;
}

.auth-dropdown-field input:-webkit-autofill,
.auth-dropdown-field input:-webkit-autofill:hover,
.auth-dropdown-field input:-webkit-autofill:focus {
  border: 0;
  -webkit-text-fill-color: #fefbf7;
  box-shadow: 0 0 0 1000px transparent inset;
  transition: background-color 9999s ease-in-out 0s;
}

.auth-error {
  min-height: 16px;
  color: #ff7a55;
  font-size: 11px;
  text-align: right;
}

.auth-dropdown-submit {
  display: inline-flex;
  align-items: center;
  justify-content: flex-end;
  gap: 7px;
  justify-self: end;
  min-height: 28px;
}

.auth-dropdown-submit:disabled {
  cursor: wait;
  opacity: 0.72;
}

.app-shell {
  display: block;
  min-height: 100vh;
  background: #fff;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  letter-spacing: 0;
}

.app-top-nav {
  position: sticky;
  top: 0;
  z-index: 40;
  display: grid;
  grid-template-columns: 1fr auto 1fr;
  width: 100%;
  min-height: 58px;
  align-items: center;
  gap: 18px;
  max-width: none;
  margin: 0 auto;
  padding: 0 30px;
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
  background: rgba(255, 255, 255, 0.96);
  color: #121212;
  backdrop-filter: blur(18px);
}

.app-top-nav .logo-link {
  font-size: 21px;
  font-weight: 400;
  letter-spacing: 0.22em;
}

.nav-logo {
  grid-column: 2;
  justify-self: center;
}

.brand-nav-menu {
  position: relative;
  grid-column: 1;
  justify-self: start;
  color: #121212;
  font-size: 11px;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.brand-nav-menu summary {
  display: inline-flex;
  min-height: 28px;
  align-items: center;
  gap: 8px;
  padding: 0;
  color: #121212;
  cursor: pointer;
  list-style: none;
}

.brand-nav-menu summary::-webkit-details-marker {
  display: none;
}

.brand-nav-menu summary::after {
  content: "";
  width: 5px;
  height: 5px;
  border-right: 1px solid currentColor;
  border-bottom: 1px solid currentColor;
  transform: translateY(-2px) rotate(45deg);
}

.brand-nav-current {
  max-width: min(280px, 34vw);
  overflow: hidden;
  color: rgba(18, 18, 18, 0.72);
  font-size: 10px;
  font-weight: 600;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.brand-nav-label {
  color: #9a9a9a;
  font-family: "JetBrains Mono", monospace;
  font-size: 8px;
  font-weight: 500;
  letter-spacing: 0.22em;
}

.brand-nav-menu[open] summary,
.brand-nav-menu summary:hover {
  color: #ea3b0c;
}

.brand-nav-dropdown {
  position: absolute;
  top: calc(100% + 12px);
  left: 0;
  z-index: 20;
  display: grid;
  width: min(420px, calc(100vw - 40px));
  gap: 0;
  padding: 10px 14px;
  border: 1px solid rgba(18, 18, 18, 0.16);
  background: #fff;
  box-shadow: 0 18px 36px rgba(18, 18, 18, 0.1);
}

.brand-nav-dropdown button {
  display: flex;
  width: 100%;
  align-items: center;
  justify-content: space-between;
  gap: 24px;
  min-height: 34px;
  padding: 0;
  border: 0;
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
  background: transparent;
  color: #121212;
  font-size: 12px;
  letter-spacing: 0.06em;
  text-align: left;
  text-transform: uppercase;
}

.brand-nav-dropdown button:last-child {
  border-bottom: 0;
}

.brand-nav-dropdown button span {
  min-width: 0;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.brand-nav-dropdown button:hover:not(:disabled) {
  color: #ea3b0c;
}

.brand-nav-dropdown button:disabled {
  color: #9b968d;
  cursor: default;
}

.brand-nav-dropdown em {
  color: #9b968d;
  font-size: 10px;
  font-style: normal;
}

.app-top-nav nav {
  display: flex;
  grid-column: 3;
  align-items: center;
  justify-content: flex-end;
  gap: 16px;
  font-size: 12px;
}

.top-nav-tab {
  padding: 0;
  border: 0;
  background: transparent;
  color: #121212;
  font-size: 11px;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.top-nav-tab.active,
.top-nav-tab:hover {
  color: #ea3b0c;
}

.wishlist-nav-button {
  position: relative;
  display: inline-flex;
  width: 24px;
  height: 24px;
  align-items: center;
  justify-content: center;
}

.wishlist-nav-button span {
  position: absolute;
  top: calc(100% + 10px);
  left: 50%;
  padding: 5px 7px;
  background: #121212;
  color: #fefbf7;
  font-size: 10px;
  line-height: 1;
  opacity: 0;
  pointer-events: none;
  text-transform: uppercase;
  transform: translateX(-50%) translateY(-4px);
  transition: opacity 120ms ease, transform 120ms ease;
  white-space: nowrap;
}

.wishlist-nav-button:hover span,
.wishlist-nav-button:focus-visible span {
  opacity: 1;
  transform: translateX(-50%) translateY(0);
}

.top-nav-user {
  display: inline-flex;
  width: 24px;
  height: 24px;
  align-items: center;
  justify-content: center;
  color: #121212;
  cursor: pointer;
}

.top-nav-user::-webkit-details-marker {
  display: none;
}

.top-nav-user:hover,
.account-menu[open] .top-nav-user {
  color: var(--kaayd-blue);
}

.account-menu {
  position: relative;
  display: inline-flex;
}

.account-dropdown {
  position: absolute;
  top: calc(100% + 10px);
  right: 0;
  z-index: 30;
  display: grid;
  width: min(240px, calc(100vw - 24px));
  overflow: hidden;
  padding: 8px 0;
  border: 1px solid #dddfe2;
  border-radius: 8px;
  background: #fff;
  box-shadow: 0 12px 28px rgb(0 0 0 / .12);
  color: #1c1e21;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  letter-spacing: 0;
  text-transform: none;
}

.account-dropdown-profile {
  display: grid;
  grid-template-columns: 28px minmax(0, 1fr);
  gap: 9px;
  align-items: center;
  padding: 8px 12px 12px;
}

.account-dropdown-avatar {
  display: block;
  width: 28px;
  height: 28px;
  object-fit: cover;
  border-radius: 50%;
  background: #f0f2f5;
}

.account-dropdown-profile strong,
.account-dropdown-profile span {
  display: block;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.account-dropdown-profile strong {
  color: #1c1e21;
  font-size: 14px;
  font-weight: 650;
  letter-spacing: 0;
  line-height: 1.25;
  text-transform: none;
}

.account-dropdown-profile span {
  margin-top: 1px;
  color: #606770;
  font-size: 12px;
  letter-spacing: 0;
  line-height: 1.3;
  text-transform: none;
}

.account-dropdown-section {
  display: grid;
  gap: 0;
  padding: 4px 8px;
  border-top: 1px solid #e4e6eb;
}

.account-dropdown button {
  display: flex;
  width: 100%;
  min-height: 36px;
  align-items: center;
  gap: 9px;
  padding: 0 8px;
  border: 0;
  border-radius: 6px;
  background: transparent;
  color: #1c1e21;
  font-size: 13px;
  font-weight: 600;
  letter-spacing: 0;
  text-align: left;
  text-transform: none;
}

.account-dropdown button {
  cursor: pointer;
}

.account-dropdown button svg {
  flex: 0 0 auto;
  width: 14px;
  height: 14px;
  color: #606770;
  stroke-width: 1.7;
}

.account-dropdown button:hover {
  background: #f0f2f5;
  color: #1c1e21;
}

.account-dropdown button:hover svg {
  color: #1c1e21;
}

.account-dropdown button.active {
  color: #1c1e21;
}

.account-dropdown button.active svg {
  color: var(--kaayd-blue);
}

.account-dropdown-section:last-child button {
  color: #1c1e21;
}

.account-dropdown-section:last-child button svg {
  color: #606770;
}

.collection-rail {
  position: sticky;
  top: 58px;
  z-index: 30;
  display: block;
  align-items: center;
  height: auto;
  max-width: none;
  overflow: visible;
  border-right: 0;
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
  background: rgba(255, 255, 255, 0.97);
  color: #121212;
  margin: 0 auto;
  padding: 0 30px;
  backdrop-filter: blur(18px);
}

.brand-block {
  display: block;
  max-width: none;
  margin: 0;
  padding: 0;
  border-bottom: 0;
}

.brand-block .logo-link {
  justify-self: center;
  font-size: 28px;
}

.brand-block h1 {
  max-width: none;
  margin-top: 0;
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 17px;
  font-weight: 600;
  line-height: 1;
  text-transform: uppercase;
  white-space: nowrap;
}

.brand-block span {
  display: block;
  max-width: 340px;
  margin-top: 7px;
  color: #555;
  font-size: 13px;
  font-weight: 400;
  line-height: 1.25;
}

.brand-block p {
  display: block;
  margin-top: 8px;
  color: #6d6a64;
  font-size: 10px;
  line-height: 1;
  text-transform: uppercase;
  white-space: nowrap;
}

.back-link {
  display: inline-flex;
  margin-top: 12px;
  padding: 0;
  border: 0;
  background: transparent;
  color: #ea3b0c;
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.toggle-row {
  display: flex;
  align-items: center;
  gap: 7px;
  color: #555;
  font-size: 11px;
  text-transform: uppercase;
}

.toggle-row input {
  width: 12px;
  height: 12px;
  accent-color: #111;
}

.collection-list {
  display: flex;
  max-width: none;
  gap: 8px;
  overflow: auto;
  margin: 0;
  padding: 12px 0;
  scrollbar-width: none;
}

.collection-list::-webkit-scrollbar {
  display: none;
}

.collection-slider-wrap {
  display: flex;
  align-items: center;
  height: 7px;
  width: 100%;
  max-width: none;
}

.collection-slider {
  width: 100%;
  appearance: none;
  border: 0;
  background: transparent;
  cursor: pointer;
  padding: 0;
}

.collection-slider:focus {
  outline: 0;
}

.collection-slider::-webkit-slider-runnable-track {
  height: 2px;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.13);
}

.collection-slider::-webkit-slider-thumb {
  width: 34px;
  height: 4px;
  appearance: none;
  border: 0;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.64);
  margin-top: -1px;
  transition: background 160ms ease, width 160ms ease;
}

.collection-slider:hover::-webkit-slider-thumb,
.collection-slider:focus-visible::-webkit-slider-thumb {
  width: 42px;
  background: #121212;
}

.collection-slider::-moz-range-track {
  height: 2px;
  border: 0;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.13);
}

.collection-slider::-moz-range-thumb {
  width: 34px;
  height: 4px;
  border: 0;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.64);
  transition: background 160ms ease, width 160ms ease;
}

.collection-slider:hover::-moz-range-thumb,
.collection-slider:focus-visible::-moz-range-thumb {
  width: 42px;
  background: #121212;
}

.collection-button,
.retry-button {
  display: flex;
  width: 100%;
  align-items: center;
  border: 0;
  background: transparent;
}

.collection-button {
  position: relative;
  flex: 0 0 auto;
  width: 72px;
  justify-content: flex-start;
  gap: 0;
  min-height: 38px;
  padding: 8px 10px 10px;
  border: 1px solid rgba(18, 18, 18, 0.1);
  background: transparent;
  color: #74716d;
  font-size: 12px;
  font-weight: 400;
  letter-spacing: 0.035em;
  text-align: left;
  text-transform: none;
  transition: border-color 160ms ease, color 160ms ease, background 160ms ease;
}

.collection-button:hover {
  border-color: rgba(18, 18, 18, 0.34);
  color: #000;
}

.collection-button.active {
  border-color: #111;
  background: #fff;
  color: #111;
  font-weight: 600;
}

.collection-button span {
  min-width: 0;
}

.collection-button strong,
.collection-button small {
  display: block;
}

.collection-button strong {
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 12px;
  font-weight: inherit;
  line-height: 1;
}

.collection-button small {
  display: none;
}

.collection-button em {
  position: absolute;
  right: 9px;
  bottom: 7px;
  min-width: 0;
  color: inherit;
  font-family: "JetBrains Mono", monospace;
  font-size: 8px;
  font-style: normal;
  opacity: 0.5;
  line-height: 1;
  text-align: left;
}

.browse-area {
  min-width: 0;
  padding: 34px 30px 76px;
}

.browse-area::before {
  display: none;
  content: "";
}

.collection-header {
  display: grid;
  grid-template-columns: minmax(0, 1fr) auto;
  align-items: end;
  gap: 28px;
  max-width: 1270px;
  margin: 0 auto;
  padding-bottom: 16px;
  border-bottom: 1px solid #e5e4e2;
}

.collection-header h2 {
  max-width: 760px;
  font-size: 31px;
  line-height: 1;
}

.collection-header p {
  margin-top: 7px;
  color: #585858;
  font-size: 14px;
}

.collection-stat {
  min-width: 92px;
  text-align: right;
}

.collection-stat strong,
.collection-stat span {
  display: block;
}

.collection-stat strong {
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 26px;
  font-weight: 400;
  line-height: 0.9;
}

.collection-stat span {
  margin-top: 8px;
  color: #77736a;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.product-toolbar {
  display: grid;
  grid-template-columns: minmax(0, 1fr) auto;
  max-width: 1380px;
  align-items: start;
  justify-content: space-between;
  gap: 28px;
  margin: 0 auto;
  padding: 0 0 18px;
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
  color: #585858;
  font-size: 13px;
}

.toolbar-collection {
  min-width: 0;
}

.toolbar-title-row {
  display: flex;
  min-width: 0;
  align-items: baseline;
  gap: 10px;
}

.toolbar-collection strong,
.toolbar-collection span {
  display: block;
}

.toolbar-collection strong {
  overflow: hidden;
  color: #121212;
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: clamp(17px, 1.65vw, 23px);
  font-weight: 400;
  letter-spacing: 0.03em;
  line-height: 1.08;
  text-overflow: ellipsis;
  text-transform: none;
  white-space: nowrap;
}

.toolbar-title-row strong {
  min-width: 0;
}

.toolbar-season-label {
  flex: 0 0 auto;
  color: #706c63;
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  font-weight: 500;
  letter-spacing: 0.08em;
  line-height: 1;
  text-transform: uppercase;
}

.toolbar-meta {
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  gap: 6px 10px;
  margin-top: 7px;
  color: #5f5b55;
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  font-weight: 500;
  line-height: 1.25;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.toolbar-meta span {
  display: inline-flex;
  align-items: center;
  gap: 10px;
  white-space: nowrap;
}

.toolbar-meta span:not(:last-child)::after {
  width: 2px;
  height: 2px;
  border-radius: 999px;
  background: currentColor;
  content: "";
  opacity: 0.5;
}

.toolbar-actions {
  display: flex;
  flex: 0 0 auto;
  flex-wrap: wrap;
  align-items: center;
  align-self: end;
  justify-content: flex-end;
  gap: 12px;
  color: #787878;
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  letter-spacing: 0.1em;
  text-transform: uppercase;
}

.toolbar-listing-count {
  color: #121212;
  font-weight: 600;
}

.product-toolbar button {
  padding: 0;
  border: 0;
  background: transparent;
  color: #121212;
  font-size: 13px;
  text-decoration: underline;
  text-underline-offset: 4px;
}

.product-toolbar .bulk-looks-toggle {
  display: inline-flex;
  align-items: center;
  gap: 8px;
  min-height: 34px;
  padding: 0 13px;
  border: 1px solid rgba(18, 18, 18, 0.1);
  border-radius: 999px;
  background: rgba(255, 255, 255, 0.72);
  color: #121212;
  font-size: 11px;
  font-weight: 600;
  letter-spacing: 0.06em;
  text-decoration: none;
  text-transform: uppercase;
  transition: border-color 160ms ease, background 160ms ease, color 160ms ease, box-shadow 160ms ease;
}

.product-toolbar .bulk-looks-toggle:hover,
.product-toolbar .bulk-looks-toggle.active {
  border-color: rgba(18, 18, 18, 0.18);
  background: #fff;
  color: #121212;
  box-shadow: 0 1px 3px rgba(18, 18, 18, 0.06);
}

.product-toolbar .bulk-looks-toggle.active {
  border-color: rgba(18, 18, 18, 0.24);
  background: #121212;
  color: #fff;
  box-shadow: none;
}

.product-toolbar .bulk-looks-toggle.active svg {
  fill: currentColor;
}

.bulk-looks-modal-backdrop {
  position: fixed;
  inset: 0;
  z-index: 90;
  display: grid;
  place-items: center;
  padding: 24px;
  background: rgba(246, 245, 242, 0.54);
  backdrop-filter: saturate(180%) blur(28px);
  -webkit-backdrop-filter: saturate(180%) blur(28px);
}

.bulk-looks-modal {
  display: grid;
  width: min(620px, 100%);
  max-height: min(760px, calc(100dvh - 48px));
  grid-template-rows: auto auto auto minmax(0, 1fr);
  overflow: hidden;
  border: 1px solid rgba(255, 255, 255, 0.72);
  border-radius: 26px;
  background: rgba(255, 255, 255, 0.86);
  box-shadow:
    0 28px 80px rgba(18, 18, 18, 0.18),
    0 2px 10px rgba(18, 18, 18, 0.06),
    inset 0 1px 0 rgba(255, 255, 255, 0.92);
  color: #121212;
  font-family: "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
}

.bulk-looks-modal-grabber {
  justify-self: center;
  width: 44px;
  height: 5px;
  margin-top: 10px;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.16);
}

.bulk-looks-modal-header {
  display: flex;
  align-items: flex-start;
  justify-content: space-between;
  gap: 20px;
  padding: 20px 24px 16px;
}

.bulk-looks-modal-header span,
.bulk-looks-url-heading span {
  display: block;
  color: #6f6b63;
  font-size: 12px;
  font-weight: 600;
  letter-spacing: 0;
}

.bulk-looks-modal-header h2 {
  margin-top: 5px;
  color: #121212;
  font-size: 26px;
  font-weight: 650;
  letter-spacing: 0;
  line-height: 1.08;
}

.bulk-looks-modal-header button {
  display: inline-flex;
  width: 32px;
  height: 32px;
  flex: 0 0 auto;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 0;
  border-radius: 50%;
  background: rgba(18, 18, 18, 0.06);
  color: #121212;
  transition: background 160ms ease, transform 160ms ease;
}

.bulk-looks-modal-header button:hover {
  background: rgba(18, 18, 18, 0.1);
}

.bulk-looks-modal-header button:active {
  transform: scale(0.96);
}

.bulk-looks-mode-control {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 3px;
  margin: 0 24px 14px;
  padding: 3px;
  border: 1px solid rgba(18, 18, 18, 0.06);
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.05);
}

.bulk-looks-mode-control button {
  min-height: 34px;
  border: 0;
  border-radius: 999px;
  background: transparent;
  color: #6f6b63;
  font-size: 13px;
  font-weight: 650;
  letter-spacing: 0;
  transition: background 160ms ease, box-shadow 160ms ease, color 160ms ease;
}

.bulk-looks-mode-control button.active {
  background: rgba(255, 255, 255, 0.92);
  box-shadow: 0 1px 4px rgba(18, 18, 18, 0.08);
  color: #121212;
}

.bulk-looks-existing-summary {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 12px;
  margin: 0 24px 14px;
  padding: 11px 14px;
  border: 1px solid rgba(18, 18, 18, 0.06);
  border-radius: 16px;
  background: rgba(246, 246, 247, 0.68);
}

.bulk-looks-existing-summary div {
  display: grid;
  gap: 2px;
}

.bulk-looks-existing-summary span {
  color: #6f6b63;
  font-size: 11px;
  font-weight: 650;
  letter-spacing: 0;
  text-transform: uppercase;
}

.bulk-looks-existing-summary strong {
  color: #121212;
  font-size: 15px;
  font-weight: 650;
  letter-spacing: 0;
}

.bulk-looks-existing-summary small {
  color: #6f6b63;
  font-size: 12px;
  font-weight: 600;
  white-space: nowrap;
}

.bulk-looks-existing-summary button {
  display: inline-flex;
  min-height: 30px;
  align-items: center;
  justify-content: center;
  gap: 6px;
  padding: 0 10px;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 999px;
  background: rgba(255, 255, 255, 0.8);
  color: #121212;
  font-size: 12px;
  font-weight: 650;
}

.bulk-looks-progress {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 6px;
  padding: 0 24px 14px;
}

.bulk-looks-progress span {
  height: 4px;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.08);
}

.bulk-looks-progress span.active {
  background: rgba(18, 18, 18, 0.72);
}

.bulk-looks-count-step,
.bulk-looks-url-step,
.bulk-looks-vogue-step {
  display: grid;
  min-height: 0;
  padding: 0 24px 24px;
}

.bulk-looks-count-step {
  gap: 22px;
}

.bulk-looks-count-control {
  display: grid;
  grid-template-columns: 54px minmax(0, 1fr) 54px;
  align-items: center;
  gap: 12px;
  min-height: 184px;
  padding: 22px;
  border: 1px solid rgba(18, 18, 18, 0.06);
  border-radius: 24px;
  background:
    linear-gradient(180deg, rgba(255, 255, 255, 0.78), rgba(246, 246, 247, 0.72)),
    #f6f6f7;
  box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.86);
}

.bulk-looks-count-control > button {
  display: inline-flex;
  width: 54px;
  height: 54px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 50%;
  background: rgba(255, 255, 255, 0.82);
  color: #121212;
  box-shadow: 0 1px 2px rgba(18, 18, 18, 0.04);
  transition: border-color 160ms ease, transform 160ms ease, background 160ms ease;
}

.bulk-looks-count-control > button:hover {
  border-color: rgba(18, 18, 18, 0.16);
  background: #fff;
}

.bulk-looks-count-control > button:active {
  transform: scale(0.96);
}

.bulk-looks-count-control > button:disabled {
  opacity: 0.34;
}

.bulk-looks-count-control label {
  display: grid;
  justify-items: center;
  gap: 8px;
}

.bulk-looks-count-control label span {
  color: #6f6b63;
  font-size: 13px;
  font-weight: 600;
  letter-spacing: 0;
}

.bulk-looks-count-control input {
  width: min(190px, 100%);
  appearance: textfield;
  -moz-appearance: textfield;
  border: 0;
  outline: 0;
  background: transparent;
  color: #121212;
  font-size: 72px;
  font-weight: 660;
  letter-spacing: 0;
  line-height: 1;
  text-align: center;
}

.bulk-looks-count-control input::-webkit-outer-spin-button,
.bulk-looks-count-control input::-webkit-inner-spin-button {
  margin: 0;
  appearance: none;
  -webkit-appearance: none;
}

.bulk-looks-url-step {
  gap: 14px;
}

.bulk-looks-vogue-step {
  gap: 14px;
}

.bulk-looks-file-drop {
  display: grid;
  min-height: 220px;
  place-items: center;
  align-content: center;
  gap: 10px;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 24px;
  background:
    linear-gradient(180deg, rgba(255, 255, 255, 0.76), rgba(246, 246, 247, 0.72)),
    #f6f6f7;
  color: #121212;
  text-align: center;
  box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.86);
  cursor: pointer;
  transition: border-color 160ms ease, background 160ms ease, transform 160ms ease;
}

.bulk-looks-file-drop:hover {
  border-color: rgba(18, 18, 18, 0.18);
  background: #fff;
}

.bulk-looks-file-drop.active {
  border-color: rgba(18, 18, 18, 0.28);
  background: #fff;
  box-shadow:
    inset 0 1px 0 rgba(255, 255, 255, 0.9),
    0 0 0 4px rgba(18, 18, 18, 0.06);
}

.bulk-looks-file-drop:active {
  transform: scale(0.995);
}

.bulk-looks-file-drop input {
  position: absolute;
  width: 1px;
  height: 1px;
  overflow: hidden;
  clip: rect(0 0 0 0);
}

.bulk-looks-file-drop svg {
  display: block;
  width: 48px;
  height: 48px;
  padding: 12px;
  border-radius: 50%;
  background: rgba(18, 18, 18, 0.08);
}

.bulk-looks-file-drop strong {
  font-size: 18px;
  font-weight: 650;
  letter-spacing: 0;
}

.bulk-looks-file-drop span {
  max-width: min(360px, calc(100% - 32px));
  overflow: hidden;
  color: #6f6b63;
  font-size: 13px;
  font-weight: 500;
  letter-spacing: 0;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.bulk-looks-url-grid {
  display: grid;
  max-height: min(430px, 48dvh);
  gap: 0;
  overflow: auto;
  border: 1px solid rgba(18, 18, 18, 0.07);
  border-radius: 18px;
  background: rgba(246, 246, 247, 0.78);
  box-shadow: inset 0 1px 0 rgba(255, 255, 255, 0.72);
}

.bulk-looks-url-grid label {
  display: grid;
  grid-template-columns: 78px minmax(0, 1fr);
  align-items: center;
  gap: 14px;
  min-height: 54px;
  padding: 0 14px;
  border-bottom: 1px solid rgba(18, 18, 18, 0.06);
}

.bulk-looks-url-grid label:last-child {
  border-bottom: 0;
}

.bulk-looks-url-grid label span {
  color: #6f6b63;
  font-size: 11px;
  font-weight: 650;
  letter-spacing: 0;
  text-transform: uppercase;
}

.bulk-looks-url-grid input {
  min-width: 0;
  height: 44px;
  padding: 0;
  border: 0;
  outline: 0;
  background: transparent;
  color: #121212;
  font-size: 14px;
}

.bulk-looks-url-grid input:focus {
  background: transparent;
}

.bulk-looks-error {
  margin: 0;
  color: #a33a2a;
  font-size: 12px;
}

.bulk-looks-modal-actions {
  display: flex;
  justify-content: flex-end;
  gap: 9px;
}

.bulk-looks-primary,
.bulk-looks-secondary {
  display: inline-flex;
  min-height: 42px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  padding: 0 18px;
  border-radius: 999px;
  font-size: 14px;
  font-weight: 650;
  transition: opacity 160ms ease, transform 160ms ease, background 160ms ease, border-color 160ms ease;
}

.bulk-looks-primary {
  border: 1px solid rgba(18, 18, 18, 0.9);
  background: rgba(18, 18, 18, 0.94);
  color: #fff;
}

.bulk-looks-secondary {
  border: 1px solid rgba(18, 18, 18, 0.08);
  background: rgba(255, 255, 255, 0.72);
  color: #121212;
}

.bulk-looks-primary:hover:not(:disabled) {
  background: #000;
}

.bulk-looks-secondary:hover:not(:disabled) {
  border-color: rgba(18, 18, 18, 0.14);
  background: #fff;
}

.bulk-looks-primary:active:not(:disabled),
.bulk-looks-secondary:active:not(:disabled) {
  transform: scale(0.98);
}

.bulk-looks-primary:disabled,
.bulk-looks-secondary:disabled {
  cursor: default;
  opacity: 0.44;
}

.bulk-looks-success {
  display: grid;
  min-height: 284px;
  place-items: center;
  align-content: center;
  gap: 16px;
  text-align: center;
}

.bulk-looks-success svg {
  display: block;
  width: 44px;
  height: 44px;
  padding: 10px;
  border-radius: 50%;
  background: rgba(18, 18, 18, 0.08);
  color: #121212;
}

.bulk-looks-success strong {
  font-size: 21px;
  font-weight: 650;
  letter-spacing: 0;
}

.iconic-hero-modal {
  width: min(1180px, calc(100vw - 32px));
  max-width: 1180px;
  max-height: min(88vh, 900px);
}

.iconic-hero-state {
  display: grid;
  min-height: 220px;
  place-items: center;
  gap: 12px;
  color: rgba(18, 18, 18, 0.58);
  text-align: center;
}

.iconic-hero-form {
  display: grid;
  gap: 18px;
  min-height: 0;
}

.iconic-hero-grid {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(190px, 1fr));
  gap: 14px;
  max-height: min(64vh, 660px);
  overflow-y: auto;
  padding: 2px 6px 2px 2px;
}

.iconic-hero-option {
  display: grid;
  grid-template-rows: minmax(0, 1fr) auto;
  gap: 8px;
  min-width: 0;
  padding: 10px;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 8px;
  background: #fff;
  color: #121212;
  text-align: left;
  transition: border-color 150ms ease, box-shadow 150ms ease, transform 150ms ease;
}

.iconic-hero-option:hover {
  border-color: rgba(18, 18, 18, 0.18);
  box-shadow: 0 8px 20px rgba(18, 18, 18, 0.08);
  transform: translateY(-1px);
}

.iconic-hero-option.active {
  border-color: #121212;
  box-shadow: inset 0 0 0 1px #121212;
}

.iconic-hero-image {
  display: flex;
  align-items: center;
  justify-content: center;
  aspect-ratio: 3 / 4;
  min-height: 0;
  overflow: hidden;
  border-radius: 6px;
  background: #f2f0eb;
}

.iconic-hero-image img {
  display: block;
  width: 100%;
  height: 100%;
  object-fit: contain;
}

.iconic-hero-image .image-placeholder {
  width: 100%;
  height: 100%;
}

.iconic-hero-option > span:last-child {
  font-size: 12px;
  font-weight: 650;
}

.product-index {
  display: block;
  max-width: 1380px;
  margin: 0 auto;
  padding-top: 22px;
}

.collection-filter-bar {
  position: relative;
  z-index: 20;
  display: flex;
  max-width: 100%;
  min-width: 0;
  flex-wrap: wrap;
  align-items: center;
  gap: 12px;
  transform: translateY(7px);
  color: #0e0e0e;
  font-family: "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 13px;
  font-weight: 500;
  letter-spacing: 0.1em;
  text-transform: uppercase;
}

.collection-filter-clear-slot {
  display: flex;
  min-width: 72px;
  align-items: center;
}

.product-toolbar button.collection-filter-clear,
.product-toolbar button.collection-filter-pill,
.product-toolbar button.collection-stock-toggle,
.product-toolbar button.collection-size-chip {
  text-decoration: none;
}

.product-toolbar button.collection-filter-clear {
  height: 36px;
  border: 0;
  background: transparent;
  color: rgba(14, 14, 14, 0.42);
  font: inherit;
  font-size: 10px;
  font-weight: 400;
  letter-spacing: 0.08em;
  text-decoration: none;
  text-transform: uppercase;
}

.product-toolbar button.collection-filter-clear:hover,
.product-toolbar button.collection-filter-clear:focus-visible {
  color: rgba(14, 14, 14, 0.68);
  text-decoration: underline;
  text-underline-offset: 5px;
}

.collection-filter-dropdown {
  position: relative;
  min-width: 0;
}

.product-toolbar button.collection-filter-pill {
  display: inline-flex;
  height: 44px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  padding: 0;
  border: 0;
  border-radius: 0;
  background: transparent;
  color: #0e0e0e;
  font: inherit;
  cursor: pointer;
  transition: border-color 180ms ease, background 180ms ease, color 180ms ease, box-shadow 180ms ease;
  white-space: nowrap;
}

.product-toolbar button.collection-filter-pill:hover,
.product-toolbar button.collection-filter-pill:focus-visible,
.product-toolbar button.collection-filter-pill[aria-expanded="true"] {
  background: transparent;
  box-shadow: none;
  text-decoration: underline;
  text-underline-offset: 5px;
}

.product-toolbar button.collection-filter-pill.active {
  color: #0e0e0e;
}

.collection-filter-pill svg {
  flex: 0 0 auto;
  transition: transform 180ms ease;
}

.collection-filter-pill[aria-expanded="true"] svg {
  transform: rotate(180deg);
}

.collection-filter-dot {
  width: 5px;
  height: 5px;
  border-radius: 50%;
  background: currentColor;
  opacity: 0.68;
}

.collection-size-panel,
.collection-price-panel {
  position: absolute;
  top: calc(100% + 8px);
  left: 0;
  z-index: 30;
  max-width: calc(100vw - 32px);
  overflow-x: auto;
  border: 1px solid #0e0e0e;
  border-radius: 28px;
  background: #ffffff;
  color: #0e0e0e;
  box-shadow: none;
}

.collection-size-panel {
  display: flex;
  gap: 4px;
  padding: 12px;
}

.product-toolbar button.collection-size-chip {
  display: inline-flex;
  width: 38px;
  height: 38px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 1px solid rgba(14, 14, 14, 0.35);
  border-radius: 50%;
  background: transparent;
  color: #0e0e0e;
  font-size: 9px;
  font-weight: 400;
  line-height: 1;
  letter-spacing: 0.06em;
  cursor: pointer;
  transition: border-color 180ms ease, background 180ms ease, color 180ms ease, box-shadow 180ms ease;
}

.product-toolbar button.collection-size-chip:hover,
.product-toolbar button.collection-size-chip:focus-visible {
  border-color: #0e0e0e;
  box-shadow: inset 0 0 0 1px #0e0e0e;
}

.product-toolbar button.collection-size-chip.active {
  border-color: #0e0e0e;
  background: #0e0e0e;
  color: #eceae6;
}

.collection-price-panel {
  display: flex;
  gap: 4px;
  padding: 12px;
}

.collection-price-field {
  display: block;
}

.collection-price-label {
  display: none;
}

.collection-price-input-shell {
  position: relative;
  display: block;
  width: 72px;
  height: 38px;
}

.collection-price-currency {
  position: absolute;
  top: 50%;
  left: 13px;
  color: rgba(14, 14, 14, 0.48);
  font: 400 10px/1 "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  pointer-events: none;
  transform: translateY(-50%);
}

.collection-price-field input {
  width: 72px;
  height: 38px;
  box-sizing: border-box;
  border: 1px solid rgba(14, 14, 14, 0.35);
  border-radius: 999px;
  background: transparent;
  color: #0e0e0e;
  font: 400 11px/1 "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  letter-spacing: 0;
  outline: none;
  padding: 0 10px 0 24px;
  text-align: center;
}

.collection-price-field input::placeholder {
  color: rgba(14, 14, 14, 0.36);
}

.collection-price-field input:focus {
  border-color: #0e0e0e;
  box-shadow: inset 0 0 0 1px #0e0e0e;
}

.product-toolbar button.collection-price-apply {
  display: inline-flex;
  width: 46px;
  height: 38px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 0;
  border-radius: 999px;
  background: rgba(14, 14, 14, 0.08);
  color: rgba(14, 14, 14, 0.72);
  font: 400 9px/1 "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  letter-spacing: 0.08em;
  text-decoration: none;
  cursor: pointer;
}

.product-toolbar button.collection-price-apply:disabled {
  background: transparent;
  color: rgba(14, 14, 14, 0.26);
  cursor: default;
}

.product-toolbar button.collection-stock-toggle {
  display: inline-flex;
  width: auto;
  height: 44px;
  align-items: center;
  justify-content: flex-start;
  gap: 12px;
  padding: 0;
  border: 0;
  background: transparent;
  color: #0e0e0e;
  font: inherit;
  cursor: pointer;
  transition: border-color 180ms ease, background 180ms ease, color 180ms ease, box-shadow 180ms ease;
}

.product-toolbar button.collection-stock-toggle:hover,
.product-toolbar button.collection-stock-toggle:focus-visible,
.product-toolbar button.collection-stock-toggle.active {
  color: #0e0e0e;
}

.collection-stock-track {
  position: relative;
  display: inline-block;
  width: 32px;
  height: 18px;
  flex: 0 0 auto;
  border-radius: 999px;
  background: rgba(14, 14, 14, 0.14);
  transition: background 180ms ease;
}

.collection-stock-track span {
  position: absolute;
  top: 3px;
  left: 3px;
  width: 12px;
  height: 12px;
  border-radius: 50%;
  background: #0e0e0e;
  transition: left 180ms ease;
}

.collection-stock-toggle.active .collection-stock-track {
  background: var(--kaayd-blue);
}

.collection-stock-toggle.active .collection-stock-track span {
  left: 17px;
  background: #fff;
}

.collection-stock-label {
  display: inline-block;
  width: auto;
  min-width: 0;
  overflow: hidden;
  text-overflow: ellipsis;
  text-align: left;
  white-space: nowrap;
}

.listing-grid {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(214px, 1fr));
  gap: 42px 22px;
  min-width: 0;
}

.listing-tile {
  position: relative;
  min-width: 0;
  color: #121212;
}

.listing-image-button {
  position: relative;
  display: block;
  width: 100%;
  aspect-ratio: 3 / 4;
  overflow: hidden;
  border: 0;
  border-radius: 10px;
  background: #f6f5f3;
  color: inherit;
  cursor: pointer;
  font: inherit;
  margin-bottom: 11px;
  padding: 0;
  text-decoration: none;
  touch-action: pan-y;
  user-select: none;
  -webkit-tap-highlight-color: transparent;
}

.listing-image-button img {
  display: block;
  width: 100%;
  height: 100%;
  -webkit-user-drag: none;
  object-fit: cover;
  transition: opacity 180ms ease, transform 360ms ease;
  user-select: none;
}

.listing-image-button:hover img {
  opacity: 1;
  transform: scale(1.018);
}

.listing-availability-pill {
  position: absolute;
  right: 8px;
  bottom: 8px;
  z-index: 5;
  display: inline-flex;
  max-width: calc(100% - 16px);
  min-height: 24px;
  align-items: center;
  justify-content: center;
  padding: 0 10px;
  border: 0;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.78);
  color: #fff;
  font-size: 11px;
  font-weight: 500;
  line-height: 1;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.listing-runway-image {
  position: absolute;
  inset: 0;
  z-index: 1;
  opacity: 0;
  pointer-events: none;
  transition: opacity 180ms ease;
}

.listing-mobile-image-dots {
  position: absolute;
  right: 0;
  bottom: 12px;
  left: 0;
  z-index: 3;
  display: none;
  width: fit-content;
  min-height: 22px;
  align-items: center;
  justify-content: center;
  gap: 7px;
  margin: 0 auto;
  padding: 0 8px;
  border-radius: 9999px;
  background: rgba(0, 0, 0, 0.42);
  box-shadow: 0 4px 14px rgba(0, 0, 0, 0.28);
  backdrop-filter: blur(10px);
  pointer-events: none;
}

.listing-mobile-image-dots span {
  width: 7px;
  height: 7px;
  border-radius: 9999px;
  background: rgba(255, 255, 255, 0.52);
  box-shadow: 0 1px 5px rgba(0, 0, 0, 0.34);
}

.listing-mobile-image-dots span.active {
  width: 17px;
  background: rgba(255, 255, 255, 0.96);
}

.listing-hover-meta {
  position: absolute;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 2;
  display: flex;
  align-items: center;
  justify-content: center;
  min-height: 32px;
  padding: 0 13px;
  background: rgba(255, 255, 255, 0.9);
  color: #111;
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  font-weight: 500;
  letter-spacing: 0.12em;
  line-height: 1;
  opacity: 0;
  text-transform: uppercase;
  transform: translateY(100%);
  transition: opacity 180ms ease, transform 220ms ease;
}

.listing-hover-meta span {
  min-width: 0;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.listing-hover-meta.split {
  justify-content: stretch;
  gap: 0;
  padding: 0;
}

.listing-hover-meta.split span {
  flex: 1 1 0;
  display: flex;
  min-height: 34px;
  align-items: center;
  justify-content: center;
  padding: 0 13px;
}

.listing-hover-meta.split span + span {
  position: relative;
  border-left: 0;
}

.listing-hover-meta.split span + span::before {
  position: absolute;
  top: 50%;
  left: 0;
  width: 1px;
  height: 16px;
  background: rgba(18, 18, 18, 0.24);
  content: "";
  transform: translateY(-50%);
}

.listing-tile:hover .listing-hover-meta,
.listing-image-button:focus-visible .listing-hover-meta {
  opacity: 1;
  transform: translateY(0);
}

@media (hover: hover) and (pointer: fine) {
  .listing-tile:hover .listing-runway-image,
  .listing-image-button:focus-visible .listing-runway-image {
    opacity: 1;
  }
}

@media (max-width: 760px), (hover: none), (pointer: coarse) {
  .listing-image-button {
    touch-action: pan-y;
  }

  .listing-image-button:hover img {
    transform: none;
  }

  .listing-tile:hover .listing-runway-image:not(.mobile-active),
  .listing-image-button:focus-visible .listing-runway-image:not(.mobile-active) {
    opacity: 0;
  }

  .listing-runway-image.mobile-active {
    opacity: 1;
  }

  .listing-mobile-image-dots {
    display: flex;
  }

  .listing-image-button .listing-hover-meta {
    display: none;
  }
}

.favorite-button {
  position: absolute;
  z-index: 4;
  top: 12px;
  right: 12px;
  display: inline-flex;
  min-width: 30px;
  height: 30px;
  align-items: center;
  justify-content: center;
  gap: 5px;
  border: 0;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 50%;
  background: rgba(255, 255, 255, 0.86);
  color: #000;
  padding: 0 7px;
  box-shadow: none;
  backdrop-filter: blur(10px);
}

.delete-listing-button {
  position: absolute;
  z-index: 4;
  top: 12px;
  left: 12px;
  display: inline-flex;
  width: 34px;
  height: 34px;
  align-items: center;
  justify-content: center;
  border: 0;
  border-radius: 50%;
  background: rgba(247, 247, 247, 0.86);
  color: #000;
  padding: 0;
  box-shadow: 0 1px 8px rgba(0, 0, 0, 0.08);
}

.accept-review-button {
  position: absolute;
  z-index: 4;
  top: 12px;
  right: 12px;
  display: inline-flex;
  width: 34px;
  height: 34px;
  align-items: center;
  justify-content: center;
  border: 0;
  border-radius: 50%;
  background: rgba(18, 18, 18, 0.86);
  color: #fff;
  padding: 0;
  box-shadow: 0 1px 8px rgba(0, 0, 0, 0.12);
  backdrop-filter: blur(10px);
}

.favorite-button:hover {
  background: #fff;
  color: #000;
  transform: scale(1.04);
}

.accept-review-button:hover {
  background: #fff;
  color: #000;
  transform: scale(1.08);
}

.delete-listing-button:hover {
  background: #000;
  color: #fff;
  transform: scale(1.08);
}

.favorite-button.saved {
  background: #fff;
  color: #1c1e21;
}

.favorite-button.saved svg {
  fill: currentColor;
}

.favorite-button:disabled,
.delete-listing-button:disabled,
.accept-review-button:disabled {
  cursor: wait;
  opacity: 0.72;
}

.favorite-button span {
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  font-weight: 500;
  line-height: 1;
  min-width: 1ch;
  text-align: left;
}

.image-placeholder {
  display: grid;
  width: 100%;
  height: 100%;
  place-items: center;
  color: #8d8d8d;
  background: #f7f7f7;
}

.listing-copy {
  display: grid;
  grid-template-rows: auto minmax(18px, auto);
  gap: 8px;
  min-width: 0;
  padding-top: 0;
  color: #121212;
  font-size: 13px;
  line-height: 1.25;
  text-align: left;
  transition: transform 220ms ease;
}

.listing-tile:hover .listing-copy {
  transform: none;
}

.listing-copy a {
  color: inherit;
  text-decoration: none;
}

.listing-copy .title-button:hover {
  color: #000;
  text-decoration: none;
}

.title-button {
  display: grid;
  grid-template-rows: auto 16px;
  gap: 3px;
  width: 100%;
  min-width: 0;
  max-width: 100%;
  overflow: hidden;
  border: 0;
  background: transparent;
  color: #121212;
  text-align: left;
}

.designer-line {
  display: block;
  max-width: 100%;
  margin: 0;
  overflow: hidden;
  color: #121212;
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 12px;
  font-weight: 700;
  line-height: 1.15;
  letter-spacing: 0.035em;
  text-transform: uppercase;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.designer-line p {
  min-width: 0;
  max-width: 100%;
  overflow: hidden;
  margin-top: 0;
  margin-bottom: 0;
  font-size: 12px;
  font-weight: 700;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.product-line {
  display: block;
  max-width: 100%;
  height: 16px;
  max-height: 16px;
  overflow: hidden;
  color: #625e58;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 12px;
  font-weight: 400;
  line-height: 1.32;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.card-price-line {
  margin: 0;
  color: #121212;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 12px;
  font-weight: 500;
  letter-spacing: 0;
  line-height: 1.2;
  text-align: right;
  white-space: nowrap;
}

.listing-card-meta {
  display: flex;
  align-items: baseline;
  justify-content: space-between;
  gap: 12px;
  min-width: 0;
  width: 100%;
}

.card-size-line {
  min-width: 0;
  overflow: hidden;
  color: #4f4b46;
  font-family: "JetBrains Mono", monospace;
  font-size: 11px;
  font-weight: 600;
  letter-spacing: 0.08em;
  line-height: 1.2;
  text-overflow: ellipsis;
  text-transform: uppercase;
  white-space: nowrap;
}


/* Browse-only typography: keep the compact grid scale and the KAAYD wordmark. */
.app-shell :is(
  .collection-button strong,
  .collection-button em,
  .collection-stat strong,
  .toolbar-collection strong,
  .toolbar-season-label,
  .toolbar-meta,
  .toolbar-actions,
  .collection-filter-bar,
  .designer-line,
  .card-size-line,
  .listing-hover-meta,
  .favorite-button span
) {
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  letter-spacing: 0;
}

.app-shell .designer-line,
.app-shell .designer-line p {
  font-weight: 600;
}

.app-shell .card-size-line {
  font-weight: 500;
}

.detail-meta {
  display: flex;
  flex-wrap: wrap;
  gap: 7px 12px;
  color: #77736a;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.detail-meta span {
  max-width: 100%;
  overflow-wrap: anywhere;
}

.load-more-row {
  display: flex;
  justify-content: center;
  padding: 48px 0 8px;
}

/* Compact charcoal pagination pill; loading is communicated with text only. */
#root .load-more-button {
  position: relative;
  isolation: isolate;
  overflow: hidden;
  display: inline-flex;
  min-width: 148px;
  min-height: 44px;
  align-items: center;
  justify-content: center;
  gap: 10px;
  padding: 0 22px;
  border: 1px solid #383735;
  border-radius: 999px !important;
  background: #383735;
  color: #f8f6f2;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 13px;
  font-weight: 500;
  letter-spacing: 0;
  line-height: 1.4;
  text-transform: none;
  transition: background-color 160ms ease, border-color 160ms ease;
}

#root .load-more-button:hover:not(:disabled) {
  border-color: #292826;
  background: #292826;
}

#root .load-more-button:active:not(:disabled) {
  background: #22211f;
}

#root .load-more-button:focus-visible {
  outline: 2px solid #383735;
  outline-offset: 4px;
}

#root .load-more-button:disabled {
  opacity: 1;
  cursor: default;
}

@media (prefers-reduced-motion: reduce) {
  #root .load-more-button { transition: none; }
}

.primary-button,
.buy-button,
.retry-button,
.inline-error button,
.back-button {
  display: inline-flex;
  min-height: 42px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  font-size: 12px;
  font-weight: 700;
  letter-spacing: 0.04em;
  text-transform: uppercase;
}

.primary-button,
.buy-button {
  border: 1px solid #121212;
  border-radius: 5px;
  background: #121212;
  color: #fefbf7;
}

.primary-button {
  padding: 0 20px;
}

.primary-button:disabled {
  cursor: wait;
  opacity: 0.64;
}

.primary-button:hover,
.buy-button:hover {
  background: #ea3b0c;
  border-color: #ea3b0c;
}

.listing-page {
  display: flex;
  flex-direction: column;
  min-height: 100dvh;
  padding: 0;
  background: #f3f3f1;
}

.listing-page-nav {
  position: absolute;
  top: 22px;
  left: 28px;
  z-index: 5;
  display: flex;
  max-width: none;
  align-items: center;
  gap: 16px;
  margin: 0;
  padding: 0;
  border-bottom: 0;
}

.back-button {
  min-height: 32px;
  padding: 0;
  border: 0;
  border-radius: 0;
  background: transparent;
  color: #121212;
  font-family: "GT Standard", Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 13px;
  font-weight: 600;
  letter-spacing: 0;
  text-transform: none;
}

.listing-page .back-button {
  min-height: auto;
  justify-content: flex-start;
  gap: 6px;
  font-size: 13px;
  letter-spacing: 0;
  text-transform: none;
}

.listing-detail {
  position: relative;
  flex: 0 0 auto;
  display: grid;
  grid-template-columns: minmax(0, 1fr) minmax(250px, 340px);
  grid-template-rows: minmax(0, 1fr);
  gap: clamp(24px, 3.5vw, 58px);
  align-items: stretch;
  width: min(85vw, 1760px);
  height: calc(100dvh - 106px);
  margin: 24px auto;
  padding: 34px 38px;
  border-radius: 28px;
  background: #fff;
  box-shadow: none;
  overflow: hidden;
}

.wishlist-page {
  display: flex;
  flex-direction: column;
  min-height: 100vh;
  background: #fff;
}

.manual-review-page {
  min-height: 100vh;
  padding-bottom: 60px;
  background: #fff;
}

.manual-review-reason-page {
  display: flex;
  flex-direction: column;
}

.manual-review-header {
  display: flex;
  align-items: end;
  justify-content: space-between;
  gap: 20px;
  max-width: 1440px;
  margin: 0 auto;
  padding: 42px 20px 18px;
  border-bottom: 1px solid #e5e4e2;
}

.manual-review-header h1 {
  font-size: 34px;
  font-weight: 700;
  letter-spacing: 0;
  text-transform: uppercase;
}

.manual-review-header p {
  margin: 7px 0 0;
  color: #706c63;
  font-size: 12px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.manual-review-count {
  display: inline-flex;
  align-items: baseline;
  gap: 7px;
  color: #706c63;
  font-family: "JetBrains Mono", monospace;
  font-size: 11px;
  text-transform: uppercase;
}

.manual-review-count strong {
  color: #121212;
  font-size: 20px;
}

.manual-review-brand-tabs {
  display: flex;
  gap: 8px;
  max-width: 1440px;
  margin: 18px auto 0;
  overflow-x: auto;
  padding: 0 20px 4px;
  scrollbar-width: none;
}

.manual-review-brand-tabs::-webkit-scrollbar {
  display: none;
}

.manual-review-brand-tabs a {
  display: inline-flex;
  min-height: 34px;
  flex: 0 0 auto;
  align-items: center;
  gap: 10px;
  border: 1px solid #d8d4cc;
  padding: 0 12px;
  background: #fff;
  color: #46423c;
  font-size: 11px;
  text-transform: uppercase;
}

.manual-review-brand-tabs a.active,
.manual-review-brand-tabs a:hover {
  border-color: #121212;
  color: #121212;
}

.manual-review-brand-tabs em {
  color: #9b968d;
  font-style: normal;
}

.manual-review-type-grid {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 14px;
  max-width: 1440px;
  margin: 28px auto 0;
  padding: 0 20px;
}

.manual-review-type-card {
  display: grid;
  min-height: 172px;
  align-content: space-between;
  gap: 18px;
  border: 1px solid #d8d4cc;
  padding: 18px;
  background: #fff;
  color: #121212;
  text-align: left;
}

.manual-review-type-card:hover:not(:disabled) {
  border-color: #121212;
  background: #fbfaf8;
}

.manual-review-type-card span {
  color: #46423c;
  font-size: 13px;
  font-weight: 800;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.manual-review-type-card strong {
  font-family: "JetBrains Mono", monospace;
  font-size: 44px;
  line-height: 1;
}

.manual-review-type-card em {
  max-width: 620px;
  color: #706c63;
  font-size: 13px;
  font-style: normal;
  line-height: 1.45;
}

.manual-review-index {
  max-width: 1440px;
  margin: 28px auto 0;
  padding: 0 20px;
}

.manual-review-filter-bar {
  display: grid;
  gap: 12px;
  max-width: 1440px;
  margin: 18px auto 0;
  padding: 0 20px;
}

.manual-review-filter-heading {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 14px;
  min-height: 30px;
  border-bottom: 1px solid rgba(18, 18, 18, 0.12);
}

.manual-review-filter-heading span,
.manual-review-filter-group > span {
  color: #706c63;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.manual-review-filter-group {
  display: grid;
  grid-template-columns: 72px minmax(0, 1fr);
  align-items: start;
  gap: 12px;
}

.manual-review-filter-options {
  display: flex;
  min-width: 0;
  flex-wrap: wrap;
  gap: 7px;
}

.manual-review-filter-options button {
  min-height: 30px;
  padding: 0 10px;
  border: 1px solid #d8d4cc;
  background: #fff;
  color: #555048;
  font-size: 11px;
  font-weight: 600;
  letter-spacing: 0;
  text-transform: uppercase;
}

.manual-review-filter-options button:hover,
.manual-review-filter-options button.active {
  border-color: #121212;
  background: #121212;
  color: #fff;
}

.manual-review-filter-options button.excluded {
  border-color: #cf7b72;
  background: #fff7f6;
  color: #a23b30;
  text-decoration: line-through;
  text-decoration-thickness: 1px;
}

.manual-review-filter-options button.excluded:hover {
  border-color: #a23b30;
  background: #ffe5e1;
  color: #8d2d24;
}

.manual-review-clear-filters {
  display: inline-flex;
  min-height: 28px;
  align-items: center;
  gap: 7px;
  border: 0;
  border-bottom: 1px solid currentColor;
  border-radius: 0 !important;
  padding: 0;
  background: transparent;
  color: #46423c;
  font-size: 11px;
  font-weight: 700;
  text-transform: uppercase;
}

.manual-review-tile .listing-hover-meta span {
  max-width: min(260px, 80vw);
}

.manual-review-workspace {
  display: grid;
  grid-template-columns: minmax(0, 1.35fr) minmax(360px, 0.65fr);
  gap: 28px;
  max-width: 1440px;
  margin: 24px auto 0;
  padding: 0 20px;
}

.manual-review-media {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(220px, 1fr));
  gap: 12px;
  align-content: start;
}

.manual-review-image {
  overflow: hidden;
  aspect-ratio: 5 / 6;
  border: 1px solid #e5e4e2;
  background: #f5f0e9;
}

.manual-review-image img {
  width: 100%;
  height: 100%;
  object-fit: contain;
}

.manual-review-image.empty {
  display: flex;
  align-items: center;
  justify-content: center;
  color: #9b968d;
}

.manual-review-panel {
  position: sticky;
  top: 82px;
  display: grid;
  align-self: start;
  gap: 22px;
  padding: 18px 0 0;
}

.manual-review-panel-heading {
  display: flex;
  justify-content: space-between;
  gap: 14px;
  padding-bottom: 12px;
  border-bottom: 1px solid #e5e4e2;
  color: #706c63;
  font-family: "JetBrains Mono", monospace;
  font-size: 11px;
  text-transform: uppercase;
}

.manual-review-panel-heading strong {
  color: #121212;
  text-align: right;
}

.manual-review-copy {
  display: grid;
  gap: 12px;
}

.manual-review-copy h2 {
  font-size: 24px;
  line-height: 1.05;
  letter-spacing: 0;
}

.manual-review-copy p {
  color: #46423c;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 13px;
  line-height: 1.55;
}

.manual-review-meta {
  display: flex;
  flex-wrap: wrap;
  gap: 8px;
}

.manual-review-meta span {
  border: 1px solid #d8d4cc;
  padding: 5px 8px;
  color: #46423c;
  font-size: 11px;
  text-transform: uppercase;
}

.manual-review-copy a {
  display: inline-flex;
  align-items: center;
  gap: 6px;
  width: fit-content;
  color: #121212;
  font-size: 11px;
  text-decoration: none;
  text-transform: uppercase;
}

.manual-review-copy a:hover {
  color: #ea3b0c;
}

.manual-review-fields {
  display: grid;
  gap: 14px;
}

.manual-review-fields label {
  display: grid;
  gap: 6px;
}

.manual-review-fields span {
  color: #706c63;
  font-size: 11px;
  text-transform: uppercase;
}

.manual-review-fields input {
  width: 100%;
  min-height: 38px;
  border: 0;
  border-bottom: 1px solid #b9b6b1;
  outline: 0;
  background: transparent;
  color: #121212;
  font-family: "JetBrains Mono", monospace;
  font-size: 14px;
  letter-spacing: 0;
}

.manual-review-fields input:focus {
  border-bottom-color: #121212;
}

.manual-review-resolve-form {
  display: grid;
  gap: 16px;
  margin-top: auto;
}

.manual-review-resolve-heading {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 12px;
}

.manual-review-resolve-modes {
  display: inline-flex;
  align-items: center;
  gap: 14px;
  min-height: 30px;
}

.manual-review-resolve-modes button {
  position: relative;
  min-height: 28px;
  padding: 0;
  border: 0;
  background: transparent;
  color: #8b857b;
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0;
  text-transform: uppercase;
}

.manual-review-resolve-modes button.active {
  color: #121212;
}

.manual-review-resolve-modes button.active::after {
  position: absolute;
  right: 0;
  bottom: 3px;
  left: 0;
  height: 1px;
  background: currentColor;
  content: "";
}

.manual-review-resolve-modes button:disabled {
  cursor: default;
  opacity: 0.42;
}

.manual-review-selected-match {
  display: grid;
  gap: 5px;
  min-width: 0;
  border-top: 1px solid rgba(18, 18, 18, 0.12);
  border-bottom: 1px solid rgba(18, 18, 18, 0.12);
  padding: 12px 0;
}

.manual-review-selected-match span {
  color: #706c63;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.manual-review-selected-match strong {
  color: #121212;
  font-family: "JetBrains Mono", monospace;
  font-size: 16px;
  letter-spacing: 0;
}

.manual-review-selected-match em {
  min-width: 0;
  overflow: hidden;
  color: #46423c;
  font-size: 12px;
  font-style: normal;
  line-height: 1.25;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.manual-review-invalid-resolution-details.expanded {
  gap: 0;
}

.manual-review-invalid-resolution-details .manual-review-selected-match + .manual-review-selected-match {
  border-top: 0;
}

.manual-review-invalid-resolution-details.expanded .manual-review-selected-match em {
  overflow: visible;
  line-height: 1.35;
  text-overflow: clip;
  white-space: pre-wrap;
}

.manual-review-invalid-resolution-details.expanded .manual-review-selected-match strong {
  overflow-wrap: anywhere;
}

.manual-review-image-order-list {
  display: grid;
  gap: 8px;
  margin-top: 12px;
}

.manual-review-image-order-item {
  display: grid;
  grid-template-columns: 54px minmax(0, 1fr) 24px;
  gap: 10px;
  align-items: center;
  width: 100%;
  min-height: 68px;
  border: 1px solid rgba(18, 18, 18, 0.12);
  border-radius: 8px;
  padding: 7px;
  background: #fff;
  color: inherit;
  cursor: grab;
  text-align: left;
}

.manual-review-image-order-item:active {
  cursor: grabbing;
}

.manual-review-image-order-item.active {
  border-color: #121212;
  box-shadow: inset 0 0 0 1px #121212;
}

.manual-review-image-order-thumb {
  overflow: hidden;
  width: 54px;
  height: 54px;
  border-radius: 6px;
  background: #ebe8e1;
}

.manual-review-image-order-thumb img {
  width: 100%;
  height: 100%;
  object-fit: cover;
}

.manual-review-image-order-copy {
  display: grid;
  gap: 3px;
  min-width: 0;
}

.manual-review-image-order-copy strong {
  overflow: hidden;
  color: #121212;
  font-size: 12px;
  font-weight: 650;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.manual-review-image-order-copy span {
  color: #756f65;
  font-size: 11px;
}

.manual-review-image-order-actions {
  display: inline-flex;
  justify-content: center;
  color: #817b71;
}

.manual-review-detail-top {
  position: relative;
  padding-right: 34px;
}

.manual-review-invalid-detail .manual-review-detail-top {
  padding-right: 0;
}

.manual-review-panel-toolbar {
  display: flex;
  justify-content: flex-end;
  gap: 8px;
  margin-bottom: 18px;
}

.manual-review-detail-view-tabs {
  display: inline-flex;
  align-items: center;
  gap: 0;
  min-height: 28px;
}

.manual-review-detail-view-tabs button {
  position: relative;
  display: inline-flex;
  align-items: center;
  min-height: 28px;
  padding: 0 8px;
  border: 0;
  background: transparent;
  color: #8b857b;
  font-size: 12px;
  font-weight: 600;
  letter-spacing: 0;
  text-transform: none;
}

.manual-review-detail-view-tabs button + button::before {
  position: absolute;
  left: -1px;
  color: #b6b1a8;
  content: "|";
}

.manual-review-detail-view-tabs button.active {
  color: #121212;
}

.manual-review-detail-view-tabs button.active::after {
  position: absolute;
  right: 0;
  bottom: 1px;
  left: 0;
  height: 1px;
  background: currentColor;
  content: "";
}

.manual-review-detail-content {
  grid-template-rows: auto minmax(0, 1fr);
  align-content: stretch;
}

.manual-review-detail-bottom {
  display: flex;
  flex: 1;
  flex-direction: column;
  min-height: 0;
}

.manual-review-resolution-panel {
  display: flex;
  flex: 1;
  height: 100%;
  min-height: 0;
  flex-direction: column;
  padding-bottom: 48px;
}

.manual-review-resolution-panel .manual-review-neighbours,
.manual-review-resolution-panel .manual-review-resolve-form {
  flex: 1;
  min-height: 0;
}

.manual-review-resolution-panel .manual-review-resolve-form {
  margin-top: 0;
}

.manual-review-approval-panel .manual-review-invalid-resolution-details,
.manual-review-approval-panel .manual-review-suggested-neighbours,
.manual-review-approval-panel .manual-review-approval-manual {
  flex: 1;
  min-height: 0;
  margin-top: 0;
  overflow-y: auto;
}

.manual-review-approval-panel .manual-review-suggested-neighbours {
  display: flex;
  flex-direction: column;
}

.manual-review-approval-panel .manual-review-suggested-neighbours .manual-review-neighbour-list {
  flex: 1;
  max-height: none;
}

.manual-review-metadata-panel {
  display: flex;
  flex: 1;
  min-height: 0;
  flex-direction: column;
  background: #fff;
}

.manual-review-metadata-summary {
  display: grid;
  grid-template-columns: repeat(3, minmax(0, 1fr));
  gap: 1px;
  margin: 16px 0 20px;
  background: #fff;
}

.manual-review-metadata-summary div {
  min-width: 0;
  padding: 13px 14px;
  background: #fff;
}

.manual-review-metadata-summary span {
  display: block;
  margin-bottom: 7px;
  color: #8b857b;
  font-size: 10px;
  font-weight: 650;
  letter-spacing: .08em;
  text-transform: uppercase;
}

.manual-review-metadata-summary strong {
  display: block;
  overflow: hidden;
  color: #161616;
  font-size: 12px;
  font-weight: 600;
  letter-spacing: 0;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.manual-review-metadata-summary strong.missing {
  color: #9a948b;
  font-weight: 500;
}

.manual-review-metadata-options {
  min-height: 0;
  overflow: auto;
  padding-right: 2px;
}

.manual-review-resolution-pager {
  position: absolute;
  right: 38px;
  bottom: 34px;
  z-index: 4;
  display: inline-grid;
  grid-template-columns: 26px minmax(54px, auto) 26px;
  align-items: center;
  align-self: flex-end;
  min-height: 34px;
  border: 1px solid rgba(18, 18, 18, 0.12);
  border-radius: 999px;
  padding: 4px 5px;
  background: rgba(255, 255, 255, 0.94);
  box-shadow: 0 12px 28px rgba(18, 18, 18, 0.12);
  backdrop-filter: blur(12px);
}

.manual-review-resolution-pager button {
  display: inline-flex;
  width: 22px;
  height: 22px;
  align-items: center;
  justify-content: center;
  border: 1px solid rgba(18, 18, 18, 0.1);
  border-radius: 50%;
  background: #fff;
  color: #4b5563;
}

.manual-review-resolution-pager button:hover,
.manual-review-resolution-pager button.active {
  background: #121212;
  color: #fff;
}

.manual-review-resolution-pager span {
  color: #111827;
  font-size: 11px;
  font-weight: 750;
  letter-spacing: 0;
  text-align: center;
}

.manual-review-match-detail {
  grid-template-columns: minmax(0, 1fr) minmax(280px, 380px);
  height: calc(100dvh - 106px);
  min-height: 0;
  overflow: hidden;
}

.manual-review-match-detail .manual-review-detail-content {
  height: 100%;
  min-height: 0;
  max-height: 100%;
  overflow-y: auto;
  overscroll-behavior: contain;
  padding-right: 6px;
  scrollbar-gutter: stable;
}

.manual-review-incorrect-detail .manual-review-match-stage {
  grid-template-columns: 1fr;
}

.manual-review-incorrect-detail .manual-review-match-stage .listing-detail-image {
  height: min(78vh, 980px);
  min-height: 620px;
}

.manual-review-invalid-detail {
  height: calc(100dvh - 106px);
  min-height: 0;
  overflow: hidden;
}

.manual-review-invalid-detail .manual-review-detail-content {
  min-height: 0;
  max-height: 100%;
  overflow-y: auto;
  overscroll-behavior: contain;
  padding-right: 6px;
  scrollbar-gutter: stable;
}

.manual-review-invalid-detail .manual-review-detail-bottom {
  min-height: 0;
  overflow: visible;
  padding-right: 0;
}

.manual-review-invalid-info-detail {
  grid-template-columns: minmax(0, 1fr) minmax(320px, 460px);
}

.manual-review-invalid-info-detail .manual-review-match-stage {
  grid-template-columns: 1fr;
}

.manual-review-invalid-info-detail .manual-review-match-stage .listing-detail-image {
  height: min(78vh, 980px);
  min-height: 620px;
}

.manual-review-invalid-info-detail .manual-review-comparison-image {
  background: #fff;
}

.manual-review-info-actions {
  margin-top: 20px;
}

.manual-review-match-carousel {
  grid-template-columns: 54px minmax(0, 1fr);
}

.listing-carousel.no-thumbnails {
  grid-template-columns: minmax(0, 1fr);
}

.manual-review-match-stage {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 18px;
  height: 100%;
  min-height: 0;
}

.manual-review-match-stage.single-view {
  grid-template-columns: minmax(0, 1fr);
}

.manual-review-matched-view {
  display: grid;
  grid-template-columns: minmax(0, 1fr) 54px;
  align-items: center;
  gap: 14px;
  height: 100%;
  min-height: 0;
}

.manual-review-comparison-image {
  background: #f6f7f9;
}

.manual-review-comparison-image.matched {
  background: #f3f4f6;
}

.manual-review-metadata-detail .manual-review-comparison-image {
  background: #fff;
}

.manual-review-neighbours {
  display: grid;
  gap: 12px;
  min-height: 0;
  margin-bottom: 18px;
}

.manual-review-matches-heading {
  margin: 0;
  color: #121212;
  font-size: 13px;
  font-weight: 600;
  letter-spacing: 0;
  line-height: 1.1;
}

.manual-review-season-hints {
  display: flex;
  flex-wrap: wrap;
  gap: 6px;
  min-width: 0;
}

.manual-review-season-hint {
  display: inline-flex;
  min-height: 24px;
  align-items: center;
  border: 1px solid rgba(37, 99, 235, 0.22);
  border-radius: 6px;
  padding: 0 8px;
  background: #eff6ff;
  color: #1d4ed8;
  font-family: "JetBrains Mono", monospace;
  font-size: 10px;
  letter-spacing: 0;
  white-space: nowrap;
}

.manual-review-season-hint.warning {
  border-color: rgba(220, 38, 38, 0.22);
  background: #fef2f2;
  color: #b91c1c;
}

.manual-review-neighbour-list {
  display: grid;
  gap: 10px;
  max-height: 530px;
  overflow-y: auto;
  overscroll-behavior: contain;
  padding-right: 4px;
  scrollbar-gutter: stable;
}

.manual-review-suggested-neighbours .manual-review-neighbour-list {
  max-height: 320px;
}

.manual-review-neighbour {
  display: grid;
  grid-template-columns: minmax(0, 1fr) 34px;
  gap: 10px;
  align-items: stretch;
  padding: 8px;
  border: 1px solid rgba(18, 18, 18, 0.07);
  border-radius: 8px;
  background: #f7f7f7;
}

.manual-review-neighbour.no-action {
  grid-template-columns: minmax(0, 1fr);
}

.manual-review-neighbour.active {
  border-color: rgba(18, 18, 18, 0.26);
  background: #fff;
}

.manual-review-neighbour-select {
  display: grid;
  grid-template-columns: 68px minmax(0, 1fr);
  gap: 11px;
  min-width: 0;
  align-items: stretch;
  padding: 0;
  border: 0;
  background: transparent;
  color: #121212;
  text-align: left;
}

.manual-review-neighbour-thumb {
  display: block;
  width: 68px;
  height: 82px;
  border-radius: 6px;
  overflow: hidden;
  background: #fff;
}

.manual-review-neighbour-thumb img {
  width: 100%;
  height: 100%;
  object-fit: contain;
}

.manual-review-neighbour-meta {
  display: grid;
  min-width: 0;
  gap: 5px;
  align-content: center;
  color: #706c63;
  font-family: "JetBrains Mono", monospace;
  text-transform: uppercase;
}

.manual-review-neighbour-title {
  min-width: 0;
  overflow: hidden;
  color: #2f2f2f;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 11px;
  font-weight: 500;
  letter-spacing: 0;
  line-height: 1.15;
  text-overflow: ellipsis;
  text-transform: none;
  white-space: nowrap;
}

.manual-review-match-score {
  color: #706c63;
  font-size: 10px;
  letter-spacing: 0.02em;
}

.manual-review-match-pills {
  display: flex;
  flex-wrap: wrap;
  gap: 8px;
  min-width: 0;
}

.manual-review-match-score,
.manual-review-match-pill {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.manual-review-match-pill {
  position: relative;
  display: inline-flex;
  color: #6f6f6f;
  font-family: "JetBrains Mono", monospace;
  font-size: 11px;
  font-weight: 400;
  letter-spacing: 0.01em;
}

.manual-review-match-pill + .manual-review-match-pill::before {
  content: "/";
  margin-right: 8px;
  color: #b0b0b0;
}

.manual-review-match-thumbnail-row {
  max-height: 100%;
  overflow-y: auto;
}

.manual-review-neighbour-open,
.manual-review-neighbour-resolve {
  display: inline-flex;
  min-width: 34px;
  min-height: 100%;
  align-items: center;
  justify-content: center;
  align-self: stretch;
  padding: 0;
  border-radius: 6px;
  background: transparent;
  color: #46423c;
}

.manual-review-neighbour-open:hover {
  background: #f1f1f1;
  color: #121212;
}

.manual-review-neighbour-resolve {
  border: 1px solid rgba(22, 163, 74, 0.2);
  background: #ecfdf5;
  color: #047857;
}

.manual-review-neighbour-resolve:hover:not(:disabled) {
  border-color: rgba(22, 163, 74, 0.34);
  background: #d1fae5;
  color: #065f46;
}

.manual-review-neighbour.active .manual-review-neighbour-resolve {
  border-color: rgba(22, 163, 74, 0.3);
  background: #dcfce7;
}

.manual-review-neighbour-resolve:disabled {
  cursor: default;
  opacity: 0.72;
}

.manual-review-neighbour-empty {
  min-height: 64px;
  display: flex;
  gap: 8px;
  align-items: center;
  border-top: 1px solid rgba(18, 18, 18, 0.08);
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
  color: #706c63;
  font-size: 12px;
}

.manual-review-source-link {
  position: absolute;
  top: 0;
  right: 0;
  display: inline-flex;
  width: 28px;
  height: 28px;
  align-items: center;
  justify-content: center;
  border: 0;
  color: #46423c;
  text-decoration: none;
}

.manual-review-source-link:hover {
  color: #121212;
}

.manual-review-source-link.panel {
  position: static;
  flex: 0 0 auto;
  width: 34px;
  height: 34px;
  border: 1px solid rgba(18, 18, 18, 0.12);
  border-radius: 8px;
  background: #f6f5f2;
}

.manual-review-resolve-actions {
  display: grid;
  grid-template-columns: minmax(0, 3fr) minmax(44px, 1fr);
  gap: 10px;
  align-items: stretch;
}

.manual-review-resolve-actions.with-route {
  grid-template-columns: minmax(0, 2fr) minmax(150px, 1.4fr) minmax(44px, 0.7fr);
}

.manual-review-resolve-button {
  min-height: 42px;
}

.manual-review-move-menu {
  position: relative;
  min-width: 0;
}

.manual-review-move-button {
  display: inline-flex;
  width: 100%;
  min-height: 42px;
  min-width: 0;
  align-items: center;
  justify-content: center;
  gap: 8px;
  border: 1px solid #d8d4cc;
  background: #fff;
  color: #46423c;
  font-size: 12px;
  font-weight: 800;
  overflow: hidden;
  padding: 0 12px;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.manual-review-move-button:hover:not(:disabled) {
  border-color: #121212;
  color: #121212;
}

.manual-review-move-panel {
  position: fixed;
  top: max(86px, calc(100dvh - 430px));
  left: max(18px, calc(100vw - 398px));
  z-index: 90;
  display: grid;
  grid-template-rows: auto minmax(0, 1fr);
  width: min(360px, calc(100vw - 36px));
  overflow: hidden;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 24px;
  background: rgba(255, 255, 255, 0.96);
  box-shadow: 0 28px 80px rgba(18, 18, 18, 0.18), 0 2px 10px rgba(18, 18, 18, 0.05);
  color: #121212;
  font-family: "GT Standard", Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  letter-spacing: 0;
  backdrop-filter: blur(22px);
}

.manual-review-move-panel-body {
  display: grid;
  gap: 12px;
  padding: 18px;
}

.manual-review-move-panel-body > span {
  color: #7b7770;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.manual-review-move-brand-list {
  display: grid;
  gap: 8px;
}

.manual-review-move-brand-list button {
  display: flex;
  min-height: 46px;
  align-items: center;
  justify-content: space-between;
  gap: 12px;
  border: 1px solid #d8d4cc;
  background: #fff;
  color: #121212;
  font-size: 13px;
  font-weight: 800;
  padding: 0 12px;
  text-align: left;
}

.manual-review-move-brand-list button:hover {
  border-color: #121212;
  background: #f6f4ef;
}

.manual-review-line-actions .manual-review-resolve-actions {
  grid-template-columns: repeat(auto-fit, minmax(180px, 1fr));
}

.manual-review-line-actions .manual-review-trash-button {
  gap: 8px;
}

.manual-review-trash-button {
  display: inline-flex;
  width: 100%;
  min-height: 42px;
  align-items: center;
  justify-content: center;
  border: 1px solid #d72d3a;
  background: transparent;
  color: #d72d3a;
}

.manual-review-trash-button:hover:not(:disabled) {
  background: #d72d3a;
  color: #fff;
}

.manual-review-detail-skeleton {
  pointer-events: none;
}

.manual-review-skeleton-block,
.manual-review-skeleton-thumb,
.manual-review-skeleton-line,
.manual-review-skeleton-neighbour-thumb,
.manual-review-skeleton-field,
.manual-review-skeleton-action {
  display: block;
  overflow: hidden;
  border-radius: 8px;
  background:
    linear-gradient(90deg, #f0eeeb, #fff, #f0eeeb);
  background-size: 200% 100%;
  animation: shimmer 1200ms infinite;
}

.manual-review-skeleton-block {
  width: 100%;
  height: 100%;
  border-radius: 18px;
}

.manual-review-skeleton-thumb {
  width: 46px;
  height: 46px;
  border: 1px solid rgba(18, 18, 18, 0.06);
  border-radius: 10px;
}

.manual-review-skeleton-line.back {
  width: 92px;
  height: 18px;
}

.manual-review-skeleton-line.title {
  width: min(100%, 310px);
  height: 28px;
  margin-top: 18px;
}

.manual-review-skeleton-line.title.short {
  width: min(64%, 210px);
  margin-top: 8px;
}

.manual-review-skeleton-line.price {
  width: 82px;
  height: 18px;
  margin-top: 16px;
}

.manual-review-skeleton-line.heading {
  width: 136px;
  height: 14px;
}

.manual-review-neighbour-skeleton {
  grid-template-columns: 68px minmax(0, 1fr);
  min-height: 100px;
}

.manual-review-skeleton-neighbour-thumb {
  width: 68px;
  height: 82px;
  border-radius: 6px;
}

.manual-review-skeleton-neighbour-copy {
  display: grid;
  align-content: center;
  gap: 9px;
  min-width: 0;
}

.manual-review-skeleton-line.row {
  width: 100%;
  height: 13px;
}

.manual-review-skeleton-line.row.small {
  width: 58%;
}

.manual-review-skeleton-field {
  width: 100%;
  height: 38px;
  border-radius: 0;
}

.manual-review-skeleton-action {
  width: 100%;
  height: 42px;
}

.manual-review-actions,
.manual-review-success {
  display: flex;
  align-items: center;
  gap: 8px;
  flex-wrap: wrap;
}

.manual-review-success {
  max-width: 1440px;
  margin: 18px auto 0;
  padding: 0 20px;
  color: #245d35;
  font-size: 12px;
  text-transform: uppercase;
}

.manual-review-success button {
  min-height: 28px;
  padding: 0 10px;
  border: 1px solid #245d35;
  background: transparent;
  color: #245d35;
  font-size: 11px;
  text-transform: uppercase;
}

.manual-review-empty {
  display: flex;
  align-items: center;
  justify-content: center;
  gap: 10px;
  min-height: 340px;
  color: #706c63;
  font-size: 13px;
}

.wishlist-content {
  flex: 1 0 auto;
  max-width: 1380px;
  width: 100%;
  margin: 0 auto;
  padding: 38px 30px 86px;
}

.wishlist-heading {
  display: flex;
  align-items: end;
  justify-content: space-between;
  gap: 28px;
  min-height: 86px;
  padding-bottom: 20px;
  border-bottom: 1px solid rgba(18, 18, 18, 0.1);
}

.wishlist-heading h1 {
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  margin-top: 8px;
  color: #121212;
  font-size: clamp(28px, 3.2vw, 42px);
  font-weight: 400;
  letter-spacing: 0.02em;
  line-height: 0.95;
  text-transform: uppercase;
}

.wishlist-eyebrow,
.wishlist-count {
  color: rgba(18, 18, 18, 0.42);
  font-family: "JetBrains Mono", monospace;
  font-size: 9px;
  font-weight: 500;
  letter-spacing: 0.14em;
  text-transform: uppercase;
}

.wishlist-count {
  display: inline-flex;
  min-height: 24px;
  align-items: center;
  padding-bottom: 2px;
  color: rgba(18, 18, 18, 0.5);
}

.wishlist-grid {
  margin-top: 34px;
}

.wishlist-page .listing-grid {
  gap: 46px 24px;
}

.wishlist-empty {
  min-height: 360px;
  border-top: 0;
  color: rgba(18, 18, 18, 0.5);
}

.listing-detail-media,
.listing-detail-content {
  min-width: 0;
}

.listing-detail-media {
  position: relative;
  display: grid;
  grid-template-rows: minmax(0, 1fr);
  gap: 18px;
  min-height: 0;
}

.image-order-toolbar {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 16px;
  margin-bottom: 8px;
}

.image-order-toolbar strong {
  color: #121212;
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.image-order-actions {
  display: flex;
  align-items: center;
  gap: 8px;
}

.image-order-error {
  color: #9f3328;
  font-size: 11px;
  text-transform: none;
}

.icon-text-button {
  display: inline-flex;
  align-items: center;
  gap: 6px;
  min-height: 30px;
  padding: 0 10px;
  border: 1px solid #d8d4cd;
  background: transparent;
  color: #121212;
  font-size: 11px;
  letter-spacing: 0;
  text-transform: uppercase;
}

.icon-text-button.primary {
  border-color: #121212;
  background: #121212;
  color: #fff;
}

.icon-text-button.danger {
  border-color: #b56b61;
  color: #9f3328;
}

.icon-text-button:disabled {
  cursor: default;
  opacity: 0.42;
}

.image-order-strip {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(72px, 1fr));
  gap: 8px;
}

.image-order-thumb {
  position: relative;
  display: block;
  aspect-ratio: 3 / 4;
  overflow: hidden;
  padding: 0;
  border: 1px solid transparent;
  background: #f4f1ed;
  cursor: grab;
}

.image-order-thumb:active {
  cursor: grabbing;
}

.image-order-thumb.hero {
  border-color: #121212;
}

.image-order-thumb img {
  width: 100%;
  height: 100%;
  object-fit: cover;
}

.image-order-rank,
.image-order-grip {
  position: absolute;
  color: #fff;
}

.image-order-rank {
  top: 6px;
  left: 6px;
  padding: 3px 5px;
  background: rgba(18, 18, 18, 0.68);
  font-size: 10px;
  line-height: 1;
  text-transform: uppercase;
}

.image-order-grip {
  right: 5px;
  bottom: 5px;
}

.listing-carousel {
  display: grid;
  grid-template-columns: 54px minmax(0, 1fr);
  align-items: center;
  gap: 20px;
  height: 100%;
  min-height: 0;
}

.listing-carousel-arrow {
  position: absolute;
  top: 50%;
  z-index: 3;
  display: inline-flex;
  width: 38px;
  height: 38px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 0;
  border-radius: 50%;
  background: rgba(255, 255, 255, 0.9);
  color: #121212;
  transform: translateY(-50%);
}

.listing-carousel-arrow:hover {
  background: #121212;
  color: #fff;
}

.listing-carousel-arrow.previous {
  left: 18px;
}

.listing-carousel-arrow.next {
  right: 18px;
}

.listing-thumbnail-row {
  display: grid;
  min-width: 0;
  max-height: 100%;
  max-width: none;
  align-content: center;
  justify-items: center;
  gap: 8px;
  padding-bottom: 0;
}

.listing-thumbnail {
  display: inline-flex;
  width: 46px;
  height: 46px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 1px solid rgba(18, 18, 18, 0.10);
  border-radius: 10px;
  overflow: hidden;
  background: #f3f3f1;
  opacity: 0.72;
}

.listing-thumbnail.active {
  border: 2px solid #121212;
  opacity: 1;
}

.listing-thumbnail img {
  width: 100%;
  height: 100%;
  max-width: 100%;
  object-fit: cover;
}

.listing-detail-image {
  position: relative;
  display: flex;
  width: 100%;
  height: 100%;
  min-height: 0;
  max-height: none;
  align-items: center;
  justify-content: center;
  overflow: hidden;
  border: 0;
  border-radius: 18px;
  color: #8f8a80;
  touch-action: pan-y;
}

.listing-reference-stage {
  position: relative;
  display: grid;
  width: 100%;
  height: 100%;
  min-height: 0;
  grid-template-columns: minmax(0, 1fr);
  gap: 14px;
}

.listing-reference-stage.active {
  grid-template-columns: repeat(2, minmax(0, 1fr));
}

.listing-detail-image img {
  display: block;
  width: auto;
  height: auto;
  max-width: 96%;
  max-height: 96%;
  border-radius: 18px;
  object-fit: contain;
}

.runway-look-browser-backdrop {
  position: fixed;
  inset: 0;
  z-index: 80;
  display: grid;
  place-items: center;
  padding: 14px;
  background: rgba(16, 16, 15, 0.72);
  outline: none;
}

.runway-look-browser {
  display: grid;
  grid-template-rows: auto minmax(0, 1fr);
  width: min(1960px, 98vw);
  height: min(1080px, 96vh);
  min-height: 0;
  overflow: hidden;
  border: 1px solid rgba(255, 255, 255, 0.16);
  border-radius: 18px;
  background: #f7f5f1;
  box-shadow: 0 24px 80px rgba(0, 0, 0, 0.34);
}

.runway-look-browser-header {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 20px;
  padding: 18px 20px;
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
}

.runway-look-browser-header span {
  color: #777269;
  font-size: 11px;
  font-weight: 760;
  letter-spacing: 0;
  text-transform: uppercase;
}

.runway-look-browser-header h2 {
  margin: 2px 0 0;
  color: #121212;
  font-size: 20px;
  line-height: 1.05;
}

.runway-look-browser-tabs {
  display: inline-grid;
  grid-template-columns: repeat(2, minmax(110px, 1fr));
  gap: 3px;
  min-height: 36px;
  margin-left: auto;
  padding: 3px;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.05);
}

.runway-look-browser-tabs button {
  min-height: 28px;
  padding: 0 12px;
  border: 0;
  border-radius: 999px;
  background: transparent;
  color: #706c63;
  font-size: 12px;
  font-weight: 720;
  letter-spacing: 0;
}

.runway-look-browser-tabs button.active {
  background: #fff;
  color: #121212;
  box-shadow: 0 1px 4px rgba(18, 18, 18, 0.08);
}

.runway-look-browser-body {
  display: grid;
  grid-template-columns: minmax(360px, 1fr) minmax(360px, 1fr) minmax(560px, 1.45fr);
  gap: 18px;
  min-height: 0;
  padding: 16px;
}

.runway-look-browser-listing,
.runway-look-browser-focus,
.runway-look-browser-grid-panel {
  min-height: 0;
}

.runway-look-browser-listing,
.runway-look-browser-focus {
  display: grid;
  grid-template-rows: minmax(0, 1fr) auto;
  gap: 12px;
}

.runway-look-browser-image-frame {
  position: relative;
  display: flex;
  min-height: 0;
  align-items: center;
  justify-content: center;
  overflow: hidden;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 14px;
  background: #fff;
}

.runway-look-browser-focus .runway-look-browser-image-frame {
  background: #ebe7df;
}

.runway-look-browser-image-frame img,
.runway-look-browser-image-frame .image-placeholder {
  width: auto;
  height: auto;
  max-width: 96%;
  max-height: 96%;
  border-radius: 12px;
  object-fit: contain;
}

.runway-look-browser-listing-thumbs {
  display: grid;
  grid-auto-flow: column;
  grid-auto-columns: 58px;
  gap: 8px;
  min-width: 0;
  overflow-x: auto;
  padding-bottom: 2px;
}

.runway-look-browser-listing-thumbs button {
  display: inline-flex;
  aspect-ratio: 1;
  min-width: 0;
  align-items: center;
  justify-content: center;
  overflow: hidden;
  padding: 0;
  border: 1px solid rgba(18, 18, 18, 0.12);
  border-radius: 9px;
  background: #fff;
  opacity: 0.74;
}

.runway-look-browser-listing-thumbs button.active,
.runway-look-browser-listing-thumbs button[aria-current="true"] {
  border-color: #121212;
  opacity: 1;
  box-shadow: inset 0 0 0 1px #121212;
}

.runway-look-browser-listing-thumbs img,
.runway-look-browser-listing-thumbs .image-placeholder {
  width: 100%;
  height: 100%;
  border-radius: 0;
  object-fit: cover;
}

.runway-look-browser-grid-panel {
  overflow: hidden;
  border-left: 1px solid rgba(18, 18, 18, 0.08);
  padding-left: 16px;
}

.runway-look-browser-grid {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(190px, 1fr));
  grid-auto-rows: 260px;
  align-content: start;
  gap: 14px;
  height: 100%;
  min-height: 0;
  overflow-y: auto;
  overscroll-behavior: contain;
  padding-right: 4px;
}

.runway-look-suggestion-list {
  display: grid;
  align-content: start;
  gap: 10px;
  height: 100%;
  min-height: 0;
  overflow-y: auto;
  overscroll-behavior: contain;
  padding-right: 4px;
}

.runway-look-suggestion-row {
  display: grid;
  grid-template-columns: 92px minmax(0, 1fr);
  gap: 12px;
  min-height: 118px;
  align-items: stretch;
  padding: 8px;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 10px;
  background: #fff;
  color: #121212;
  text-align: left;
}

.runway-look-suggestion-row:hover,
.runway-look-suggestion-row.preview,
.runway-look-suggestion-row.active {
  border-color: #121212;
}

.runway-look-suggestion-row.active {
  box-shadow: inset 0 0 0 2px #121212;
}

.runway-look-suggestion-thumb {
  display: block;
  width: 92px;
  height: 102px;
  overflow: hidden;
  border-radius: 8px;
  background: #f2efe9;
}

.runway-look-suggestion-thumb img,
.runway-look-suggestion-thumb .image-placeholder {
  width: 100%;
  height: 100%;
  object-fit: contain;
}

.runway-look-suggestion-meta {
  display: grid;
  min-width: 0;
  align-content: center;
  gap: 6px;
}

.runway-look-suggestion-meta strong {
  color: #121212;
  font-size: 15px;
  font-weight: 700;
  letter-spacing: 0;
}

.runway-look-suggestion-meta small {
  color: #706c63;
  font-size: 12px;
  font-weight: 650;
  letter-spacing: 0;
}

.runway-look-browser-grid button {
  position: relative;
  display: block;
  width: 100%;
  height: 260px;
  min-width: 0;
  min-height: 0;
  overflow: hidden;
  padding: 0;
  border: 1px solid rgba(18, 18, 18, 0.11);
  border-radius: 10px;
  background: #e8e4dc;
  color: #fff;
}

.runway-look-browser-grid button:hover,
.runway-look-browser-grid button.preview,
.runway-look-browser-grid button.active {
  border-color: #121212;
}

.runway-look-browser-grid button.active {
  box-shadow: inset 0 0 0 3px #121212;
}

.runway-look-browser-grid button.preview:not(.active) {
  box-shadow: inset 0 0 0 2px rgba(18, 18, 18, 0.38);
}

.runway-look-browser-grid img,
.runway-look-browser-grid .image-placeholder {
  width: 100%;
  height: 100%;
  border-radius: 0;
  object-fit: cover;
  pointer-events: none;
}

.runway-look-browser-grid span {
  position: absolute;
  right: 7px;
  bottom: 7px;
  left: 7px;
  display: inline-flex;
  min-height: 28px;
  align-items: center;
  justify-content: center;
  padding: 0 8px;
  background: rgba(18, 18, 18, 0.82);
  color: #fff;
  font-size: 11px;
  font-weight: 760;
  letter-spacing: 0;
  text-transform: uppercase;
}

.listing-static-meta {
  right: 24px;
  bottom: 24px;
  left: 24px;
  min-height: 42px;
  padding: 0 18px;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.88);
  color: #fff;
  letter-spacing: 0;
  opacity: 1;
  pointer-events: none;
  transform: translateY(0);
}

.listing-static-meta span {
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 13px;
  font-weight: 600;
  letter-spacing: 0;
  text-transform: none;
}

.listing-detail-content {
  display: grid;
  grid-template-rows: auto auto;
  align-content: start;
  gap: 28px;
  padding: 0;
  border-top: 0;
  color: #121212;
  font-family: "GT Standard", Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  max-height: 100%;
  overflow: hidden;
}

.listing-detail-top {
  min-width: 0;
}

.listing-detail-bottom {
  display: grid;
  min-width: 0;
  align-self: start;
  gap: 0;
}

.listing-detail-content h1 {
  max-width: 360px;
  margin-top: 18px;
  color: #111;
  font-size: clamp(22px, 1.6vw, 28px);
  font-weight: 600;
  letter-spacing: 0;
  line-height: 1.12;
}

.listing-detail-price {
  margin-top: 12px;
  color: #1f1f1f;
  font-size: 17px;
  font-weight: 500;
  line-height: 1.18;
}

.listing-stock-pill {
  display: inline-flex;
  width: fit-content;
  min-height: 24px;
  align-items: center;
  margin-bottom: 16px;
  padding: 0 10px;
  border-radius: 999px;
  background: #ffe7e3;
  color: #ff3b30;
  font-size: 12px;
  font-weight: 600;
}

.listing-metadata-section {
  display: grid;
  gap: 10px;
  margin: 0 0 16px;
}

.listing-metadata-section h2 {
  margin: 0;
  color: #121212;
  font-size: 13px;
  font-weight: 600;
  letter-spacing: 0;
  line-height: 1.1;
}

.listing-metadata {
  display: grid;
  gap: 0;
  margin: 0;
  padding: 0;
  border-top: 1px solid rgba(18, 18, 18, 0.12);
}

.listing-metadata-row {
  display: grid;
  grid-template-columns: minmax(90px, 0.42fr) minmax(0, 1fr);
  gap: 18px;
  align-items: baseline;
  min-width: 0;
  padding: 10px 0;
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
}

.listing-metadata dt,
.listing-metadata dd {
  min-width: 0;
  margin: 0;
  line-height: 1.25;
}

.listing-metadata dt {
  color: #76736d;
  font-size: 11px;
  font-weight: 600;
  letter-spacing: 0;
}

.listing-metadata dd {
  color: #151515;
  font-size: 13px;
  font-weight: 500;
  text-align: right;
  overflow-wrap: anywhere;
}

.listing-option-group {
  display: flex;
  min-height: 42px;
  align-items: center;
  justify-content: flex-start;
  gap: 18px;
  margin-top: 0;
  padding: 12px 0 16px;
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
}

.listing-option-label {
  color: #222;
  font-size: 14px;
  font-weight: 500;
  line-height: 1;
}

.listing-size-icon {
  display: inline-flex;
  width: 36px;
  height: 36px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 1px solid #121212;
  border-radius: 50%;
  background: #fff;
  color: #121212;
  font-family: "GT Standard", Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 12px;
  font-weight: 600;
  letter-spacing: 0;
}

.listing-secondary-actions {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 8px;
  margin-top: 10px;
}

.listing-pill-button {
  display: inline-flex;
  min-height: 40px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  padding: 0 14px;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 999px;
  background: #fff;
  color: #111;
  font-size: 14px;
  font-weight: 500;
  transition: background-color 150ms ease, border-color 150ms ease;
}

.listing-pill-button:hover:not(:disabled) {
  border-color: rgba(18, 18, 18, 0.12);
  background: #f6f6f4;
}

.listing-pill-button.saved svg {
  fill: currentColor;
}

.runway-reference-toggle {
  position: absolute;
  top: 16px;
  right: 16px;
  z-index: 6;
  display: inline-flex;
  min-height: 36px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  min-width: 186px;
  max-width: calc(100% - 32px);
  padding: 0 10px 0 13px;
  border: 1px solid rgba(18, 18, 18, 0.12);
  border-radius: 999px;
  background: rgba(255, 255, 255, 0.92);
  color: #121212;
  font: 650 12px/1 "GT Standard", Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  letter-spacing: 0;
  box-shadow: none;
  cursor: pointer;
  backdrop-filter: blur(14px);
  transition: border-color 150ms ease, background-color 150ms ease, color 150ms ease;
  white-space: nowrap;
}

.runway-reference-toggle:hover:not(:disabled) {
  border-color: rgba(18, 18, 18, 0.22);
  background: rgba(255, 255, 255, 0.98);
}

.runway-reference-toggle.active {
  border-color: rgba(18, 18, 18, 0.18);
  background: rgba(245, 245, 245, 0.96);
  color: #111;
  box-shadow: none;
}

.runway-reference-toggle svg {
  flex: 0 0 auto;
  stroke-width: 1.7;
}

.listing-admin-look-section {
  display: grid;
  gap: 14px;
  margin-top: 12px;
}

.listing-admin-look-button {
  display: inline-flex;
  width: 100%;
  min-height: 42px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  padding: 0 14px;
  border: 1px solid rgba(18, 18, 18, 0.12);
  background: #fff;
  color: #121212;
  font-size: 13px;
  font-weight: 650;
  letter-spacing: 0;
}

.listing-admin-look-button:hover,
.listing-admin-look-button.active {
  border-color: #121212;
  background: #f6f6f4;
}

.listing-beta-pill {
  display: inline-flex;
  min-height: 18px;
  align-items: center;
  justify-content: center;
  padding: 0 7px;
  border: 0;
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.08);
  color: inherit;
  font-size: 9px;
  font-weight: 700;
  line-height: 1;
  text-transform: uppercase;
}

.runway-reference-toggle.active .listing-beta-pill {
  background: rgba(18, 18, 18, 0.1);
}

.share-link-toast {
  position: fixed;
  left: 50%;
  bottom: max(22px, env(safe-area-inset-bottom));
  z-index: 80;
  min-width: 188px;
  padding: 12px 24px;
  border-radius: 999px;
  background: #080808;
  color: #fff;
  box-shadow: 0 14px 38px rgba(0, 0, 0, 0.18);
  font-family: "GT Standard", Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  font-size: 13px;
  font-weight: 600;
  line-height: 1;
  text-align: center;
  opacity: 0;
  pointer-events: none;
  transform: translate(-50%, 18px) scale(0.98);
  transition:
    opacity 180ms ease,
    transform 220ms cubic-bezier(0.2, 0.8, 0.2, 1);
}

.share-link-toast.visible {
  opacity: 1;
  transform: translate(-50%, 0) scale(1);
}

.listing-info-section {
  display: grid;
  gap: 10px;
  margin-top: 32px;
  padding-top: 22px;
  border-top: 1px solid rgba(18, 18, 18, 0.08);
}

.listing-info-section h2 {
  margin: 0;
  color: #111;
  font-size: 16px;
  font-weight: 600;
  letter-spacing: 0;
  line-height: 1.15;
}

.description {
  display: -webkit-box;
  max-width: 560px;
  margin-top: 0;
  color: #6f6f6f;
  font-size: 14px;
  font-weight: 400;
  line-height: 1.45;
  overflow: hidden;
  -webkit-box-orient: vertical;
  -webkit-line-clamp: 5;
  white-space: normal;
}

.detail-meta {
  display: grid;
  grid-template-columns: 1fr;
  gap: 0;
  margin-top: 0;
  padding-top: 0;
  border-top: 0;
}

.detail-meta span {
  display: flex;
  align-items: baseline;
  justify-content: space-between;
  gap: 18px;
  padding: 12px 0;
  border-bottom: 1px solid rgba(18, 18, 18, 0.08);
  color: #5f5f5f;
  font-size: 14px;
  font-weight: 600;
}

.detail-meta span:last-child {
  border-bottom: 0;
}

.detail-meta strong {
  color: #111;
  font-weight: 700;
}

.admin-listing-tools {
  position: absolute;
  top: 18px;
  right: 22px;
  z-index: 7;
  margin: 0;
}

.admin-tools-trigger {
  display: inline-flex;
  width: 34px;
  height: 34px;
  min-height: 0;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 0;
  border-radius: 50%;
  background: rgba(255, 255, 255, 0.78);
  color: rgba(18, 18, 18, 0.64);
  box-shadow: 0 1px 8px rgba(18, 18, 18, 0.08);
  backdrop-filter: blur(12px);
}

.admin-tools-trigger:hover {
  background: #fff;
  color: #121212;
}

.admin-tools-panel {
  position: fixed;
  top: max(34px, calc(100dvh - 704px));
  left: max(18px, calc(100vw - 588px));
  z-index: 90;
  display: grid;
  grid-template-rows: auto auto minmax(0, 1fr);
  width: min(560px, calc(100vw - 36px));
  height: min(650px, calc(100dvh - 72px));
  min-width: 380px;
  min-height: 320px;
  max-width: calc(100vw - 36px);
  max-height: calc(100dvh - 40px);
  overflow: hidden;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 24px;
  background: rgba(255, 255, 255, 0.96);
  box-shadow: 0 28px 80px rgba(18, 18, 18, 0.18), 0 2px 10px rgba(18, 18, 18, 0.05);
  color: #121212;
  cursor: grab;
  font-family: "GT Standard", Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  letter-spacing: 0;
  resize: both;
  transform: translate(var(--admin-panel-x), var(--admin-panel-y));
  backdrop-filter: blur(22px);
}

.admin-tools-panel:active {
  cursor: grabbing;
}

.admin-tools-panel button {
  cursor: pointer;
}

.admin-tools-panel input {
  cursor: text;
}

.admin-tools-panel label {
  cursor: default;
}

.admin-tools-header {
  display: flex;
  min-height: 48px;
  align-items: center;
  justify-content: flex-end;
  gap: 16px;
  padding: 10px 14px 8px;
  border-bottom: 1px solid rgba(18, 18, 18, 0.06);
  cursor: grab;
  user-select: none;
}

.admin-tools-header:active {
  cursor: grabbing;
}

.admin-tools-header div {
  display: grid;
  gap: 3px;
}

.admin-tools-header span {
  color: #7b7770;
  font-size: 10px;
  font-weight: 600;
  letter-spacing: 0.06em;
  line-height: 1;
  text-transform: uppercase;
}

.admin-tools-header strong {
  color: #121212;
  font-size: 16px;
  font-weight: 600;
  line-height: 1.15;
}

.admin-tools-header button {
  display: inline-flex;
  width: 30px;
  height: 30px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 0;
  border-radius: 50%;
  background: transparent;
  color: #121212;
}

.admin-tools-header button:hover {
  background: #f4f3f1;
}

.admin-tools-tabs {
  display: grid;
  grid-template-columns: repeat(4, minmax(0, 1fr));
  gap: 6px;
  padding: 10px 12px;
  background: #f3f5f8;
}

.admin-tools-tabs button {
  min-height: 36px;
  padding: 0 8px;
  border: 0;
  border-radius: 999px;
  background: transparent;
  color: #6c6861;
  font-size: 12px;
  font-weight: 650;
  letter-spacing: 0;
}

.admin-tools-tabs button.active {
  background: #fff;
  color: #121212;
  box-shadow: 0 1px 3px rgba(18, 18, 18, 0.08), 0 8px 18px rgba(18, 18, 18, 0.05);
}

.admin-tools-body {
  container-type: inline-size;
  min-height: 0;
  overflow: auto;
  padding: 18px;
}

.image-order-panel {
  display: grid;
  gap: 12px;
  margin: 0;
  padding: 0;
  background: transparent;
}

.add-look-toggle {
  display: inline-flex;
  width: 100%;
  max-width: 360px;
  min-height: 38px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  margin-top: 24px;
  padding: 0 14px;
  border: 1px solid #121212;
  background: transparent;
  color: #121212;
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.add-look-toggle:hover {
  background: #121212;
  color: #fefbf7;
}

.collection-assignment-panel {
  display: grid;
  gap: 14px;
}

.collection-assignment-heading {
  display: flex;
  min-height: 20px;
  align-items: center;
  justify-content: space-between;
  gap: 12px;
}

.collection-assignment-heading strong {
  color: #121212;
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.collection-assignment-heading button {
  display: inline-flex;
  align-items: center;
  gap: 5px;
  padding: 0;
  border: 0;
  background: transparent;
  color: #ea3b0c;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.collection-key-grid {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(108px, 1fr));
  gap: 8px;
}

.collection-key-option {
  display: grid;
  min-height: 72px;
  align-content: center;
  gap: 5px;
  padding: 10px 8px;
  border: 1px solid #d8d5cf;
  background: transparent;
  color: #121212;
  text-align: center;
}

.collection-key-option:hover,
.collection-key-option.active {
  border-color: #121212;
  background: #121212;
  color: #fefbf7;
}

.collection-key-option span,
.collection-key-option small {
  min-width: 0;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.collection-key-option span {
  font-size: 12px;
  font-weight: 700;
  letter-spacing: 0.04em;
  text-transform: uppercase;
}

.collection-key-option small {
  color: inherit;
  font-size: 10px;
  line-height: 1.2;
}

.metadata-edit-panel {
  display: grid;
  grid-template-rows: minmax(0, 1fr) auto;
  gap: 18px;
  min-height: 100%;
}

.metadata-section {
  display: grid;
  align-content: start;
  gap: 10px;
  min-height: 0;
}

.metadata-action-footer {
  display: grid;
  gap: 10px;
  margin-top: auto;
}

.metadata-section-heading {
  display: flex;
  min-height: 22px;
  align-items: center;
  justify-content: space-between;
  gap: 12px;
}

.metadata-section-heading strong {
  color: #121212;
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.metadata-clear-button {
  min-height: 28px;
  padding: 0 11px;
  border: 1px solid #dedbd5;
  background: #fff;
  color: #6c6861;
  font-size: 11px;
  font-weight: 650;
}

.metadata-clear-button:hover {
  border-color: #121212;
  color: #121212;
}

.metadata-size-grid,
.metadata-category-grid {
  display: grid;
  gap: 8px;
}

.metadata-size-grid {
  grid-template-columns: repeat(4, minmax(0, 1fr));
}

.metadata-category-grid {
  grid-template-columns: repeat(auto-fill, minmax(132px, 1fr));
}

.metadata-size-option,
.metadata-category-option {
  min-height: 42px;
  padding: 0 12px;
  border: 1px solid #dedbd5;
  background: #fff;
  color: #121212;
  font-size: 12px;
  font-weight: 650;
  letter-spacing: 0;
}

.metadata-category-option {
  min-height: 48px;
  padding: 0 10px;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.metadata-size-option:hover,
.metadata-category-option:hover,
.metadata-size-option.active,
.metadata-category-option.active {
  border-color: #121212;
  background: #121212;
  color: #fff;
}

.admin-primary-action {
  display: inline-flex;
  min-height: 42px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  padding: 0 16px;
  border: 0;
  background: #121212;
  color: #fff;
  font-size: 12px;
  font-weight: 750;
  letter-spacing: 0;
}

.admin-primary-action:hover:not(:disabled) {
  background: #2b2b2b;
  transform: translateY(-1px);
}

.admin-primary-action:disabled {
  cursor: default;
  opacity: 0.42;
}

.add-look-panel {
  display: grid;
  grid-template-rows: auto auto minmax(0, 1fr) auto auto auto;
  gap: 14px;
  min-height: 100%;
  max-width: none;
  margin: 0;
  padding: 0;
  border-top: 0;
}

.listing-look-resolver-panel {
  min-height: 0;
  padding: 0;
  border: 0;
  background: transparent;
}

.listing-look-resolver-panel.manual-mode {
  grid-template-rows: auto auto minmax(0, 1fr) auto auto auto;
  min-height: 0;
  height: 100%;
}

.listing-look-resolver-panel.suggestions-mode {
  grid-template-rows: auto auto auto auto auto auto;
}

.add-look-heading {
  display: flex;
  align-items: center;
  justify-content: flex-start;
  gap: 12px;
  min-height: 20px;
}

.add-look-heading strong {
  color: #121212;
  font-size: 11px;
  font-weight: 700;
  letter-spacing: 0.08em;
  text-transform: uppercase;
}

.look-resolution-mode-control {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 3px;
  padding: 3px;
  border: 1px solid rgba(18, 18, 18, 0.06);
  border-radius: 999px;
  background: rgba(18, 18, 18, 0.05);
}

.look-resolution-mode-control button {
  min-height: 32px;
  border: 0;
  border-radius: 999px;
  background: transparent;
  color: #706c63;
  font-size: 12px;
  font-weight: 700;
  letter-spacing: 0;
}

.look-resolution-mode-control button.active {
  background: #fff;
  color: #121212;
  box-shadow: 0 1px 4px rgba(18, 18, 18, 0.08);
}

.look-resolution-stage {
  display: grid;
  grid-template-columns: repeat(2, minmax(0, 1fr));
  gap: 10px;
  min-height: 220px;
}

.look-resolution-image {
  position: relative;
  display: grid;
  min-width: 0;
  min-height: 220px;
  place-items: center;
  overflow: hidden;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 16px;
  background: #fff;
}

.look-resolution-image.runway {
  background: rgba(246, 246, 247, 0.62);
}

.look-resolution-image img {
  width: 100%;
  height: 100%;
  object-fit: contain;
}

.look-resolution-image > svg {
  color: #9b968d;
}

.look-resolution-image > span {
  position: absolute;
  left: 9px;
  bottom: 9px;
  max-width: calc(100% - 18px);
  overflow: hidden;
  padding: 5px 7px;
  border-radius: 999px;
  background: rgba(255, 255, 255, 0.84);
  color: #121212;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.02em;
  text-overflow: ellipsis;
  text-transform: uppercase;
  white-space: nowrap;
  backdrop-filter: blur(12px);
}

.add-look-heading button {
  display: inline-flex;
  width: 22px;
  height: 22px;
  align-items: center;
  justify-content: center;
  padding: 0;
  border: 0;
  background: transparent;
  color: #121212;
}

.existing-look-picker {
  display: grid;
  align-content: start;
  gap: 10px;
  min-height: 0;
}

.listing-look-resolver-panel.manual-mode .existing-look-picker {
  grid-template-rows: auto minmax(0, 1fr) auto;
  align-content: stretch;
}

.look-suggestion-list {
  max-height: 360px;
}

.look-suggestion-list .manual-review-neighbour-title {
  font-size: 12px;
  font-weight: 650;
}

.existing-look-picker .status-line {
  min-height: 34px;
  padding: 0;
  font-size: 11px;
}

.existing-look-picker-heading {
  display: flex;
  min-height: 18px;
  align-items: center;
  justify-content: space-between;
  gap: 12px;
  color: #706c63;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.existing-look-picker-heading button {
  display: inline-flex;
  align-items: center;
  gap: 5px;
  padding: 0;
  border: 0;
  background: transparent;
  color: #ea3b0c;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.look-resolution-heading-actions {
  display: inline-flex;
  align-items: center;
  gap: 8px;
}

.look-resolution-strip {
  display: flex;
  min-height: 118px;
  gap: 8px;
  overflow-x: auto;
  overflow-y: hidden;
  padding: 2px 0 6px;
  scrollbar-width: thin;
}

.listing-look-resolver-panel .look-resolution-strip {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(124px, 1fr));
  max-height: min(56dvh, 620px);
  min-height: 0;
  gap: 12px;
  overflow-x: hidden;
  overflow-y: auto;
  padding: 2px 2px 8px;
}

.listing-look-resolver-panel.manual-mode .look-resolution-strip {
  height: 100%;
  max-height: none;
}

.look-resolution-card {
  position: relative;
  display: grid;
  width: 88px;
  min-width: 88px;
  height: 116px;
  grid-template-rows: minmax(0, 1fr) auto;
  overflow: hidden;
  padding: 0;
  border: 1px solid rgba(18, 18, 18, 0.08);
  border-radius: 12px;
  background: #fff;
  color: #121212;
  text-align: left;
}

.listing-look-resolver-panel .look-resolution-card {
  width: auto;
  min-width: 0;
  height: 196px;
  border-radius: 14px;
}

.look-resolution-card.active {
  border-color: #121212;
  box-shadow: 0 0 0 2px rgba(18, 18, 18, 0.08);
}

.look-resolution-card img {
  width: 100%;
  height: 100%;
  min-height: 0;
  object-fit: contain;
  background: #fff;
}

.listing-look-resolver-panel .look-resolution-card img {
  padding: 6px;
}

.look-resolution-card span {
  padding: 6px 7px;
  overflow: hidden;
  color: #121212;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.02em;
  text-overflow: ellipsis;
  text-transform: uppercase;
  white-space: nowrap;
}

.look-resolution-card small {
  position: absolute;
  top: 6px;
  right: 6px;
  padding: 4px 5px;
  border-radius: 999px;
  background: rgba(255, 255, 255, 0.86);
  color: #121212;
  font-size: 10px;
  font-weight: 800;
  line-height: 1;
}

.listing-look-resolver-panel .add-look-submit {
  min-height: 40px;
}

.listing-look-resolver-panel.manual-mode > .existing-look-picker > .add-look-submit {
  position: sticky;
  bottom: 0;
  z-index: 2;
  box-shadow: 0 -10px 22px rgba(255, 255, 255, 0.86);
}

.existing-look-grid {
  display: grid;
  grid-template-columns: repeat(auto-fill, minmax(112px, 1fr));
  gap: 8px;
}

.existing-look-option {
  position: relative;
  display: grid;
  min-height: 62px;
  align-content: center;
  gap: 4px;
  padding: 8px 7px;
  border: 1px solid #d8d5cf;
  background: transparent;
  color: #121212;
  text-align: center;
}

@container (min-width: 520px) {
  .image-order-strip {
    grid-template-columns: repeat(auto-fill, minmax(104px, 1fr));
    gap: 10px;
  }

  .existing-look-grid {
    grid-template-columns: repeat(auto-fill, minmax(124px, 1fr));
    gap: 10px;
  }
}

@container (min-width: 720px) {
  .image-order-strip {
    grid-template-columns: repeat(auto-fill, minmax(132px, 1fr));
  }

  .existing-look-grid {
    grid-template-columns: repeat(auto-fill, minmax(132px, 1fr));
  }
}

.existing-look-option:hover:not(:disabled) {
  border-color: #121212;
  background: #121212;
  color: #fefbf7;
}

.existing-look-option:disabled {
  cursor: wait;
  opacity: 0.62;
}

.existing-look-option span,
.existing-look-option small {
  min-width: 0;
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap;
}

.existing-look-option span {
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.04em;
  text-transform: uppercase;
}

.existing-look-option small {
  color: inherit;
  font-size: 10px;
}

.existing-look-option svg {
  position: absolute;
  top: 5px;
  right: 5px;
}

.existing-look-empty {
  min-height: 30px;
  color: #706c63;
  font-size: 11px;
  line-height: 1.4;
}

.add-look-divider {
  display: flex;
  align-items: center;
  gap: 10px;
  margin-top: auto;
  color: #706c63;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.add-look-divider::before,
.add-look-divider::after {
  content: "";
  height: 1px;
  flex: 1 1 0;
  background: #d8d5cf;
}

.add-look-fields {
  display: grid;
  grid-template-columns: minmax(82px, 0.48fr) minmax(0, 1fr);
  gap: 14px;
}

.add-look-fields label {
  display: grid;
  gap: 7px;
  min-width: 0;
  color: #706c63;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: 0.06em;
  text-transform: uppercase;
}

.add-look-fields input {
  width: 100%;
  min-width: 0;
  min-height: 30px;
  padding: 0;
  border: 0;
  border-bottom: 1px solid #b9b6b1;
  outline: 0;
  background: transparent;
  color: #121212;
  font-size: 12px;
  letter-spacing: 0;
}

.add-look-fields input:focus {
  border-bottom-color: #121212;
}

.add-look-error {
  color: #ea3b0c;
  font-size: 11px;
}

.add-look-submit {
  display: inline-flex;
  min-height: 42px;
  align-items: center;
  justify-content: center;
  gap: 8px;
  padding: 0 16px;
  border: 0;
  background: #121212;
  color: #fff;
  font-size: 12px;
  font-weight: 750;
  letter-spacing: 0;
}

.add-look-submit:hover:not(:disabled) {
  background: #2b2b2b;
  transform: translateY(-1px);
}

.add-look-submit:disabled {
  cursor: default;
  opacity: 0.54;
}

.buy-button {
  width: 100%;
  max-width: none;
  min-height: 52px;
  margin-top: 22px;
  padding: 0 18px;
  border: 0;
  border-radius: 999px;
  background: var(--kaayd-blue);
  color: #fff;
  box-shadow: none;
  font-size: 15px;
  font-weight: 700;
  letter-spacing: 0;
  text-transform: none;
  text-decoration: none;
  transition: background-color 150ms ease;
}

.listing-detail .buy-button:hover {
  background: var(--kaayd-blue-hover);
}

.status-line,
.inline-error,
.empty-state {
  display: flex;
  align-items: center;
  gap: 10px;
  color: #706c63;
}

.status-line {
  padding: 18px 0;
  font-size: 13px;
}

.inline-error {
  justify-content: space-between;
  max-width: 1440px;
  margin: 22px auto 0;
  padding: 14px 0;
  border-top: 1px solid #b56b61;
  border-bottom: 1px solid #b56b61;
  color: #ea3b0c;
}

.inline-error button,
.retry-button {
  padding: 0 12px;
  border: 1px solid #e5e4e2;
  background: transparent;
  color: #121212;
}

.empty-state {
  justify-content: center;
  min-height: 260px;
}

.listing-skeleton {
  aspect-ratio: 3 / 4;
  background:
    linear-gradient(90deg, #f0eeeb, #fff, #f0eeeb);
  background-size: 200% 100%;
  animation: shimmer 1200ms infinite;
}

.spin {
  animation: spin 900ms linear infinite;
}

@keyframes shimmer {
  to {
    background-position: -200% 0;
  }
}

@keyframes spin {
  to {
    transform: rotate(360deg);
  }
}

@media (max-width: 1180px) {
  .listing-detail {
    grid-template-columns: 1fr;
    height: auto;
    min-height: calc(100dvh - 104px);
    max-height: none;
    overflow: visible;
  }

  .listing-detail-media,
  .listing-carousel,
  .listing-detail-image,
  .listing-reference-stage {
    min-height: min(72vh, 760px);
  }

  .listing-detail-content {
    grid-template-rows: auto;
    width: min(620px, 100%);
    max-height: none;
    overflow: visible;
  }

  .manual-review-match-detail {
    grid-template-columns: 1fr;
  }

  .manual-review-match-detail .manual-review-detail-content {
    max-height: none;
    overflow: visible;
    padding-right: 0;
  }

  .manual-review-invalid-detail {
    height: auto;
    min-height: calc(100dvh - 104px);
    overflow: visible;
  }

  .manual-review-invalid-detail .manual-review-detail-content,
  .manual-review-invalid-detail .manual-review-detail-bottom {
    max-height: none;
    overflow: visible;
  }

  .manual-review-invalid-detail .manual-review-detail-content,
  .manual-review-invalid-detail .manual-review-detail-bottom {
    padding-right: 0;
  }

  .manual-review-match-media,
  .manual-review-match-carousel {
    min-height: 0;
  }

  .manual-review-match-stage {
    min-height: 0;
  }

  .manual-review-match-stage .listing-detail-image {
    height: min(56vw, 620px);
    min-height: 0;
  }

  .manual-review-invalid-info-detail .manual-review-match-stage .listing-detail-image {
    height: min(72vh, 760px);
    min-height: 0;
  }

  .listing-detail-bottom {
    align-self: start;
    margin-top: 34px;
  }

  .listing-detail-content h1 {
    max-width: 100%;
  }

  .runway-look-browser-body {
    grid-template-columns: minmax(0, 1fr) minmax(0, 1fr);
    grid-template-rows: minmax(320px, 0.9fr) minmax(260px, 1fr);
  }

  .runway-look-browser-grid-panel {
    grid-column: 1 / -1;
    border-top: 1px solid rgba(18, 18, 18, 0.08);
    border-left: 0;
    padding-top: 14px;
    padding-left: 0;
  }

  .runway-look-browser-grid {
    grid-auto-rows: 220px;
    grid-template-columns: repeat(auto-fill, minmax(150px, 1fr));
  }

  .runway-look-browser-grid button {
    height: 220px;
  }
}

@media (max-width: 980px) {
  .brand-landing {
    padding: 0 20px 54px;
  }

  .landing-logo {
    font-size: 0.875em;
  }

  .brand-landing-hero {
    min-height: 88vh;
    margin-right: -20px;
    margin-left: -20px;
  }

  .home-page .brand-landing-hero {
    min-height: 100vh;
    margin: 0;
  }

  .brand-landing-nav {
    align-items: flex-start;
    flex-direction: column;
    gap: 18px;
    padding: 26px 20px 0;
  }

  .brand-landing-nav nav,
  .browse-area::before {
    justify-content: flex-start;
    overflow: auto;
  }

  .app-top-nav {
    grid-template-columns: minmax(0, 1fr) auto minmax(0, 1fr);
    padding-top: 18px;
    padding-bottom: 14px;
  }

  .app-top-nav nav {
    min-width: 0;
    justify-content: flex-end;
    overflow: visible;
  }

  .brand-nav-dropdown {
    min-width: min(280px, calc(100vw - 40px));
  }

  .brand-landing-copy {
    padding: 0 20px 56px;
  }

  .brand-landing-action {
    bottom: 42px;
  }

  .brand-landing-copy h1 {
    font-size: 56px;
  }

  .browse-area,
  .listing-page {
    padding-right: 20px;
    padding-left: 20px;
  }

  .listing-detail-media,
  .listing-carousel {
    width: 100%;
    max-width: 100%;
  }

  .listing-carousel {
    grid-template-columns: 1fr;
    grid-template-rows: auto auto;
    align-items: stretch;
    gap: 14px;
    min-height: 0;
  }

  .listing-reference-stage {
    order: 1;
  }

  .listing-carousel .listing-detail-image {
    order: 1;
    min-height: min(66vh, 720px);
  }

  .manual-review-match-carousel {
    grid-template-rows: auto auto;
  }

  .manual-review-match-stage {
    order: 1;
    grid-template-columns: repeat(2, minmax(0, 1fr));
    min-height: 0;
  }

  .manual-review-match-stage .listing-detail-image {
    height: min(62vw, 560px);
    min-height: 0;
  }

  .manual-review-matched-view {
    grid-template-columns: 1fr;
  }

  .listing-reference-stage.active {
    grid-template-columns: 1fr;
  }

  .listing-thumbnail-row {
    order: 2;
    display: flex;
    max-width: 100%;
    max-height: none;
    align-content: stretch;
    justify-content: flex-start;
    overflow-x: auto;
    padding-bottom: 4px;
    scrollbar-width: none;
  }

  .listing-thumbnail-row::-webkit-scrollbar {
    display: none;
  }

  .listing-thumbnail {
    flex: 0 0 56px;
    width: 56px;
    height: 56px;
  }

  .manual-review-match-thumbnail-row {
    order: 2;
    display: flex;
    max-width: 100%;
    max-height: none;
    justify-content: flex-start;
    overflow-x: auto;
    overflow-y: hidden;
    padding-bottom: 4px;
  }

  .manual-review-match-thumbnail-row .listing-thumbnail {
    flex: initial;
  }

  .browse-area::before {
    margin-right: -20px;
    margin-left: -20px;
    padding-right: 20px;
    padding-left: 20px;
  }

  .collection-rail {
    top: 64px;
    padding: 0 20px;
  }

  .brand-block {
    grid-column: 1;
  }

  .collection-list {
    gap: 8px;
    padding: 14px 0 12px;
  }

  .product-index {
    display: block;
  }

  .collection-header h2 {
    font-size: 42px;
  }

  .listing-detail {
    grid-template-columns: 1fr;
    gap: 28px;
  }

  .manual-review-workspace {
    grid-template-columns: 1fr;
  }

  .manual-review-panel {
    position: static;
  }

  .listing-detail-content {
    position: static;
    padding-top: 16px;
  }

  .listing-detail-content h1 {
    font-size: 36px;
  }

  .product-toolbar {
    grid-template-columns: minmax(0, 1fr) auto;
    align-items: start;
    gap: 16px;
    padding-bottom: 18px;
  }

  .wishlist-heading {
    align-items: flex-start;
    flex-direction: column;
    gap: 12px;
  }

  .wishlist-content {
    padding: 30px 20px 72px;
  }

  .wishlist-count {
    padding-bottom: 0;
  }

  .toolbar-actions {
    width: auto;
    justify-self: end;
    justify-content: flex-end;
    gap: 10px;
    flex-wrap: wrap;
  }

  .collection-filter-bar {
    width: auto;
    justify-content: flex-end;
    flex-wrap: wrap;
    gap: 10px;
  }

  .collection-filter-clear-slot {
    min-width: 0;
  }
}

@media (max-width: 680px) {
  .manual-review-type-grid {
    grid-template-columns: 1fr;
  }

  .manual-review-type-card {
    min-height: 150px;
  }

  .manual-review-match-stage {
    grid-template-columns: 1fr;
    min-height: 0;
  }

  .manual-review-matched-view {
    grid-template-columns: 1fr;
  }

  .manual-review-match-stage .listing-detail-image {
    height: min(92vw, 430px);
    min-height: 0;
  }

  .manual-review-invalid-info-detail .manual-review-match-stage .listing-detail-image {
    height: min(92vw, 520px);
    min-height: 0;
  }

  .manual-review-incorrect-detail .manual-review-match-stage .listing-detail-image {
    height: min(92vw, 520px);
    min-height: 0;
  }

  .manual-review-match-thumbnail-row {
    order: 2;
    display: flex;
    max-width: 100%;
    max-height: none;
    justify-content: flex-start;
    overflow-x: auto;
    overflow-y: hidden;
    padding-bottom: 4px;
  }

  .manual-review-neighbour-list {
    max-height: 500px;
  }

  .manual-review-neighbour {
    grid-template-columns: minmax(0, 1fr) 34px;
  }

  .manual-review-neighbour-open {
    grid-column: 2;
    grid-row: 1;
  }

  .runway-look-browser-backdrop {
    padding: 8px;
  }

  .runway-look-browser {
    width: calc(100vw - 16px);
    height: calc(100dvh - 16px);
    border-radius: 14px;
  }

  .runway-look-browser-header {
    align-items: flex-start;
    flex-wrap: wrap;
    padding: 12px;
  }

  .runway-look-browser-tabs {
    order: 3;
    width: 100%;
    margin-left: 0;
  }

  .runway-look-browser-body {
    grid-template-columns: 1fr;
    grid-template-rows: minmax(260px, 0.8fr) minmax(260px, 0.8fr) minmax(240px, 1fr);
    gap: 12px;
    padding: 10px;
    overflow-y: auto;
  }

  .runway-look-browser-grid-panel {
    grid-column: auto;
  }

  .runway-look-browser-grid {
    grid-template-columns: repeat(2, minmax(0, 1fr));
    grid-auto-rows: 190px;
    height: auto;
    max-height: 480px;
  }

  .runway-look-suggestion-list {
    height: auto;
    max-height: 480px;
  }

  .runway-look-browser-grid button {
    height: 190px;
  }
}

@media (max-width: 620px) {
  .admin-tools-panel {
    top: 76px;
    left: 18px;
    width: calc(100vw - 36px);
    min-width: 0;
    max-height: calc(100dvh - 94px);
  }

  .site-footer {
    grid-template-columns: 1fr;
    gap: 6px;
    min-height: auto;
    padding: 10px 20px;
    text-align: center;
  }

  .site-footer > span,
  .site-footer > a,
  .site-footer nav {
    grid-column: auto;
    justify-self: center;
  }

  .site-footer nav {
    gap: 5px 12px;
    row-gap: 5px;
  }

  .site-footer .footer-separator {
    display: none;
  }

  .app-top-nav {
    gap: 10px;
    min-height: 64px;
    padding-top: 12px;
    padding-bottom: 10px;
  }

  .app-top-nav .logo-link {
    font-size: 24px;
    letter-spacing: 0.18em;
  }

  .brand-nav-current {
    display: none;
  }

  .brand-nav-menu summary {
    gap: 5px;
  }

  .brand-nav-label {
    font-size: 8px;
    letter-spacing: 0.12em;
  }

  .brand-landing-nav nav {
    gap: 18px;
    width: 100%;
    padding-bottom: 6px;
  }

  .brand-landing-copy h1 {
    font-size: 42px;
  }

  .auth-dropdown {
    right: auto;
    left: 0;
    width: min(300px, calc(100vw - 40px));
  }

  .brand-landing-action {
    bottom: 72px;
  }

  .home-brand-selector {
    top: calc(100% + 22px);
    left: 50%;
    grid-template-columns: minmax(0, max-content) auto;
    transform: translateX(-50%) translateY(-8px);
  }

  .home-brand-selector-window {
    max-width: 78vw;
  }

  .brand-landing-action:hover .home-brand-selector,
  .brand-landing-action:focus-within .home-brand-selector {
    transform: translateX(-50%) translateY(0);
  }

  .home-brand-selector::before {
    display: none;
  }

  .collection-header {
    grid-template-columns: 1fr;
  }

  .product-toolbar {
    grid-template-columns: minmax(0, 1fr) auto;
    align-items: end;
    gap: 12px;
  }

  .toolbar-actions {
    width: auto;
    align-self: end;
    justify-self: end;
  }

  .toolbar-actions,
  .collection-filter-bar {
    justify-content: flex-end;
  }

  .toolbar-title-row {
    max-width: 100%;
  }

  .collection-filter-dropdown,
  .product-toolbar button.collection-stock-toggle {
    flex: 0 0 auto;
  }

  .product-toolbar button.collection-filter-pill {
    justify-content: flex-start;
    width: auto;
  }

  .collection-size-panel,
  .collection-price-panel {
    max-width: calc(100vw - 40px);
    overflow-x: auto;
  }

  .collection-stat {
    text-align: left;
  }

  .listing-grid {
    grid-template-columns: repeat(2, minmax(0, 1fr));
    gap: 34px 12px;
  }

  .listing-copy {
    gap: 7px;
    min-width: 0;
  }

  .title-button {
    grid-template-rows: auto 15px;
    width: 100%;
    text-align: left;
  }

  .card-price-line {
    text-align: right;
  }

  .designer-line,
  .designer-line p {
    font-size: 10px;
    line-height: 1.15;
    white-space: nowrap;
  }

  .product-line {
    display: block;
    height: 15px;
    max-height: 15px;
    font-size: 11px;
    line-height: 1.25;
    text-overflow: ellipsis;
    white-space: nowrap;
  }

  .listing-card-meta {
    width: 100%;
  }

  .listing-page-nav {
    gap: 18px;
    margin-bottom: 20px;
  }

  .listing-detail-image {
    width: 100%;
    max-height: none;
    overflow: hidden;
  }

  .bulk-looks-modal-backdrop {
    align-items: end;
    padding: 12px;
  }

  .bulk-looks-modal {
    width: 100%;
    max-height: calc(100dvh - 24px);
    border-radius: 24px;
  }

  .bulk-looks-modal-header {
    padding: 18px 18px 14px;
  }

  .bulk-looks-progress,
  .bulk-looks-count-step,
  .bulk-looks-url-step,
  .bulk-looks-vogue-step {
    padding-right: 18px;
    padding-left: 18px;
  }

  .bulk-looks-mode-control {
    margin-right: 18px;
    margin-left: 18px;
  }

  .bulk-looks-existing-summary {
    margin-right: 18px;
    margin-left: 18px;
  }

  .bulk-looks-count-control {
    grid-template-columns: 46px minmax(0, 1fr) 46px;
    min-height: 172px;
    gap: 8px;
    padding: 18px 12px;
    border-radius: 22px;
  }

  .bulk-looks-count-control > button {
    width: 46px;
    height: 46px;
  }

  .bulk-looks-count-control input {
    font-size: 64px;
  }

  .bulk-looks-url-grid {
    max-height: 50dvh;
  }

  .bulk-looks-file-drop {
    min-height: 188px;
    border-radius: 22px;
  }

  .bulk-looks-url-grid label {
    grid-template-columns: 1fr;
    gap: 6px;
    min-height: 72px;
    padding: 10px 14px;
  }

  .bulk-looks-modal-actions {
    display: grid;
    grid-template-columns: 1fr 1fr;
  }

  .listing-reference-stage {
    min-height: 0;
  }

  .listing-reference-stage.active .listing-detail-image {
    min-height: min(86vw, 460px);
  }

  .listing-detail-image img {
    max-width: 100%;
    max-height: 58vh;
    border-radius: 14px;
  }

  .listing-carousel-rail {
    width: 100%;
    gap: 8px;
  }

  .listing-thumbnail-row {
    max-width: 100%;
  }

  .listing-thumbnail {
    flex-basis: 54px;
    width: 54px;
    height: 54px;
  }

  .detail-meta span {
    padding: 10px 0;
  }

  .description {
    margin-top: 18px;
    font-size: 12px;
    line-height: 1.55;
  }

  .buy-button {
    min-height: 40px;
    margin-top: 24px;
    padding: 10px 12px;
    line-height: 1.2;
    text-align: center;
  }

  .manual-review-header {
    align-items: flex-start;
    flex-direction: column;
  }

  .manual-review-media {
    grid-template-columns: 1fr;
  }

  .manual-review-actions {
    align-items: stretch;
    flex-direction: column;
  }

  .manual-review-actions .icon-text-button {
    justify-content: center;
  }

  .listing-detail-content h1 {
    font-size: 28px;
    line-height: 1;
  }
}

.discovery-nav-links button,
.discovery-nav-actions .auth-menu > button,
.discovery-icon-button,
.discovery-primary-button,
.discovery-secondary-button,
.discovery-shelf-head button,
.kayded-hero-cta,
.kayded-landing-footer > button,
.waitlist-close-button,
.waitlist-submit-button,
.waitlist-success button,
.change-password-heading button,
.change-password-modal .auth-dropdown-submit,
.auth-dropdown-submit,
.home-brand-selector button,
.brand-landing-nav nav button,
.home-brand-selector-arrow,
.home-brand-selector-option,
.brand-nav-menu summary,
.brand-nav-dropdown,
.brand-nav-dropdown button,
.top-nav-tab,
.account-dropdown button,
.collection-button,
.retry-button,
.product-toolbar button,
.collection-filter-clear,
.collection-filter-pill,
.collection-size-chip,
.collection-price-apply,
.collection-stock-toggle,
.listing-image-button,
.primary-button,
.buy-button,
.inline-error button,
.back-button,
.manual-review-success button,
.icon-text-button,
.listing-carousel-arrow,
.add-look-toggle,
.collection-assignment-heading button,
.collection-key-option,
.metadata-clear-button,
.metadata-size-option,
.metadata-category-option,
.admin-primary-action,
.add-look-heading button,
.existing-look-picker-heading button,
.existing-look-option,
.add-look-submit {
  border-radius: var(--button-radius);
}

.favorite-button,
.delete-listing-button,
.accept-review-button,
.account-dropdown-avatar {
  border-radius: 50%;
}

button:not(.currency-select-trigger):not(.currency-choice):not(.currency-close):not(.currency-done):not(.favorite-button):not(.delete-listing-button):not(.accept-review-button):not(.collection-filter-pill):not(.collection-size-chip):not(.collection-price-apply):not(.collection-stock-toggle):not(.runway-reference-toggle) {
  border-radius: var(--button-radius);
}

.product-toolbar button.collection-stock-toggle {
  border-radius: 999px;
}

.product-toolbar button.collection-size-chip {
  border-radius: 50%;
}

.listing-page button.listing-carousel-arrow,
.listing-page .listing-size-icon {
  border-radius: 50%;
}

.listing-page button.listing-carousel-arrow {
  border: 1px solid rgba(18, 18, 18, 0.12);
}

.runway-look-browser-grid button,
.runway-look-browser-listing-thumbs button {
  border-radius: var(--button-radius);
}

.discovery-primary-button,
.discovery-secondary-button,
.discovery-blue-button,
.discovery-neutral-button,
.discovery-home .button,
.discovery-home .collection-card__action,
.auth-nav-button,
.auth-dropdown-submit,
.change-password-modal .auth-dropdown-submit,
.waitlist-submit-button,
.waitlist-success button,
.delete-confirm-cancel,
.delete-confirm-primary,
.bulk-looks-primary,
.bulk-looks-secondary,
.bulk-looks-mode-control button,
.primary-button,
.buy-button,
.retry-button,
.inline-error button,
.back-button,
.listing-pill-button,
.runway-reference-toggle,
.listing-admin-look-button,
.admin-primary-action,
.add-look-submit,
.icon-text-button,
.metadata-clear-button,
.manual-review-resolve-button,
.manual-review-move-button,
.manual-review-trash-button {
  border-radius: 999px !important;
}

@media (prefers-reduced-motion: reduce) {
  .share-link-toast {
    transform: translateX(-50%);
    transition: opacity 120ms ease;
  }

  .share-link-toast.visible {
    transform: translateX(-50%);
  }
}

/* Discovery landing v4.3 */
.discovery-home {
  --discovery-page-max: 1600px;
  --discovery-content-max: 1440px;
  --discovery-gutter: clamp(20px, 4.45vw, 72px);
  --discovery-section-space: clamp(72px, 8vw, 128px);
  --discovery-header-height: 54px;
  --discovery-radius-sm: 10px;
  --discovery-radius-md: 18px;
  --discovery-radius-lg: 30px;
  --discovery-radius-pill: 999px;
  --discovery-accent: #1f62e8;
  --discovery-accent-hover: #164fbf;
  --discovery-ink: #101114;
  --discovery-muted: #62666d;
  --discovery-line: #d8dadd;
  --discovery-surface: #f3f4f6;
  --discovery-ease: cubic-bezier(.2, .8, .2, 1);
  min-height: 100vh;
  overflow-x: hidden;
  background: #fff;
  color: var(--discovery-ink);
  font-family: Inter, ui-sans-serif, -apple-system, BlinkMacSystemFont, "Segoe UI", Helvetica, Arial, sans-serif;
}

.discovery-nav {
  position: sticky;
  top: 0;
  z-index: 50;
  width: min(calc(100% - 40px), calc(var(--discovery-page-max) - 40px));
  height: var(--discovery-header-height);
  margin: 0 auto;
  padding: 0;
  display: grid;
  grid-template-columns: minmax(92px, 1fr) auto minmax(92px, 1fr);
  align-items: center;
  gap: 18px;
  border-bottom: 1px solid rgb(16 17 20 / .08);
  background: rgb(255 255 255 / .78);
  backdrop-filter: blur(22px) saturate(1.35);
}

.discovery-logo {
  justify-self: start;
  padding: 0;
  border: 0;
  background: transparent;
  color: var(--discovery-ink);
  font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, ui-sans-serif, system-ui, sans-serif;
  font-size: 15px;
  font-weight: 600;
  letter-spacing: .18em;
  cursor: pointer;
}

.discovery-nav-links {
  display: flex;
  align-items: center;
  justify-content: center;
  height: 100%;
  gap: 2px;
}

.discovery-nav-links button {
  min-height: 30px;
  padding: 0 11px;
  border: 0;
  border-radius: 6px;
  background: transparent;
  color: rgb(16 17 20 / .56);
  font-size: 12px;
  white-space: nowrap;
}

.discovery-nav-links button:hover,
.discovery-nav-links button.active {
  color: var(--discovery-ink);
}

.discovery-nav-links button.active {
  background: rgb(255 255 255 / .72);
  box-shadow: inset 0 0 0 1px rgb(16 17 20 / .08);
}

.discovery-nav-actions {
  display: flex;
  min-width: 0;
  align-items: center;
  justify-content: flex-end;
  gap: 14px;
  color: rgb(16 17 20 / .56);
  font-size: 10px;
  font-weight: 700;
  letter-spacing: .11em;
  text-transform: uppercase;
}

.discovery-nav-actions .auth-menu {
  gap: 0;
}

.discovery-nav-actions .auth-menu > .auth-nav-secondary {
  display: none;
}

.discovery-nav-actions .auth-menu > .auth-nav-login {
  min-width: 78px;
  min-height: 34px;
  padding: 0 15px;
  border: 1px solid rgb(16 17 20 / .14);
  border-radius: var(--discovery-radius-pill);
  background: rgb(255 255 255 / .72);
  color: var(--discovery-ink);
  box-shadow: inset 0 0 0 1px rgb(255 255 255 / .46);
  font-size: 12px;
  font-weight: 700;
  letter-spacing: 0;
  line-height: 1;
  text-transform: none;
  transition: background .2s var(--discovery-ease), border-color .2s var(--discovery-ease), transform .2s var(--discovery-ease);
}

.discovery-nav-actions .auth-menu > .auth-nav-login:hover,
.discovery-nav-actions .auth-menu > .auth-nav-login:focus-visible {
  border-color: rgb(16 17 20 / .24);
  background: #fff;
  color: var(--discovery-ink);
  box-shadow: inset 0 0 0 1px rgb(255 255 255 / .46);
  transform: translateY(-1px);
}

.discovery-icon-button,
.discovery-wishlist-button,
.discovery-account-menu .top-nav-user {
  color: rgb(16 17 20 / .64);
}

.discovery-icon-button {
  width: 32px;
  height: 32px;
  display: inline-grid;
  place-items: center;
  padding: 0;
  border: 0;
  background: transparent;
}

.discovery-wishlist-button {
  display: inline-flex;
  align-items: center;
  gap: 7px;
  padding: 0;
  border: 0;
  background: transparent;
  font-size: 10px;
  font-weight: 700;
  letter-spacing: .11em;
}

.discovery-account-menu {
  position: relative;
}

.discovery-account-menu .top-nav-user {
  width: 32px;
  height: 32px;
  display: inline-grid;
  place-items: center;
  padding: 0;
  border: 0;
  background: transparent;
}

.discovery-hero {
  width: min(calc(100% - 40px), calc(var(--discovery-page-max) - 40px));
  min-height: clamp(620px, calc(100svh - var(--discovery-header-height) - 56px), 800px);
  margin: 24px auto 0;
  padding: 0;
  display: grid;
  place-items: center;
}

.discovery-hero-frame {
  position: relative;
  width: 100%;
  min-height: inherit;
  height: 100%;
  overflow: hidden;
  border: 0;
  border-radius: var(--discovery-radius-lg);
  background: #d9dadd;
  box-shadow: none;
  isolation: isolate;
}

.discovery-hero-media,
.discovery-hero-scrim {
  position: absolute;
  inset: 0;
}

.discovery-hero-media {
  z-index: 0;
  background: #101114;
}

.discovery-hero-media video {
  width: 100%;
  height: 100%;
  object-fit: cover;
  object-position: center top;
}

.discovery-hero-scrim {
  z-index: 1;
  background: linear-gradient(180deg, rgb(0 0 0 / .08), rgb(0 0 0 / .36));
}

.discovery-hero-copy {
  position: relative;
  z-index: 2;
  width: min(980px, calc(100% - 40px));
  margin: 16% auto 0;
  display: grid;
  justify-items: center;
  color: #fff;
  text-align: center;
}

.discovery-kicker,
.discovery-eyebrow {
  margin: 0 0 10px;
  color: var(--discovery-muted);
  font-size: 12px;
  font-weight: 750;
  letter-spacing: .11em;
  line-height: 1.25;
  text-transform: uppercase;
}

.discovery-hero-copy .discovery-kicker {
  color: rgb(255 255 255 / .78);
}

.discovery-hero-copy h1 {
  max-width: 900px;
  margin: 0 auto 18px;
  color: #fff;
  font-size: clamp(44px, 5.5vw, 84px);
  font-weight: 560;
  letter-spacing: -.045em;
  line-height: .98;
  text-wrap: balance;
}

.discovery-description {
  max-width: 640px;
  margin: 0 auto 30px;
  color: rgb(255 255 255 / .9);
  font-size: clamp(18px, 1.6vw, 24px);
  line-height: 1.45;
}

.discovery-hero-actions,
.discovery-campaign-actions {
  display: flex;
  flex-wrap: wrap;
  gap: 12px;
  justify-content: center;
}

.discovery-primary-button,
.discovery-secondary-button,
.discovery-blue-button,
.discovery-neutral-button {
  min-height: 48px;
  padding: 0 24px;
  display: inline-flex;
  align-items: center;
  justify-content: center;
  border: 1px solid transparent;
  border-radius: var(--discovery-radius-pill);
  font-size: 14px;
  font-weight: 700;
  line-height: 1;
  transition: background .18s ease, color .18s ease, border-color .18s ease, transform .18s ease;
}

.discovery-primary-button,
.discovery-blue-button {
  background: var(--discovery-accent);
  color: #fff;
}

.discovery-primary-button:hover,
.discovery-blue-button:hover {
  background: var(--discovery-accent-hover);
  transform: translateY(-1px);
}

.discovery-secondary-button,
.discovery-neutral-button {
  border-color: #b6bac1;
  background: #fff;
  color: var(--discovery-ink);
}

.discovery-secondary-button:hover,
.discovery-neutral-button:hover {
  background: var(--discovery-surface);
  transform: translateY(-1px);
}

.discovery-product-section {
  padding: var(--discovery-section-space) var(--discovery-gutter);
  background: #fff;
}

.discovery-section-heading {
  width: min(100%, var(--discovery-content-max));
  margin: 0 auto clamp(36px, 5vw, 64px);
}

.discovery-section-heading-centered {
  text-align: center;
}

.discovery-section-heading h2 {
  max-width: 760px;
  margin: 0 auto;
  color: var(--discovery-ink);
  font-size: clamp(28px, 2.5vw, 40px);
  font-weight: 560;
  letter-spacing: -.035em;
  line-height: 1.08;
  text-wrap: balance;
}

.discovery-product-grid {
  width: min(100%, var(--discovery-content-max));
  margin: 0 auto;
  display: grid;
  grid-template-columns: repeat(3, minmax(0, 1fr));
  gap: 20px;
}

.discovery-product-card {
  min-width: 0;
  display: grid;
  padding: 0;
  overflow: hidden;
  border: 0;
  border-radius: var(--discovery-radius-lg);
  background: var(--discovery-surface);
  color: inherit;
  text-align: left;
  transition: transform .28s var(--discovery-ease);
}

.discovery-product-card:hover {
  transform: translateY(-5px);
}

.discovery-product-media {
  width: 100%;
  aspect-ratio: 1 / .92;
  display: grid;
  place-items: center;
  overflow: hidden;
  background: #f6f6f7;
}

.discovery-product-media img {
  width: auto;
  height: auto;
  max-width: 78%;
  max-height: 78%;
  object-fit: contain;
  object-position: center;
  mix-blend-mode: multiply;
  transform: translateY(-3%);
}

.discovery-product-body {
  min-height: 150px;
  padding: 24px 28px 30px;
  display: grid;
  align-content: start;
  gap: 16px;
}

.discovery-product-main {
  display: grid;
  gap: 8px;
}

.discovery-product-main strong {
  color: var(--discovery-ink);
  font-size: clamp(22px, 2vw, 32px);
  font-weight: 560;
  letter-spacing: -.025em;
  line-height: 1.08;
}

.discovery-product-main span {
  color: var(--discovery-muted);
  font-size: 14px;
  font-weight: 600;
  line-height: 1.35;
}

.discovery-product-footer {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 16px;
  color: var(--discovery-ink);
  font-size: 14px;
  font-weight: 800;
}

.discovery-product-footer span:last-child {
  display: inline-flex;
  align-items: center;
  gap: 8px;
  font-weight: 700;
  white-space: nowrap;
}

.discovery-campaign-stack {
  padding: 0 var(--discovery-gutter) var(--discovery-section-space);
  display: grid;
  gap: 20px;
}

.discovery-intelligence-panel {
  width: min(100%, var(--discovery-content-max));
  min-height: clamp(520px, 44vw, 640px);
  margin: 0 auto;
  padding: clamp(40px, 5vw, 72px) clamp(24px, 3vw, 28px);
  display: grid;
  grid-template-columns: minmax(0, .82fr) minmax(700px, 1.18fr);
  align-items: center;
  gap: clamp(32px, 4vw, 48px);
  overflow: hidden;
  border-radius: var(--discovery-radius-lg);
  background:
    radial-gradient(circle at 82% 18%, rgb(31 98 232 / .14), transparent 34%),
    linear-gradient(135deg, #f8f9fb, #eef1f5);
}

.discovery-intelligence-copy {
  max-width: none;
  display: grid;
  gap: 18px;
}

.discovery-intelligence-copy .discovery-eyebrow {
  margin-left: 3px;
}

.discovery-intelligence-copy h2 {
  max-width: 620px;
  margin: 0;
  color: var(--discovery-ink);
  font-size: clamp(38px, 4.2vw, 66px);
  font-weight: 550;
  letter-spacing: -.045em;
  line-height: 1;
  text-wrap: balance;
}

.discovery-intelligence-copy p:not(.discovery-eyebrow) {
  max-width: 520px;
  margin: 0 0 10px;
  color: var(--discovery-muted);
  font-size: clamp(16px, 1.5vw, 20px);
  line-height: 1.45;
}

.discovery-campaign-actions {
  justify-content: flex-start;
}

.discovery-integration-board {
  position: relative;
  align-self: center;
  justify-self: end;
  width: min(100%, 714px);
  display: grid;
  grid-template-columns: repeat(4, minmax(0, 1fr));
  align-content: center;
  gap: 10px;
  isolation: isolate;
}

.discovery-integration-card {
  position: relative;
  z-index: 1;
  display: grid;
  aspect-ratio: 1;
  place-items: center;
  overflow: hidden;
  border-radius: 6px;
  background: #1a3252;
}

.discovery-integration-card img {
  width: 100%;
  height: 100%;
  display: block;
  object-fit: cover;
}

.discovery-integration-card span {
  position: absolute;
  top: 10px;
  right: 10px;
  z-index: 2;
  padding: 4px 6px;
  border-radius: 2px;
  background: rgb(255 252 245 / .14);
  color: rgb(255 252 245 / .7);
  font-size: 7px;
  font-weight: 800;
  letter-spacing: .08em;
  line-height: 1;
  text-transform: uppercase;
}

.discovery-collection-heading {
  margin-top: clamp(72px, 7vw, 112px);
}

.discovery-collection-carousel {
  width: min(100%, var(--discovery-content-max));
  min-width: 0;
  margin: 0 auto clamp(56px, 6vw, 96px);
  position: relative;
  overflow: hidden;
}

.discovery-collection-track {
  display: grid;
  grid-auto-flow: column;
  grid-auto-columns: 347px;
  gap: 20px;
  overflow-x: auto;
  overflow-y: hidden;
  padding: 2px 0 10px;
  scroll-behavior: smooth;
  scroll-snap-type: x mandatory;
  scrollbar-width: none;
}

.discovery-collection-track::-webkit-scrollbar {
  display: none;
}

.discovery-featured-collection-card {
  position: relative;
  aspect-ratio: 2 / 3;
  display: block;
  overflow: hidden;
  padding: 0;
  border: 0;
  border-radius: var(--discovery-radius-lg);
  background: #111;
  color: #fff;
  scroll-snap-align: start;
  text-align: center;
  transition: transform .28s var(--discovery-ease);
  will-change: transform;
}

.discovery-featured-collection-card:hover {
  transform: translateY(-5px);
}

.discovery-featured-collection-card::after {
  content: "";
  position: absolute;
  inset: 0;
  background:
    linear-gradient(0deg, rgb(0 0 0 / .74), rgb(0 0 0 / .28) 38%, transparent 66%),
    linear-gradient(90deg, rgb(0 0 0 / .18), transparent 48%);
  pointer-events: none;
}

.discovery-featured-collection-card > img,
.discovery-featured-collection-placeholder {
  width: 100%;
  height: 100%;
  display: grid;
  place-items: center;
  object-fit: cover;
  object-position: center top;
}

.discovery-featured-collection-content {
  position: absolute;
  z-index: 2;
  left: 24px;
  right: 24px;
  bottom: 24px;
  display: grid;
  justify-items: center;
  gap: 10px;
  color: #fff;
}

.discovery-featured-collection-key {
  color: rgb(255 255 255 / .72);
  font-size: 11px;
  font-weight: 800;
  letter-spacing: .08em;
  text-transform: uppercase;
}

.discovery-featured-collection-brand {
  max-width: 420px;
  color: rgb(255 255 255 / .86);
  font-size: clamp(18px, 1.6vw, 26px);
  font-weight: 520;
  letter-spacing: -.02em;
  line-height: 1.08;
}

.discovery-featured-collection-action {
  min-height: 48px;
  padding: 0 24px;
  display: inline-flex;
  align-items: center;
  justify-content: center;
  border-radius: var(--discovery-radius-pill);
  background: var(--discovery-accent);
  color: #fff;
  font-size: 14px;
  font-weight: 700;
}

.discovery-collection-carousel-button {
  position: absolute;
  z-index: 5;
  top: 50%;
  width: 38px;
  height: 38px;
  display: grid;
  place-items: center;
  padding: 0;
  border: 1px solid rgb(255 255 255 / .58);
  border-radius: 50%;
  background: rgb(255 255 255 / .78);
  color: rgb(16 17 20 / .72);
  box-shadow: 0 8px 24px rgb(16 17 20 / .12);
  backdrop-filter: blur(12px);
  transform: translateY(-50%);
  transition: background .2s var(--discovery-ease), color .2s var(--discovery-ease), transform .2s var(--discovery-ease);
}

.discovery-collection-carousel-button:hover {
  background: #fff;
  color: var(--discovery-ink);
  transform: translateY(calc(-50% - 1px));
}

.discovery-collection-carousel-button.previous {
  left: 14px;
}

.discovery-collection-carousel-button.next {
  right: 14px;
}

.discovery-newsletter {
  width: min(calc(100% - (var(--discovery-gutter) * 2)), var(--discovery-content-max));
  margin: 0 auto var(--discovery-section-space);
  padding: var(--discovery-section-space) clamp(28px, 5vw, 72px);
  overflow: hidden;
  border-radius: var(--discovery-radius-lg);
  background: #17191d;
  color: #fff;
}

.discovery-newsletter-inner {
  width: min(100%, var(--discovery-content-max));
  margin: 0 auto;
  display: grid;
  grid-template-columns: .9fr minmax(420px, .72fr);
  align-items: center;
  gap: clamp(56px, 9vw, 140px);
}

.discovery-newsletter h2 {
  max-width: 520px;
  margin: 0;
  color: #fff;
  font-size: clamp(40px, 4vw, 64px);
  font-weight: 550;
  letter-spacing: -.045em;
  line-height: 1;
}

.discovery-newsletter p {
  max-width: 560px;
  margin: 18px 0 0;
  color: rgb(255 255 255 / .62);
  font-size: clamp(16px, 1.4vw, 19px);
  line-height: 1.45;
}

.discovery-newsletter-form {
  padding: clamp(24px, 3vw, 34px);
  display: grid;
  gap: 16px;
  border: 1px solid rgb(255 255 255 / .12);
  border-radius: var(--discovery-radius-lg);
  background: rgb(255 255 255 / .06);
  box-shadow: inset 0 1px 0 rgb(255 255 255 / .08);
}

.discovery-newsletter-form label {
  display: grid;
  gap: 10px;
  color: #fff;
  font-size: 14px;
  font-weight: 700;
}

.discovery-newsletter-form input,
.discovery-newsletter-form select {
  width: 100%;
  min-width: 0;
  height: 54px;
  padding: 0 18px;
  border: 1px solid #666b74;
  border-radius: var(--discovery-radius-sm);
  background: #23262b;
  color: #fff;
  outline: none;
}

.discovery-newsletter-form select {
  appearance: none;
  background-image:
    linear-gradient(45deg, transparent 50%, rgb(255 255 255 / .72) 50%),
    linear-gradient(135deg, rgb(255 255 255 / .72) 50%, transparent 50%);
  background-position: calc(100% - 22px) 23px, calc(100% - 16px) 23px;
  background-repeat: no-repeat;
  background-size: 6px 6px, 6px 6px;
}

.discovery-newsletter-form input:focus,
.discovery-newsletter-form select:focus {
  border-color: #fff;
  box-shadow: 0 0 0 3px rgb(255 255 255 / .15);
}

.discovery-newsletter-form .discovery-blue-button {
  width: 100%;
}

.discovery-newsletter-form .discovery-form-note,
.discovery-newsletter-form .discovery-form-status {
  max-width: none;
  margin: -4px 0 0;
  color: rgb(255 255 255 / .55);
  font-size: 12px;
}

.discovery-newsletter-form .discovery-form-status {
  margin: 0;
  min-height: 20px;
  color: rgb(255 255 255 / .78);
}

.discovery-newsletter-form .discovery-form-status.error {
  color: #ffb4a8;
}

.discovery-footer-strip {
  width: min(100%, var(--discovery-content-max));
  margin: 0 auto;
  padding: 0 var(--discovery-gutter) 28px;
  display: flex;
  justify-content: space-between;
  gap: 24px;
  color: var(--discovery-muted);
  font-size: 12px;
}

.discovery-footer-strip nav {
  display: flex;
  flex-wrap: wrap;
  gap: 18px;
}

.discovery-footer-strip a,
.discovery-footer-strip button {
  padding: 0;
  border: 0;
  background: transparent;
  color: inherit;
  font-size: inherit;
  text-decoration: none;
}

.discovery-footer-strip a:hover,
.discovery-footer-strip button:hover {
  color: var(--discovery-ink);
  text-decoration: underline;
  text-underline-offset: 3px;
}

@media (max-width: 1120px) {
  .discovery-intelligence-panel {
    grid-template-columns: 1fr;
  }

  .discovery-integration-board {
    justify-self: stretch;
    width: 100%;
  }
}

@media (max-width: 820px) {
  .discovery-home {
    --discovery-header-height: 64px;
  }

  .discovery-nav {
    width: calc(100% - 20px);
    grid-template-columns: 1fr auto;
    gap: 12px;
  }

  .discovery-nav-links {
    display: none;
  }

  .discovery-wishlist-button span,
  .discovery-icon-button {
    display: none;
  }

  .discovery-logo {
    font-size: 17px;
  }

  .discovery-hero {
    width: calc(100% - 20px);
    min-height: 640px;
    margin-top: 16px;
  }

  .discovery-hero-frame {
    border-radius: 24px;
  }

  .discovery-hero-media video {
    object-position: 58% top;
  }

  .discovery-hero-copy {
    position: absolute;
    right: 16px;
    bottom: 72px;
    left: 16px;
    width: calc(100% - 32px);
    margin: 0;
    justify-items: start;
    text-align: left;
  }

  .discovery-hero-copy h1,
  .discovery-description {
    margin-left: 0;
  }

  .discovery-hero-actions {
    justify-content: flex-start;
  }

  .discovery-product-section {
    padding-inline: 20px;
  }

  .discovery-product-grid {
    grid-template-columns: 1fr;
    gap: 14px;
  }

  .discovery-product-media {
    aspect-ratio: 1.2;
  }

  .discovery-campaign-stack {
    padding-inline: 20px;
  }

  .discovery-intelligence-panel {
    min-height: auto;
    padding: 34px;
  }

  .discovery-integration-board {
    grid-template-columns: repeat(2, minmax(0, 1fr));
  }

  .discovery-collection-track {
    grid-auto-columns: minmax(280px, 78vw);
  }

  .discovery-collection-carousel-button {
    width: 34px;
    height: 34px;
  }

  .discovery-collection-carousel-button.previous {
    left: 8px;
  }

  .discovery-collection-carousel-button.next {
    right: 8px;
  }

  .discovery-newsletter {
    width: calc(100% - 40px);
  }

  .discovery-newsletter-inner {
    grid-template-columns: 1fr;
    gap: 40px;
  }

  .discovery-footer-strip {
    flex-direction: column;
  }
}

@media (max-width: 520px) {
  .discovery-hero-copy h1 {
    font-size: clamp(42px, 12vw, 66px);
  }

  .discovery-product-body {
    min-height: 112px;
    padding: 22px;
  }

  .discovery-product-main strong {
    font-size: 22px;
  }
}

/* Literal storefront v4.3 port. Keep these rules last so the React page matches the prototype. */
.discovery-home {
  --page-max: 1600px;
  --content-max: 1440px;
  --gutter: clamp(20px, 4.45vw, 72px);
  --section-space: clamp(72px, 8vw, 128px);
  --header-height: 54px;
  --region-height: 0px;
  --hero-height: clamp(660px, calc(100svh - var(--header-height) - var(--region-height)), 880px);
  --text-xs: 12px;
  --text-sm: 14px;
  --text-base: 16px;
  --text-xl: clamp(28px, 2.5vw, 40px);
  --display: clamp(44px, 5.5vw, 74px);
  --paper: #ffffff;
  --ink: #101114;
  --muted: #62666d;
  --line: #d8dadd;
  --line-strong: #b6bac1;
  --surface: #f3f4f6;
  --surface-dark: #17191d;
  --accent: var(--kaayd-blue);
  --accent-hover: var(--kaayd-blue-hover);
  --focus: #0b57d0;
  --radius-sm: 10px;
  --radius-md: 18px;
  --radius-lg: 30px;
  --radius-pill: 999px;
  --ease: cubic-bezier(.2, .8, .2, 1);
  min-width: 320px;
  background: var(--paper);
  color: var(--ink);
  font-family: Inter, ui-sans-serif, -apple-system, BlinkMacSystemFont, "Segoe UI", Helvetica, Arial, sans-serif;
  font-size: var(--text-base);
  line-height: 1.45;
}

.discovery-home button,
.discovery-home input,
.discovery-home select {
  font: inherit;
}

.discovery-home .site-shell {
  width: min(100%, var(--page-max));
  margin-inline: auto;
  background: var(--paper);
  overflow: clip;
}

.discovery-home .site-header {
  position: sticky;
  z-index: 100;
  top: 0;
  height: var(--header-height);
  padding: 0;
  border-bottom: 1px solid rgb(16 17 20 / .08);
  background: rgb(255 255 255 / .78);
  backdrop-filter: blur(22px) saturate(1.35);
}

.discovery-home .site-header__inner {
  width: min(calc(100% - 40px), calc(var(--page-max) - 40px));
  height: 100%;
  margin-inline: auto;
  padding-inline: 0;
  display: grid;
  grid-template-columns: minmax(92px, 1fr) auto minmax(92px, 1fr);
  align-items: center;
  gap: 18px;
}

.discovery-home .brand {
  display: inline-flex;
  justify-self: start;
  align-items: center;
  gap: 8px;
  padding: 0;
  border: 0;
  background: transparent;
  color: var(--ink);
  font-weight: 700;
}

.discovery-home .brand__name {
  font-size: 15px;
  letter-spacing: .18em;
}

.discovery-home .primary-nav {
  display: flex;
  align-items: center;
  justify-content: center;
  height: 100%;
  gap: 2px;
}

.discovery-home .nav-link {
  display: inline-flex;
  align-items: center;
  min-height: 30px;
  padding: 0 11px;
  border: 0;
  border-radius: 6px;
  background: transparent;
  color: rgb(16 17 20 / .56);
  font-size: 12px;
  white-space: nowrap;
}

.discovery-home .nav-link:hover,
.discovery-home .nav-link.is-active {
  color: var(--ink);
}

.discovery-home .nav-link.is-active {
  background: rgb(255 255 255 / .72);
  box-shadow: inset 0 0 0 1px rgb(16 17 20 / .08);
}

.discovery-home .header-actions {
  display: flex;
  min-width: 0;
  align-items: center;
  justify-content: flex-end;
  gap: 14px;
  color: rgb(16 17 20 / .56);
  font-size: 10px;
  font-weight: 700;
  letter-spacing: .11em;
  text-transform: uppercase;
}

.discovery-home .header-actions .auth-menu {
  gap: 0;
}

.discovery-home .header-actions .auth-nav-secondary {
  display: none;
}

.discovery-home .header-actions .auth-nav-login,
.discovery-home .login-button {
  min-height: 34px;
  display: inline-flex;
  align-items: center;
  justify-content: center;
  padding: 0 15px;
  border: 1px solid rgb(16 17 20 / .14);
  border-radius: var(--radius-pill);
  background: rgb(255 255 255 / .72);
  color: var(--ink);
  box-shadow: inset 0 0 0 1px rgb(255 255 255 / .46);
  font-size: 12px;
  font-weight: 700;
  letter-spacing: 0;
  text-transform: none;
  transition: background .2s var(--ease), border-color .2s var(--ease), transform .2s var(--ease);
}

.discovery-home .header-actions .auth-nav-login:hover,
.discovery-home .login-button:hover {
  border-color: rgb(16 17 20 / .24);
  background: #fff;
  color: var(--ink);
  transform: translateY(-1px);
}

.discovery-home .hero {
  position: relative;
  width: min(calc(100% - 40px), calc(var(--page-max) - 40px));
  min-height: clamp(620px, calc(var(--hero-height) - 56px), 800px);
  margin: 24px auto 0;
  display: grid;
  place-items: center;
  overflow: hidden;
  border-radius: var(--radius-lg);
  background: #d9dadd;
}

.discovery-home .hero__media,
.discovery-home .hero__scrim {
  position: absolute;
  inset: 0;
}

.discovery-home .hero__video {
  width: 100%;
  height: 100%;
  object-fit: cover;
  object-position: center;
}

.discovery-home .hero__scrim {
  z-index: 1;
  background: linear-gradient(180deg, rgb(0 0 0 / .08), rgb(0 0 0 / .36));
}

.discovery-home .hero__content {
  position: relative;
  z-index: 2;
  width: min(980px, calc(100% - 40px));
  margin-top: 16%;
  color: white;
  text-align: center;
}

.discovery-home .hero__content h1 {
  max-width: 900px;
  margin: 0 auto 10px;
  color: white;
  font-size: var(--display);
  font-weight: 560;
  letter-spacing: -.045em;
  line-height: .98;
  text-wrap: balance;
}

.discovery-home .eyebrow {
  margin: 0 0 10px;
  color: var(--muted);
  font-size: var(--text-xs);
  font-weight: 750;
  letter-spacing: .11em;
  text-transform: uppercase;
}

.discovery-home .hero__eyebrow {
  color: rgb(255 255 255 / .78);
}

.discovery-home .hero__copy {
  max-width: 660px;
  margin: 0 auto 26px;
  color: rgb(255 255 255 / .9);
  font-size: clamp(16px, 1.25vw, 20px);
}

.discovery-home .button-row {
  display: flex;
  flex-wrap: wrap;
  gap: 12px;
  justify-content: inherit;
}

.discovery-home .hero .button-row {
  justify-content: center;
}

.discovery-home .button {
  min-height: 48px;
  padding: 0 24px;
  display: inline-flex;
  align-items: center;
  justify-content: center;
  border: 1px solid transparent;
  border-radius: var(--discovery-radius-pill);
  font-size: var(--text-sm);
  font-weight: 700;
  transition: background .18s ease, color .18s ease, border-color .18s ease, transform .18s ease;
}

.discovery-home .button:hover {
  transform: translateY(-1px);
}

.discovery-home .button--primary {
  background: var(--accent);
  color: white;
}

.discovery-home .button--primary:hover {
  background: var(--accent-hover);
}

.discovery-home .button--secondary {
  border-color: var(--line-strong);
  background: var(--paper);
  color: var(--ink);
}

.discovery-home .hero .button--secondary {
  border-color: transparent;
}

.discovery-home .button--secondary:hover {
  background: var(--surface);
}

.discovery-home .section {
  padding: var(--section-space) var(--gutter);
}

.discovery-home .section-heading {
  width: min(100%, var(--content-max));
  margin: 0 auto clamp(36px, 5vw, 64px);
}

.discovery-home .section-heading--center {
  text-align: center;
}

.discovery-home .section-heading h2 {
  max-width: 760px;
  margin: 0 auto;
  font-size: var(--text-xl);
  font-weight: 560;
  letter-spacing: -.035em;
  line-height: 1.08;
  text-wrap: balance;
}

.discovery-home .product-categories {
  background: var(--paper);
}

.discovery-home .category-grid {
  width: min(100%, var(--content-max));
  margin-inline: auto;
  display: grid;
  grid-template-columns: repeat(3, minmax(0, 1fr));
  gap: 20px;
}

.discovery-home .category-card {
  min-width: 0;
  overflow: hidden;
  border: 0;
  border-radius: var(--radius-lg);
  background: var(--surface);
  color: inherit;
  text-align: left;
  transition: transform .28s var(--ease);
}

.discovery-home .category-card:hover {
  transform: translateY(-5px);
}

.discovery-home .category-card__media {
  aspect-ratio: 1 / .92;
}

.discovery-home .media-art {
  position: relative;
  overflow: hidden;
  background: #f6f6f7;
}

.discovery-home .category-card__media--product {
  display: grid;
  place-items: center;
}

.discovery-home .category-card__media--product img {
  width: auto;
  height: auto;
  max-width: 78%;
  max-height: 78%;
  object-fit: contain;
  object-position: center;
  mix-blend-mode: multiply;
  transform: translateY(-3%);
}

.discovery-home .category-card__body {
  min-height: 150px;
  padding: 24px 28px 30px;
  display: grid;
  gap: 16px;
  align-content: start;
}

.discovery-home .category-card__body-main {
  display: grid;
  gap: 8px;
}

.discovery-home .category-card__body h3 {
  margin: 0;
  font-size: clamp(22px, 2vw, 32px);
  font-weight: 560;
  letter-spacing: -.025em;
}

.discovery-home .category-card__meta {
  margin: 0;
  color: var(--muted);
  font-size: var(--text-sm);
  font-weight: 600;
  line-height: 1.35;
}

.discovery-home .category-card__footer {
  display: flex;
  align-items: center;
  justify-content: space-between;
  gap: 16px;
}

.discovery-home .category-card__price {
  font-size: var(--text-sm);
  font-weight: 800;
}

.discovery-home .arrow-link {
  display: inline-flex;
  gap: 8px;
  align-items: center;
  font-size: var(--text-sm);
  font-weight: 700;
  white-space: nowrap;
}

.discovery-home .campaign-stack {
  padding: 0 var(--gutter) var(--section-space);
  display: grid;
  grid-template-columns: minmax(0, 1fr);
  gap: 20px;
}

.discovery-home .campaign {
  width: min(100%, var(--content-max));
  margin-inline: auto;
  overflow: hidden;
  border-radius: var(--radius-lg);
  background: var(--surface);
}

.discovery-home .campaign--intelligence {
  min-height: clamp(520px, 44vw, 640px);
  padding: clamp(40px, 5vw, 72px) clamp(24px, 3vw, 28px);
  display: grid;
  grid-template-columns: minmax(0, .82fr) minmax(700px, 1.18fr);
  gap: clamp(32px, 4vw, 48px);
  align-items: center;
  background:
    radial-gradient(circle at 82% 18%, rgb(31 98 232 / .14), transparent 34%),
    linear-gradient(135deg, #f8f9fb, #eef1f5);
}

.discovery-home .campaign--intelligence .campaign__content {
  max-width: none;
  padding: 0;
}

.discovery-home .campaign--intelligence .eyebrow {
  margin-left: 3px;
}

.discovery-home .campaign__content h2 {
  margin: 0 0 18px;
  font-size: clamp(38px, 4.2vw, 66px);
  font-weight: 550;
  letter-spacing: -.045em;
  line-height: 1;
}

.discovery-home .campaign__content p:not(.eyebrow) {
  max-width: 520px;
  margin: 0 0 28px;
  color: var(--muted);
  font-size: clamp(16px, 1.5vw, 20px);
}

.discovery-home .campaign--intelligence .button-row {
  justify-content: flex-start;
}

.discovery-home .integration-board {
  position: relative;
  align-self: center;
  justify-self: end;
  width: min(100%, 714px);
  display: grid;
  grid-template-columns: repeat(4, minmax(0, 1fr));
  align-content: center;
  gap: 10px;
}

.discovery-home .integration-logo-card {
  position: relative;
  display: grid;
  aspect-ratio: 1;
  place-items: center;
  overflow: hidden;
  border-radius: 6px;
  background: #1a3252;
  transition: transform .16s ease;
}

.discovery-home .integration-logo-card:hover {
  transform: translateY(-5px);
}

.discovery-home .acq-cover-img {
  width: 100%;
  height: 100%;
  object-fit: cover;
  display: block;
}

.discovery-home .acq-cover-badge {
  position: absolute;
  top: 10px;
  right: 10px;
  z-index: 2;
  padding: 4px 6px;
  border-radius: 2px;
  background: rgb(255 252 245 / .14);
  color: rgb(255 252 245 / .7);
  font-size: 7px;
  font-weight: 800;
  letter-spacing: .08em;
  line-height: 1;
  text-transform: uppercase;
}

.discovery-home .acq-cover-badge--dark {
  background: rgb(16 17 20 / .16);
  color: rgb(16 17 20 / .9);
}

.discovery-home .collection-carousel-heading {
  margin-top: clamp(72px, 7vw, 112px);
}

.discovery-home .collection-carousel {
  width: min(100%, var(--content-max));
  min-width: 0;
  margin: 0 auto clamp(56px, 6vw, 96px);
  position: relative;
  overflow: hidden;
}

.discovery-home .collection-carousel__track {
  display: grid;
  grid-auto-flow: column;
  grid-auto-columns: 347px;
  gap: 20px;
  overflow-x: auto;
  overflow-y: hidden;
  padding: 2px 0 10px;
  scroll-behavior: smooth;
  scroll-snap-type: x mandatory;
  scrollbar-width: none;
}

.discovery-home .collection-carousel__track::-webkit-scrollbar {
  display: none;
}

.discovery-home .collection-card {
  position: relative;
  aspect-ratio: 2 / 3;
  overflow: hidden;
  padding: 0;
  border: 0;
  border-radius: var(--radius-lg);
  background: #111;
  color: #fff;
  scroll-snap-align: start;
  transition: transform .28s var(--ease);
}

.discovery-home a.collection-card {
  border-radius: var(--button-radius);
  text-align: center;
  text-decoration: none;
}

.discovery-home .collection-card:hover {
  transform: translateY(-5px);
}

.discovery-home .collection-card::after {
  content: "";
  position: absolute;
  inset: 0;
  background:
    linear-gradient(0deg, rgb(0 0 0 / .74), rgb(0 0 0 / .28) 38%, transparent 66%),
    linear-gradient(90deg, rgb(0 0 0 / .18), transparent 48%);
  pointer-events: none;
}

.discovery-home .collection-card__image {
  width: 100%;
  height: 100%;
  display: block;
  object-fit: cover;
  object-position: center top;
}

.discovery-home .collection-card__content {
  position: absolute;
  z-index: 2;
  left: 24px;
  right: 24px;
  bottom: 24px;
  display: grid;
  justify-items: center;
  gap: 10px;
  color: #fff;
  text-align: center;
}

.discovery-home .collection-card__key {
  margin: 0;
  color: rgb(255 255 255 / .72);
  font-size: 11px;
  font-weight: 800;
  letter-spacing: .08em;
  text-transform: uppercase;
}

.discovery-home .collection-card__content h3 {
  max-width: 420px;
  margin: 0;
  color: rgb(255 255 255 / .86);
  font-size: clamp(17px, 1.45vw, 23px);
  font-weight: 520;
  letter-spacing: -.02em;
  line-height: 1.08;
}

.discovery-home .collection-card__action {
  min-height: 32px;
  width: fit-content;
  padding: 0 14px;
  border-radius: var(--discovery-radius-pill);
  font-size: 10px;
  font-weight: 650;
}

.discovery-home .collection-carousel__button {
  position: absolute;
  z-index: 5;
  top: 50%;
  width: 38px;
  height: 38px;
  display: grid;
  place-items: center;
  padding: 0;
  border: 1px solid rgb(255 255 255 / .58);
  border-radius: 50%;
  background: rgb(255 255 255 / .78);
  color: rgb(16 17 20 / .72);
  box-shadow: 0 8px 24px rgb(16 17 20 / .12);
  backdrop-filter: blur(12px);
  transform: translateY(-50%);
}

.discovery-home .collection-carousel__button--prev {
  left: 14px;
}

.discovery-home .collection-carousel__button--next {
  right: 14px;
}

.discovery-home .newsletter {
  width: min(calc(100% - (var(--gutter) * 2)), var(--content-max));
  margin: 0 auto var(--section-space);
  padding: var(--section-space) clamp(28px, 5vw, 72px);
  overflow: hidden;
  border-radius: var(--radius-lg);
  background: var(--surface-dark);
  color: white;
}

.discovery-home .newsletter__inner {
  width: min(100%, var(--content-max));
  margin-inline: auto;
  display: grid;
  grid-template-columns: .9fr minmax(420px, .72fr);
  gap: clamp(56px, 9vw, 140px);
  align-items: center;
}

.discovery-home .newsletter h2 {
  max-width: 520px;
  margin: 0;
  font-size: clamp(40px, 4vw, 64px);
  font-weight: 550;
  letter-spacing: -.045em;
  line-height: 1;
}

.discovery-home .newsletter__copy {
  max-width: 560px;
  margin: 18px 0 0;
  color: rgb(255 255 255 / .62);
  font-size: clamp(16px, 1.4vw, 19px);
}

.discovery-home .newsletter__form {
  padding: clamp(24px, 3vw, 34px);
  border: 1px solid rgb(255 255 255 / .12);
  border-radius: var(--radius-lg);
  background: rgb(255 255 255 / .06);
  box-shadow: inset 0 1px 0 rgb(255 255 255 / .08);
}

.discovery-home .newsletter__field-row {
  display: grid;
  grid-template-columns: 1fr;
  gap: 16px;
}

.discovery-home .newsletter__field {
  display: grid;
  gap: 10px;
  color: #fff;
  font-size: var(--text-sm);
  font-weight: 700;
}

.discovery-home .newsletter input,
.discovery-home .newsletter select {
  width: 100%;
  min-width: 0;
  height: 54px;
  padding: 0 18px;
  border: 1px solid #666b74;
  border-radius: var(--radius-sm);
  background: #23262b;
  color: white;
  outline: none;
}

.discovery-home .newsletter select {
  appearance: none;
  background-image: linear-gradient(45deg, transparent 50%, rgb(255 255 255 / .72) 50%), linear-gradient(135deg, rgb(255 255 255 / .72) 50%, transparent 50%);
  background-position: calc(100% - 22px) 23px, calc(100% - 16px) 23px;
  background-repeat: no-repeat;
  background-size: 6px 6px, 6px 6px;
}

.discovery-home .newsletter__form .button {
  width: 100%;
  margin-top: 4px;
}

.discovery-home .form-note {
  margin: 12px 0 0;
  color: rgb(255 255 255 / .55);
  font-size: var(--text-xs);
}

.discovery-home .form-status {
  min-height: 20px;
  margin: 8px 0 0;
  color: rgb(255 255 255 / .78);
  font-size: var(--text-sm);
}

.discovery-home .form-status.error {
  color: #ffb4a8;
}

.discovery-home .site-footer {
  display: block;
  grid-template-columns: none;
  width: auto;
  min-height: 0;
  margin: 0;
  padding: 0 var(--gutter) 28px;
  background: var(--paper);
  border-top: 0;
  color: inherit;
  font-family: inherit;
  font-size: inherit;
  font-weight: inherit;
  letter-spacing: 0;
  line-height: inherit;
  text-transform: none;
}

.discovery-home .site-footer__bottom {
  width: min(100%, var(--content-max));
  margin-inline: auto;
  padding-top: 24px;
  display: flex;
  justify-content: space-between;
  gap: 24px;
  border-top: 1px solid var(--line);
  color: var(--muted);
  font-size: var(--text-xs);
  font-weight: 400;
  letter-spacing: 0;
  line-height: 1.45;
  text-transform: none;
}

.discovery-home .site-footer__bottom > div {
  display: flex;
  flex-wrap: wrap;
  gap: 18px;
}

.discovery-home .site-footer__bottom a {
  padding: 0;
  border: 0;
  background: transparent;
  color: inherit;
  font: inherit;
  letter-spacing: 0;
  line-height: inherit;
  text-transform: none;
  text-decoration: none;
}

@media (max-width: 1120px) {
  .discovery-home .primary-nav {
    display: none;
  }

  .discovery-home .site-header__inner {
    grid-template-columns: 1fr auto;
  }

  .discovery-home .campaign--intelligence {
    grid-template-columns: 1fr;
  }

  .discovery-home .category-grid {
    grid-template-columns: repeat(2, 1fr);
  }

  .discovery-home .category-card:last-child {
    grid-column: span 2;
  }
}

@media (max-width: 820px) {
  .discovery-home {
    --header-height: 64px;
    --hero-height: 760px;
  }

  .discovery-home .site-header__inner {
    width: calc(100% - 20px);
  }

  .discovery-home .brand__name {
    font-size: 17px;
  }

  .discovery-home .hero {
    width: calc(100% - 20px);
    min-height: 640px;
    margin-top: 16px;
    align-items: end;
    border-radius: 24px;
  }

  .discovery-home .hero__content {
    width: calc(100% - 32px);
    margin: 0 0 72px;
    text-align: left;
  }

  .discovery-home .hero__content h1,
  .discovery-home .hero__copy {
    margin-left: 0;
  }

  .discovery-home .hero__content h1 {
    font-size: clamp(38px, 12vw, 42px);
  }

  .discovery-home .hero .button-row {
    justify-content: flex-start;
  }

  .discovery-home .section {
    padding-inline: 20px;
  }

  .discovery-home .category-grid {
    grid-template-columns: 1fr;
    gap: 14px;
  }

  .discovery-home .category-card:last-child {
    grid-column: auto;
  }

  .discovery-home .category-card__media,
  .discovery-home .category-card:last-child .category-card__media {
    aspect-ratio: 1.2;
  }

  .discovery-home .campaign-stack {
    padding-inline: 20px;
  }

  .discovery-home .campaign--intelligence {
    min-height: auto;
    padding: 34px;
  }

  .discovery-home .integration-board {
    grid-template-columns: repeat(2, minmax(0, 1fr));
    gap: 10px;
  }

  .discovery-home .collection-carousel__track {
    grid-auto-columns: minmax(280px, 78vw);
  }

  .discovery-home .collection-carousel__button {
    width: 34px;
    height: 34px;
  }

  .discovery-home .collection-carousel__button--prev {
    left: 8px;
  }

  .discovery-home .collection-carousel__button--next {
    right: 8px;
  }

  .discovery-home .newsletter {
    width: min(calc(100% - 40px), var(--content-max));
  }

  .discovery-home .newsletter__inner {
    grid-template-columns: 1fr;
  }

  .discovery-home .site-footer__bottom {
    flex-direction: column;
  }
}

@media (max-width: 520px) {
  .discovery-home .button {
    padding-inline: 20px;
  }

  .discovery-home .category-card__body {
    min-height: 112px;
    padding: 22px;
  }

  .discovery-home .campaign__content h2 {
    font-size: 40px;
  }
}

.discovery-primary-button,
.discovery-secondary-button,
.discovery-blue-button,
.discovery-neutral-button,
.discovery-home .button,
.discovery-home .collection-card__action,
.auth-nav-button,
.auth-dropdown-submit,
.change-password-modal .auth-dropdown-submit,
.waitlist-submit-button,
.waitlist-success button,
.delete-confirm-cancel,
.delete-confirm-primary,
.bulk-looks-primary,
.bulk-looks-secondary,
.bulk-looks-mode-control button,
.primary-button,
.buy-button,
.retry-button,
.inline-error button,
.back-button,
.listing-pill-button,
.runway-reference-toggle,
.listing-admin-look-button,
.admin-primary-action,
.add-look-submit,
.icon-text-button,
.metadata-clear-button,
.manual-review-resolve-button,
.manual-review-move-button,
.manual-review-trash-button {
  border-radius: 999px;
}

/* Compact account menu, aligned with the navigation's scale. */
.account-menu .account-dropdown {
  top: calc(100% + 10px);
  width: min(248px, calc(100vw - 32px));
  padding: 6px;
  border: 1px solid #e5e7eb;
  border-radius: 10px;
  background: #fff;
  color: #1c1e21;
  box-shadow: 0 4px 20px rgb(0 0 0 / 9%), 0 1px 3px rgb(0 0 0 / 4%);
  backdrop-filter: none;
  max-height: calc(100dvh - 88px);
  overflow-y: auto;
}
.account-menu .account-dropdown-profile {
  display: block;
  margin: 0 8px 4px;
  padding: 10px 4px 12px;
  border: 0;
  border-bottom: 1px solid #eceef0;
  border-radius: 0;
  box-shadow: none;
}
.account-menu .account-dropdown-profile strong {
  font-size: 14px;
  line-height: 1.4;
  font-weight: 600;
}
.account-menu .account-dropdown-profile span {
  margin-top: 2px;
  font-size: 12px;
  line-height: 1.4;
  font-weight: 400;
  color: #65676b;
}
.account-menu .account-dropdown-section { gap: 0; padding: 0; border: 0; }
.account-menu .account-dropdown-section + .account-dropdown-section {
  margin: 4px 0 0;
  padding-top: 4px;
  border-top: 1px solid #eceef0;
}
.account-menu .account-dropdown button {
  min-height: 44px;
  gap: 10px;
  padding: 10px 12px;
  border-radius: 6px;
  font-size: 13px;
  line-height: 1.4;
  font-weight: 500;
}
.account-menu .account-dropdown button svg {
  width: 16px;
  height: 16px;
  color: #65676b;
  stroke-width: 1.75;
}
.account-menu .account-dropdown button:hover { background: #f2f3f5; }
.account-menu .account-dropdown button:focus-visible {
  outline: 2px solid var(--kaayd-blue);
  outline-offset: -2px;
  background: #f2f3f5;
}
.account-menu .account-dropdown button.active { background: #f2f3f5; }

/* Shared modern login and password forms on the white auth canvas. */
.auth-screen-card.modern-auth-form {
  width: min(400px, 100%);
  padding: 0;
  gap: 20px;
  border: 0;
  border-radius: 0;
  box-shadow: none;
  max-height: calc(100dvh - 48px);
  overflow-y: auto;
}
.modern-auth-form.auth-screen-card .change-password-heading { padding: 0; align-items: center; }
.modern-auth-form.auth-screen-card .change-password-heading h2 {
  font-size: 28px;
  font-weight: 600;
  line-height: 1.2;
  letter-spacing: -0.8px;
}
.modern-auth-form.auth-screen-card .change-password-heading button {
  flex: 0 0 36px;
  width: 36px;
  height: 36px;
  background: #f2f3f5;
}
.auth-form-intro {
  margin: -8px 0 8px;
  color: #65676b;
  font-size: 14px;
  line-height: 1.5;
}
.auth-form-field { display: grid; gap: 8px; }
.auth-form-field > label { color: #1c1e21; font-size: 13px; font-weight: 500; }
.modern-auth-form.auth-screen-card .auth-dropdown-field {
  min-height: 52px;
  border: 1px solid #e5e7eb;
  border-radius: 10px;
  background: #f8f9fa;
  padding: 0 14px;
}
.modern-auth-form.auth-screen-card .auth-dropdown-field:focus-within {
  background: #fff;
  border-color: var(--kaayd-blue);
}
.modern-auth-form.auth-screen-card .auth-dropdown-field input { font-size: 16px; }
.modern-auth-form.auth-screen-card .password-visibility-toggle {
  width: 36px;
  height: 44px;
  flex: 0 0 36px;
}
.modern-auth-form.auth-screen-card .auth-dropdown-submit { min-height: 48px; margin-top: 8px; font-weight: 600; }

/* Login is a complete branded page, not a floating modal card. */
.login-page {
  position: relative;
  min-height: 100dvh;
  display: flex;
  flex-direction: column;
  overflow-y: auto;
  background: #fff;
  color: #1c1e21;
  font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
}
.login-page:focus { outline: none; }
.login-page-header {
  display: flex;
  flex: 0 0 80px;
  align-items: center;
  justify-content: space-between;
  gap: 20px;
  padding: 0 40px;
  border-bottom: 1px solid #eceef0;
}
.login-page-wordmark { font-size: 17px; font-weight: 650; letter-spacing: 3px; }
.login-page-back {
  display: inline-flex;
  align-items: center;
  gap: 8px;
  min-height: 44px;
  padding: 0 8px;
  border: 0;
  background: transparent;
  color: #65676b;
  font: inherit;
  font-size: 13px;
  cursor: pointer;
}
.login-page-back:hover { color: #1c1e21; background: #f5f6f7; }
.login-page-back:focus-visible { outline: 2px solid var(--kaayd-blue); outline-offset: 2px; }
.login-page-layout {
  display: grid;
  grid-template-columns: 1fr 1fr;
  flex: 1 0 auto;
  min-height: calc(100dvh - 80px);
  padding: 24px;
  gap: 24px;
}
.login-page-editorial {
  position: relative;
  overflow: hidden;
  min-height: 560px;
  border-radius: 20px;
  background: #242424;
  isolation: isolate;
}
.login-page-editorial video { position: absolute; inset: 0; width: 100%; height: 100%; object-fit: cover; object-position: center top; }
.login-page-editorial::after { content: ""; position: absolute; inset: 0; background: linear-gradient(transparent 45%, rgb(0 0 0 / 75%)); }
.login-page-caption { position: absolute; z-index: 1; bottom: 40px; left: 40px; right: 40px; color: #fff; }
.login-page-caption p { max-width: 420px; margin: 0 0 16px; font-size: clamp(30px, 3.2vw, 48px); font-weight: 550; line-height: 1.08; letter-spacing: -1.5px; }
.login-page-caption span { font-size: 13px; line-height: 1.6; color: #e4e6eb; }
.login-page-content { display: grid; place-items: center; padding: 48px 32px; }
.login-page .modern-auth-form { max-height: none; overflow: visible; }
.login-page .modern-auth-form .change-password-heading h2 { font-size: 36px; letter-spacing: -1.2px; }
.login-page .auth-form-intro { margin-bottom: 12px; }
@media (max-width: 760px) {
  .login-page-header { flex-basis: 72px; padding: 0 24px; }
  .login-page-layout { display: block; min-height: calc(100dvh - 72px); padding: 0; }
  .login-page-editorial { display: none; }
  .login-page-content { padding: clamp(48px, 10vh, 96px) 24px 40px; }
  .login-page .modern-auth-form .change-password-heading h2 { font-size: 32px; }
}

/* My KAAYD: the same quiet surfaces and readable type as account UI. */
.wishlist-page { font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif; color: #1c1e21; }
.wishlist-page .wishlist-content { max-width: 1280px; padding: 64px 40px 88px; }
.wishlist-page .wishlist-heading { min-height: 0; padding-bottom: 40px; border: 0; align-items: center; }
.wishlist-page .wishlist-heading h1 {
  margin: 0; font: 600 clamp(30px, 3vw, 40px)/1.15 Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
  color: #1c1e21; letter-spacing: -1.2px; text-transform: none;
}
.wishlist-description { margin: 12px 0 0; color: #65676b; font-size: 15px; line-height: 1.6; }
.wishlist-browse, .wishlist-start {
  display: inline-flex; align-items: center; justify-content: center; gap: 8px;
  min-height: 44px; padding: 0 20px; border: 0; border-radius: 999px;
  font: 600 13px/1.4 Inter, "Helvetica Neue", Helvetica, Arial, sans-serif; cursor: pointer;
}
.wishlist-page .wishlist-browse { background: #f0f2f5; color: #1c1e21; }
.wishlist-page .wishlist-browse:hover { background: #e4e6eb; }
.wishlist-section-heading { display: flex; align-items: center; gap: 12px; padding: 22px 0; border-top: 1px solid #e4e6eb; }
.wishlist-section-heading h2 { margin: 0; font-size: 16px; font-weight: 600; letter-spacing: -.2px; }
.wishlist-page .wishlist-count { min-height: 24px; padding: 3px 9px; background: #f0f2f5; border-radius: 6px; color: #65676b; font: 500 12px/1.4 Inter, sans-serif; letter-spacing: 0; text-transform: none; }
.wishlist-page .wishlist-grid { margin-top: 0; grid-template-columns: repeat(4, minmax(0, 1fr)); gap: 36px 20px; }
.wishlist-page .listing-image-button { border-radius: 14px; background: #f5f6f7; margin-bottom: 14px; }
.wishlist-page .listing-copy { gap: 10px; }
.wishlist-page .title-button { grid-template-rows: auto auto; gap: 5px; }
.wishlist-page .designer-line { font-family: inherit; letter-spacing: 0; text-transform: none; }
.wishlist-page .designer-line p { font-size: 13px; font-weight: 600; line-height: 1.4; }
.wishlist-page .product-line { font-size: 13px; height: auto; max-height: none; line-height: 1.4; color: #65676b; }
.wishlist-page .card-size-line { font-family: inherit; font-weight: 400; letter-spacing: 0; color: #65676b; }
.wishlist-page .card-price-line { font-size: 13px; font-weight: 600; }
.wishlist-page .favorite-button { min-width: 36px; height: 36px; background: #fff; backdrop-filter: none; border-color: #e4e6eb; }
.wishlist-page .favorite-button.saved { color: #1c1e21; }
.wishlist-page .favorite-button:hover { background: #f0f2f5; }
.wishlist-page .wishlist-empty { display: flex; flex-direction: column; justify-content: center; align-items: center; gap: 16px; min-height: 370px; padding: 48px 24px; border-radius: 16px; background: #f8f9fa; text-align: center; color: #65676b; }
.wishlist-empty > svg { color: #65676b; stroke-width: 1.5; }
.wishlist-empty h2 { margin: 0; color: #1c1e21; font-size: 23px; font-weight: 600; letter-spacing: -.6px; }
.wishlist-empty p { margin: 0; font-size: 14px; line-height: 1.6; }
.wishlist-page .wishlist-start { margin-top: 8px; background: var(--kaayd-blue); color: #fff; }
.wishlist-page .wishlist-start:hover { background: var(--kaayd-blue-hover); }
.wishlist-page .wishlist-browse:focus-visible, .wishlist-page .wishlist-start:focus-visible { outline: 2px solid var(--kaayd-blue); outline-offset: 3px; }
.wishlist-nav-button .wishlist-nav-tooltip {
  z-index: 60; left: auto; right: -12px; top: calc(100% + 12px);
  display: grid; gap: 4px; min-width: 152px; padding: 12px 14px;
  border: 1px solid #e4e6eb; border-radius: 10px; background: #fff;
  box-shadow: 0 4px 16px rgb(0 0 0 / 10%); color: #1c1e21;
  text-align: left; text-transform: none; letter-spacing: 0;
  transform: translateY(-4px); font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif;
}
.wishlist-nav-tooltip strong { font-size: 13px; line-height: 1.4; font-weight: 600; }
.wishlist-nav-tooltip small { font-size: 12px; line-height: 1.4; color: #65676b; font-weight: 400; }
.wishlist-nav-button:hover .wishlist-nav-tooltip, .wishlist-nav-button:focus-visible .wishlist-nav-tooltip { transform: translateY(0); }
.wishlist-page .wishlist-nav-button.active { color: #1c1e21; }
@media (max-width: 900px) { .wishlist-page .wishlist-grid { grid-template-columns: repeat(3, minmax(0, 1fr)); } }
@media (max-width: 600px) {
  .wishlist-page .wishlist-content { padding: 32px 20px 56px; }
  .wishlist-page .wishlist-heading { align-items: flex-start; flex-direction: column; gap: 20px; padding-bottom: 28px; }
  .wishlist-page .wishlist-grid { grid-template-columns: repeat(2, minmax(0, 1fr)); gap: 28px 12px; }
  .wishlist-page .wishlist-empty { padding: 36px 20px; min-height: 340px; }
  .wishlist-empty h2 { font-size: 21px; }
  .wishlist-page .favorite-button { top: 8px; right: 8px; }
}
@media (hover: none) { .wishlist-nav-button .wishlist-nav-tooltip { display: none; } }
@media (prefers-reduced-motion: reduce) { .wishlist-nav-button .wishlist-nav-tooltip { transition: none; } }
/* Explicit action shapes override the legacy generic button-radius rule. */
#root .wishlist-page .wishlist-browse,
#root .wishlist-page .wishlist-start { border-radius: 999px; }
#root .wishlist-nav-button:hover,
#root .wishlist-nav-button:focus-visible { color: #1c1e21; }
#root .wishlist-nav-button { color: #1c1e21; }
.wishlist-page .wishlist-empty > svg { color: var(--kaayd-blue); }

/* Loading placeholders follow the real listing grid's responsive columns. */
.grid-loading-announcement { position: absolute; width: 1px; height: 1px; padding: 0; margin: -1px; overflow: hidden; clip-path: inset(50%); white-space: nowrap; }
.listing-card-skeleton { min-width: 0; }
.listing-detail-skeleton__block,
.listing-card-skeleton__image,
.listing-card-skeleton__line,
.listing-card-skeleton__meta span,
.collection-card-skeleton__key,
.collection-card-skeleton__count {
  background: linear-gradient(100deg, #f0f2f5 25%, #f8f9fa 45%, #f0f2f5 65%);
  background-size: 200% 100%;
  animation: shimmer 1600ms ease-in-out infinite;
}
.listing-card-skeleton__image { aspect-ratio: 3 / 4; border-radius: 10px; margin-bottom: 12px; }
.listing-card-skeleton__line { width: 76%; height: 12px; border-radius: 4px; margin-bottom: 7px; }
.listing-card-skeleton__line--short { width: 54%; }
.listing-card-skeleton__meta { display: flex; justify-content: space-between; margin-top: 12px; }
.listing-card-skeleton__meta span { display: block; width: 24px; height: 12px; border-radius: 4px; }
.listing-card-skeleton__meta span:last-child { width: 56px; }
.collection-card-skeleton {
  position: relative;
  flex: 0 0 72px;
  height: 38px;
  box-sizing: border-box;
  padding: 8px 10px 10px;
  border: 1px solid rgba(18, 18, 18, 0.1);
}
.collection-card-skeleton__key { display: block; width: 34px; height: 12px; border-radius: 3px; }
.collection-card-skeleton__count { position: absolute; right: 5px; bottom: 4px; width: 12px; height: 7px; border-radius: 2px; }
@media (prefers-reduced-motion: reduce) {
  .listing-card-skeleton__image, .listing-card-skeleton__line, .listing-card-skeleton__meta span,
  .collection-card-skeleton__key, .collection-card-skeleton__count { animation: none; }
}
/* Compact currency picker, shared across navigation surfaces. */
.currency-menu { position: relative; font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif; }
#root .currency-trigger { border: 0; background: transparent; font-family: inherit; display: inline-flex; align-items: center; justify-content: center; gap: 7px; height: 40px; padding: 0 10px; border-radius: 999px; color: #222; cursor: pointer; list-style: none; transition: background 150ms ease; }
.currency-trigger::-webkit-details-marker { display: none; }
.currency-trigger span { font-size: 11px; font-weight: 600; letter-spacing: .02em; }
#root .currency-trigger:hover, #root .currency-trigger:active { background: #f3f3f3; }
.currency-trigger:focus-visible { outline: 2px solid #222; outline-offset: 2px; }
.currency-panel { position: fixed; inset: 0; box-sizing: border-box; width: min(500px, calc(100vw - 32px)); max-height: calc(100dvh - 32px); margin: auto; padding: 0; overflow-y: auto; border: 1px solid #ededed; border-radius: 16px; background: #fff; color: #222; box-shadow: 0 24px 80px rgb(0 0 0 / 18%); font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif; text-transform: none; letter-spacing: 0; font-weight: 400; line-height: 1.4; }
.currency-panel::backdrop { background: rgb(0 0 0 / 32%); backdrop-filter: none; }
dialog.currency-panel .currency-close { position: absolute; top: 14px; right: 16px; width: 36px; height: 36px; display: grid; place-items: center; padding: 0; border: 0; border-radius: 50%; background: #f2f3f5; color: #222; cursor: pointer; }
dialog.currency-panel .currency-close:hover { background: #e6e7e9; }
.currency-close:focus-visible { outline: 2px solid #222; outline-offset: 3px; }

.currency-panel-heading { display: flex; align-items: center; justify-content: center; min-height: 64px; padding: 0 60px; border-bottom: 1px solid #e5e7eb; }
.currency-panel-heading strong { font-size: 20px; font-weight: 650; letter-spacing: -.4px; }
.currency-panel-body { padding: 20px 24px 24px; }
.currency-description { margin: 0 0 18px; font-size: 14px; color: #65676b; }
.currency-options { display: grid; grid-template-columns: repeat(2, minmax(0, 1fr)); gap: 10px; max-height: calc(100dvh - 280px); overflow-y: auto; padding: 2px; margin: -2px; }
.currency-panel .currency-options button { display: flex; align-items: center; width: 100%; min-height: 66px; gap: 8px; padding: 12px; border: 1px solid #e4e6eb; border-radius: 10px; background: #fff; color: #1c1e21; font-family: inherit; text-align: left; text-transform: none; letter-spacing: 0; cursor: pointer; transition: background 150ms ease; }
.currency-panel .currency-options button:hover { background: #f5f6f7; }
.currency-panel .currency-options button[aria-pressed="true"] { border-color: #1c1e21; background: #f5f6f7; box-shadow: inset 0 0 0 .5px #1c1e21; }
.currency-panel button:focus-visible { outline: 2px solid #1c1e21; outline-offset: 2px; }
.currency-panel .currency-options button:disabled { opacity: .45; cursor: default; }
.currency-selection { flex: 0 0 18px; height: 18px; border: 1px solid #ccd0d5; border-radius: 50%; display: grid; place-items: center; box-sizing: border-box; }
.currency-choice[aria-pressed="true"] .currency-selection { background: #1c1e21; color: white; border-color: #1c1e21; }
.currency-name { flex: 1; min-width: 0; display: grid; gap: 4px; font-size: 13px; font-weight: 550; }
.currency-name small { color: #65676b; font-size: 12px; font-weight: 400; }
.currency-panel-footer { display: flex; align-items: center; gap: 16px; justify-content: space-between; padding: 16px 24px; border-top: 1px solid #e5e7eb; }
.currency-note { margin: 0; color: #65676b; font-size: 12px; line-height: 1.5; }
dialog.currency-panel .currency-done { flex-shrink: 0; min-width: 100px; min-height: 40px; border: 0; border-radius: 999px; background: var(--kaayd-blue, #1f62e8); color: white; font: 600 14px Inter, sans-serif; text-transform: none; letter-spacing: 0; cursor: pointer; }
dialog.currency-panel .currency-done:hover { background: #1855ce; }
.collection-filter-pill:disabled { opacity: .45; cursor: wait; }
@media (max-width: 600px) {
  .currency-panel-heading strong { font-size: 18px; }
  .currency-panel-body { padding: 18px 16px; }
  .currency-panel-footer { padding: 16px; }
  .currency-options { gap: 8px; }
  .currency-panel .currency-options button { padding: 10px; }
  #root .currency-trigger { width: 40px; padding: 0; }
  .currency-trigger span { display: none; }
}
@media (prefers-reduced-motion: reduce) { .currency-trigger, .currency-panel .currency-options button { transition: none; } }

/* Searchable country-selector style currency control. */
.currency-combobox > label { display: block; margin-bottom: 8px; color: #444950; font-size: 12px; font-weight: 600; }
.currency-select-field { display: flex; align-items: center; gap: 12px; min-height: 56px; padding: 0 14px; border: 1px solid #d9dce1; border-radius: 12px; background: #fff; }
.currency-select-field:focus-within { border-color: #25282d; box-shadow: 0 0 0 3px rgb(28 30 33 / 6%); }
.currency-panel .currency-select-field input { width: 100%; min-width: 0; padding: 0; margin: 0; border: 0; border-radius: 0; outline: none; box-shadow: none; background: transparent; color: #1c1e21; -webkit-text-fill-color: #1c1e21; font: 500 14px Inter, sans-serif; }
.currency-panel .currency-select-field input::placeholder { color: #858990; -webkit-text-fill-color: #858990; font-weight: 400; }
.currency-select-field > svg { flex-shrink: 0; color: #767b83; }
.currency-select-field.is-open .currency-chevron { transform: rotate(180deg); }
.currency-code-badge { flex: 0 0 40px; padding: 6px 0; border-radius: 6px; background: #f1f3f5; color: #555c66; text-align: center; font-size: 10px; font-weight: 650; letter-spacing: .5px; }
.currency-select-menu { margin-top: 8px; padding: 6px; border: 1px solid #e5e7eb; border-radius: 12px; box-shadow: 0 5px 18px rgb(0 0 0 / 5%); }
.currency-list-label { padding: 8px 10px; color: #858990; font-size: 11px; font-weight: 500; }
.currency-select-menu .currency-options { display: block; max-height: min(260px, calc(100dvh - 370px)); overflow-y: auto; margin: 0; padding: 0; overscroll-behavior: contain; }
.currency-option { display: flex; align-items: center; gap: 12px; min-height: 46px; padding: 4px 10px; border-radius: 7px; cursor: pointer; }
.currency-option.is-active { background: #f3f4f6; }
.currency-option-name { flex: 1; font-size: 13px; font-weight: 500; }
.currency-option-symbol { color: #858990; font-size: 12px; }
.currency-option > svg { flex-shrink: 0; }
.currency-no-results { padding: 16px 10px; color: #65676b; font-size: 13px; }

dialog.currency-panel .currency-select-trigger { width: 100%; cursor: pointer; text-align: left; color: #1c1e21; font: 500 14px Inter, sans-serif; text-transform: none; letter-spacing: 0; border-radius: 12px; }
.currency-selected-name { flex: 1; }
.currency-select-trigger:hover { background: #fafbfc; }
.currency-select-menu .currency-search-field { min-height: 44px; margin: 2px 2px 6px; border: 0; border-bottom: 1px solid #eceef1; border-radius: 0; box-shadow: none; padding: 0 10px; }

/* Brand navigation uses the same restrained selector language as currency. */
.brand-nav-menu { font-family: Inter, "Helvetica Neue", Helvetica, Arial, sans-serif; text-transform: none; letter-spacing: 0; }
.brand-nav-menu summary { min-height: 40px; gap: 6px; padding: 0 10px; margin-left: -10px; border-radius: 8px; color: #1c1e21; transition: background-color 140ms ease; }
.brand-nav-menu summary:focus-visible { outline: 2px solid #65676b; outline-offset: 2px; }
.brand-nav-menu summary::after { display: none; }
.brand-nav-menu summary > svg { flex-shrink: 0; width: 16px; height: 16px; color: #444950; stroke-width: 2; }
.brand-nav-menu[open] summary > svg { transform: rotate(180deg); }
.brand-nav-menu[open] summary, .brand-nav-menu summary:hover { color: #1c1e21; background: #f0f2f5; }
.brand-nav-current { color: #1c1e21; font-size: 14px; font-weight: 600; letter-spacing: 0; }
#root .brand-nav-dropdown { width: min(280px, calc(100vw - 32px)); padding: 5px; gap: 0; border: 1px solid #e5e7eb; border-radius: 10px; background: #fff; box-shadow: 0 6px 20px rgb(0 0 0 / 8%); }
.brand-nav-search { display: flex; align-items: center; gap: 10px; padding: 10px; margin: 0 2px 4px; border-bottom: 1px solid #eceef1; color: #858990; }
#root .brand-nav-search input { width: 100%; min-width: 0; margin: 0; padding: 0; border: 0; border-radius: 0; outline: none; box-shadow: none; background: transparent; color: #1c1e21; -webkit-text-fill-color: #1c1e21; font: 400 13px Inter, sans-serif; }
#root .brand-nav-search input::placeholder { color: #858990; -webkit-text-fill-color: #858990; }
.brand-nav-search:focus-within { border-bottom-color: #1c1e21; }
.brand-nav-options { max-height: min(460px, calc(100dvh - 140px)); overflow-y: auto; }
#root .brand-nav-dropdown button { min-height: 34px; gap: 8px; padding: 7px 9px; border: 0; border-radius: 8px; font: 400 12px/1.4 Inter, sans-serif; text-transform: none; letter-spacing: 0; color: #1c1e21; cursor: pointer; }
#root .brand-nav-dropdown button span { white-space: normal; }
#root .brand-nav-dropdown button svg { flex-shrink: 0; }
#root .brand-nav-dropdown button[aria-current="true"] { background: #f3f4f6; font-weight: 500; }
#root .brand-nav-dropdown button:hover:not(:disabled) { background: #f3f4f6; color: #1c1e21; }
#root .brand-nav-dropdown button:focus-visible { outline: 2px solid #1c1e21; outline-offset: -2px; }
.brand-nav-empty { padding: 16px 10px; font-size: 13px; color: #65676b; }
@media (max-width: 600px) { #root .brand-nav-dropdown { position: fixed; top: 64px; left: 16px; } }

.brand-nav-mobile-label { display: none; }
@media (max-width: 600px) { .brand-nav-mobile-label { display: inline; color: #1c1e21; font-size: 14px; font-weight: 600; letter-spacing: 0; } }

.brand-nav-group + .brand-nav-group { border-top: 1px solid #eceef1; margin-top: 5px; padding-top: 5px; }
.brand-nav-group-heading { padding: 7px 9px 4px; font-size: 12px; line-height: 1.4; font-weight: 600; color: #1c1e21; letter-spacing: 0; }
#root .brand-nav-group button { min-height: 30px; padding: 6px 9px 6px 25px; }
#root .brand-nav-group button:disabled { color: #92969d; cursor: default; }
#root .brand-nav-group button em { color: #92969d; font-size: 9px; }

/* Unknown session/data state is neutral, never a signed-out or empty result. */
.account-loading-placeholder { display: inline-flex; align-items: center; justify-content: flex-end; gap: 16px; min-width: 64px; height: 36px; }
.account-loading-placeholder > span { display: block; width: 20px; height: 20px; border-radius: 50%; background: #eef0f2; }
.session-loading-page { min-height: 100dvh; background: #fff; color: #1c1e21; }
.session-loading-header { display: grid; grid-template-columns: 1fr auto 1fr; align-items: center; min-height: 64px; padding: 0 24px; border-bottom: 1px solid #eceef1; }
.session-loading-header .account-loading-placeholder { justify-self: end; }
.session-loading-nav { width: 80px; height: 12px; background: #eef0f2; border-radius: 5px; }
.session-loading-content { max-width: 1200px; margin: 48px auto; padding: 0 24px; }
.session-loading-title { width: 180px; height: 30px; border-radius: 6px; background: #eef0f2; }
.session-loading-subtitle { width: 240px; height: 12px; margin-top: 16px; border-radius: 5px; background: #f3f4f5; }
.session-loading-grid { display: grid; grid-template-columns: repeat(4, 1fr); gap: 24px; margin-top: 40px; }
.session-loading-grid > div { aspect-ratio: 3 / 4; border-radius: 10px; background: #f3f4f5; }
@media (max-width: 600px) { .session-loading-grid { grid-template-columns: repeat(2, 1fr); gap: 12px; } }


/* One wordmark across home, internal pages, login and loading shells. */
#root .kaayd-wordmark { display: inline-flex; align-items: center; flex-shrink: 0; padding: 0; margin: 0; border: 0; background: transparent; color: #121212; font-family: Akrobat, "Helvetica Neue", Helvetica, Arial, sans-serif; font-size: 21px; font-weight: 400; line-height: 1.2; letter-spacing: .22em; text-decoration: none; text-transform: none; cursor: pointer; }
#root .kaayd-wordmark:focus-visible { outline: 2px solid var(--kaayd-blue, #1f62e8); outline-offset: 6px; border-radius: 2px; }
#root .app-top-nav .auth-nav-login { display: inline-flex; align-items: center; justify-content: center; min-height: 34px; padding: 0 15px; border: 1px solid rgb(16 17 20 / 14%); border-radius: 999px; background: rgb(255 255 255 / 72%); color: #101114; box-shadow: inset 0 0 0 1px rgb(255 255 255 / 46%); font: 700 12px Inter, sans-serif; letter-spacing: 0; text-transform: none; cursor: pointer; }
#root .app-top-nav .auth-nav-login:hover { background: #fff; border-color: rgb(16 17 20 / 24%); }

/* Borderless red logout footer, flush with the account panel edges. */
#root .account-menu .account-dropdown { border: 0; }
#root .account-menu .account-dropdown .account-logout-section { margin: 6px -6px -6px; padding: 0; border: 0; background: #e74c3c; }
#root .account-menu .account-dropdown .account-logout { width: 100%; margin: 0; padding: 12px 18px; border: 0; border-radius: 0; background: transparent; color: #fff; box-shadow: none; }
#root .account-menu .account-dropdown .account-logout svg { color: #fff; }
#root .account-menu .account-dropdown .account-logout:hover { background: #d94334; }
#root .account-menu .account-dropdown .account-logout:focus-visible { background: #d94334; outline: 2px solid #fff; outline-offset: -3px; }

/* Every routed page containing the shared footer owns a full-height column. */
#root :is(.app-shell, .manual-review-page, .legal-page, .session-loading-page, .discovery-home) {
  display: flex;
  flex-direction: column;
  min-height: 100vh;
  min-height: 100dvh;
}
#root .manual-review-page { padding-bottom: 0; }
/* Auto side margins prevent flex-column children from stretching. Keep review
   content full-width so auto-fill grids retain their available desktop tracks. */
.manual-review-page > :is(
  .manual-review-header,
  .manual-review-brand-tabs,
  .manual-review-type-grid,
  .manual-review-filter-bar,
  .manual-review-index
) {
  width: 100%;
  min-width: 0;
}
.kaayd-footer { flex-shrink: 0; }

/* Preview follows rendered lines; expansion preserves the complete text and paragraphs. */
.listing-info-section .description {
  display: block;
  overflow: visible;
  -webkit-line-clamp: unset;
  white-space: pre-wrap;
  overflow-wrap: anywhere;
  margin-top: 0;
}
.listing-info-section .description.description-preview {
  display: -webkit-box;
  -webkit-box-orient: vertical;
  -webkit-line-clamp: 3;
  overflow: hidden;
}
#root .description-toggle {
  display: inline-flex;
  align-items: center;
  justify-content: center;
  justify-self: start;
  gap: 5px;
  min-height: 44px;
  padding: 0;
  border: 0;
  border-radius: 2px;
  background: transparent;
  color: #626262;
  font: 500 13px/1.5 Inter, sans-serif;
  text-transform: none;
  letter-spacing: 0;
  text-decoration: none;
  cursor: pointer;
  transition: color 150ms ease;
}
#root .description-toggle:hover { color: #1c1e21; }
#root .description-toggle:active { color: #101114; }
#root .description-toggle:focus-visible { outline: 2px solid var(--kaayd-blue, #1f62e8); outline-offset: 3px; }
#root .description-toggle svg { flex-shrink: 0; }
#root .description-toggle[aria-expanded="true"] svg { transform: rotate(180deg); }
@media (prefers-reduced-motion: reduce) {
  #root .description-toggle { transition: none; }
}
.app-shell > .browse-area { flex: 1 0 auto; }
/* Let listing copy grow in the page, rather than hide its ending in a nested scroller. */
.public-listing-detail { height: auto; overflow: visible; }
.public-listing-detail > .listing-detail-content { max-height: none; overflow: visible; }
@media (min-width: 1181px) {
  .public-listing-detail { min-height: calc(100dvh - 106px); }
  .public-listing-detail > .listing-detail-media {
    height: calc(100dvh - 174px);
    align-self: start;
  }
}
.app-shell > .collection-rail { width: 100%; min-width: 0; }

/* Quiet provenance disclosure, separate from action-button styling. */
.description-heading { display: flex; align-items: center; gap: 0; }
.description-info { position: relative; display: inline-flex; align-items: center; flex: 0 0 auto; }
#root .description-info-trigger {
  display: inline-flex; align-items: center; justify-content: center;
  width: 24px; height: 24px; min-height: 24px; padding: 0;
  border: 0; border-radius: 50%; background: transparent; box-shadow: none;
  color: #777; cursor: pointer;
}
/* Inter’s visible glyphs sit 1px below its line-box centre; align the icon optically. */
#root .description-info-trigger > svg { display: block; flex-shrink: 0; transform: translateY(1px); }
#root .description-info-trigger:hover { color: #333; background: transparent; }
#root .description-info-trigger:focus-visible { outline: 2px solid var(--kaayd-blue, #1f62e8); outline-offset: 2px; }
.description-info-tooltip {
  position: absolute; z-index: 10; top: calc(100% + 7px); left: -108px;
  width: min(260px, calc(100vw - 48px)); padding: 10px 12px;
  border: 1px solid #e4e4e4; border-radius: 8px; background: #fff;
  box-shadow: 0 3px 12px rgba(0, 0, 0, .07);
  color: #555; font: 400 12px/1.5 Inter, sans-serif;
  text-transform: none; letter-spacing: 0;
}

/* Public detail placeholders share the loaded page geometry and grid shimmer. */
.listing-detail-skeleton__block { display: block; border-radius: 4px; }
.listing-detail-skeleton__title { height: 26px; margin-top: 18px; width: 94%; }
.listing-detail-skeleton__title.short { width: 66%; margin-top: 8px; }
.listing-detail-skeleton__price { width: 84px; height: 20px; margin-top: 16px; }
.listing-detail-skeleton__heading { width: 96px; height: 14px; margin: 12px 0 20px; }
.listing-detail-skeleton__row { display: flex; justify-content: space-between; gap: 24px; margin-bottom: 14px; }
.listing-detail-skeleton__row > span { width: 28%; height: 12px; }
.listing-detail-skeleton__row > span:last-child { width: 52%; }
.listing-detail-skeleton__action { height: 44px; border-radius: 999px; margin: 24px 0 12px; }
.listing-detail-skeleton__row.actions { justify-content: flex-start; margin-bottom: 24px; }
.listing-detail-skeleton__row.actions > span { width: 96px; height: 36px; border-radius: 999px; }
.listing-detail-skeleton__copy { width: 100%; height: 12px; margin-bottom: 10px; }
.listing-detail-skeleton__copy.short { width: 70%; }
@media (prefers-reduced-motion: reduce) {
  .listing-detail-skeleton__block { animation: none; }
}

/* Admin curation: quiet actions and a photo-first, white runway comparison workspace. */
.listing-curation-actions { display:flex; flex-wrap:wrap; gap:8px; padding-block:8px; }
.listing-curation-actions .listing-curation-button,
.runway-picker .runway-picker-secondary,
.runway-picker .runway-picker-primary,
.runway-picker .runway-picker-close {
  display:inline-flex; align-items:center; justify-content:center; gap:8px;
  min-height:36px; padding:8px 14px; border:0; border-radius:8px;
  background:#f0f2f5; color:#1c1e21; font-size:13px; font-weight:600; line-height:20px;
  letter-spacing:normal; text-transform:none; box-shadow:none; cursor:pointer;
}
.listing-curation-button svg,.runway-picker button svg { flex-shrink:0; }
.listing-curation-actions .listing-curation-button:hover,.runway-picker .runway-picker-secondary:hover { background:#e4e6eb; }
.listing-curation-actions .listing-curation-button[aria-pressed="true"] { background:#e7f3ff; color:#0866c6; }
.listing-curation-actions .listing-curation-button[aria-pressed="true"] svg { fill:currentColor; }
.listing-curation-actions button:focus-visible,.runway-picker button:focus-visible,.runway-picker input:focus-visible { outline:2px solid #0866c6; outline-offset:3px; }
.listing-curation-actions button:focus:not(:focus-visible),.runway-picker button:focus:not(:focus-visible) { outline:none; }
.runway-look-browser-backdrop { background:rgb(28 30 33 / 45%); padding:24px; }
.runway-look-browser.runway-picker { width:min(1320px,100%); height:min(880px,calc(100dvh - 48px)); grid-template-rows:auto minmax(0,1fr) auto; background:#fff; border:0; border-radius:14px; box-shadow:0 16px 56px rgb(0 0 0 / 18%); color:#1c1e21; }
.runway-picker .runway-look-browser-header { padding:20px 24px; gap:12px; background:#fff; border-color:#e4e6eb; }
.runway-picker .runway-look-browser-header h2 { margin:0; font-size:20px; line-height:1.3; letter-spacing:-.3px; }
.runway-picker .runway-look-browser-header p { margin:5px 0 0; color:#65676b; font-size:13px; line-height:1.4; }
.runway-picker .runway-picker-close { width:36px; padding:0; border-radius:50%; flex-shrink:0; }
.runway-picker .runway-look-browser-body { grid-template-columns:minmax(0,1fr) minmax(0,1fr) minmax(280px,1.15fr); gap:18px; padding:20px 24px; overflow:hidden; }
.runway-picker .runway-look-browser-listing,.runway-picker .runway-look-browser-focus { grid-template-rows:auto minmax(0,1fr) 54px; gap:10px; min-width:0; }
.runway-picker h3 { font-size:13px; font-weight:600; margin:0; color:#65676b; }
.runway-picker .runway-look-browser-image-frame { background:#fff; border:1px solid #eef0f3; border-radius:8px; }
.runway-picker .runway-look-browser-image-frame img { width:100%; height:100%; max-width:100%; max-height:100%; object-fit:contain; border-radius:0; }
.runway-picker .runway-look-browser-listing-thumbs { display:flex; gap:6px; padding:0; overflow-x:auto; }
.runway-picker .runway-look-browser-listing-thumbs button { width:42px; height:52px; min-width:42px; padding:0; border:1px solid #e4e6eb; border-radius:5px; background:white; box-shadow:none; }
.runway-picker .runway-look-browser-listing-thumbs button.active { border-color:#0866c6; box-shadow:none; }
.runway-picker .runway-look-browser-grid-panel { display:flex; flex-direction:column; gap:12px; padding-left:18px; border-color:#e4e6eb; min-width:0; }
.runway-picker-tools { flex-shrink:0; display:grid; gap:10px; }
.runway-picker .runway-look-browser-tabs { display:flex; width:100%; margin:0; padding:3px; border:0; border-radius:8px; background:#f0f2f5; gap:4px; order:initial; }
.runway-picker .runway-look-browser-tabs button { flex:1; min-height:34px; padding:6px 10px; border:0; border-radius:6px; background:transparent; color:#65676b; box-shadow:none; font-size:13px; }
.runway-picker .runway-look-browser-tabs button.active { background:#fff; color:#0866c6; box-shadow:0 1px 3px rgb(0 0 0 / 8%); }
.runway-picker-search { display:flex; align-items:center; gap:8px; padding:0 12px; height:40px; min-width:0; background:#f0f2f5; border-radius:8px; color:#65676b; }
.runway-picker-search svg { flex-shrink:0; }
.runway-picker .runway-picker-search input { flex:1; min-width:0; width:100%; height:100%; min-height:0; margin:0; padding:0; line-height:20px; border:0; background:transparent; box-shadow:none; color:#1c1e21; font-size:13px; border-radius:0; }
.runway-picker-count { margin:0; color:#65676b; font-size:12px; line-height:18px; }
.runway-picker .runway-look-browser-grid { height:auto; flex:1; grid-template-columns:repeat(2,minmax(0,1fr)); grid-auto-rows:max-content; gap:10px; padding:3px; overflow-y:auto; }
.runway-picker .runway-look-browser-grid button { display:flex; flex-direction:column; height:auto; min-height:0; border:1px solid #e4e6eb; background:#fff; color:#1c1e21; border-radius:8px; padding:0 0 8px; box-shadow:none; }
.runway-picker .runway-look-browser-grid button:hover { background:#f7f8fa; border-color:#b8bec7; }
.runway-picker .runway-look-browser-grid button.active { border-color:#0866c6; background:#e7f3ff; box-shadow:none; }
.runway-picker .runway-look-browser-grid img,.runway-picker .runway-look-browser-grid .image-placeholder { height:150px; width:100%; object-fit:contain; background:white; }
.runway-picker .runway-look-browser-grid .runway-picker-card-caption { position:static; min-height:30px; width:100%; padding:8px 10px 0; display:flex; justify-content:space-between; gap:6px; background:transparent; color:inherit; font-size:13px; text-transform:none; }
.runway-picker .runway-look-browser-grid small { padding:2px 10px 0; color:#65676b; font-size:11px; text-align:left; }
.runway-picker-state { display:flex; flex:1; min-height:160px; flex-direction:column; align-items:center; justify-content:center; gap:10px; text-align:center; color:#65676b; padding:20px; }
.runway-picker-state strong { color:#1c1e21; font-size:15px; }
.runway-picker-state p { margin:0; font-size:13px; line-height:1.5; }
.runway-picker-footer { display:flex; justify-content:space-between; align-items:center; gap:16px; padding:16px 24px; border-top:1px solid #e4e6eb; background:white; }
.runway-picker-footer strong { font-size:14px; }
.runway-picker-footer p { margin:4px 0 0; color:#65676b; font-size:12px; }
.runway-picker-footer-actions { display:flex; gap:8px; flex-shrink:0; }
.runway-picker .runway-picker-primary { background:#0866ff; color:white; }
.runway-picker .runway-picker-primary:hover { background:#0758d8; }
.runway-picker button:disabled { cursor:default; opacity:.5; }
.runway-picker-footer .runway-picker-error { color:#b42318; }
@media(max-width:1000px) {
 .runway-picker .runway-look-browser-body { grid-template-columns:repeat(2,minmax(0,1fr)); overflow-y:auto; align-content:start; }
 .runway-picker .runway-look-browser-listing,.runway-picker .runway-look-browser-focus { height:330px; }
 .runway-picker .runway-look-browser-grid-panel { grid-column:1 / -1; border:0; padding:0; overflow:visible; }
 .runway-picker .runway-look-browser-grid { grid-template-columns:repeat(4,minmax(0,1fr)); overflow:visible; flex:none; }
}
@media(max-width:600px) {
 .runway-look-browser-backdrop { padding:8px; }
 .runway-look-browser.runway-picker { height:calc(100dvh - 16px); width:100%; border-radius:12px; }
 .runway-picker .runway-look-browser-header { padding:16px; flex-wrap:nowrap; }
 .runway-picker .runway-look-browser-header h2 { font-size:18px; }
 .runway-picker .runway-look-browser-body { padding:16px; gap:14px 10px; }
 .runway-picker .runway-look-browser-listing,.runway-picker .runway-look-browser-focus { height:246px; grid-template-rows:auto minmax(0,1fr) 42px; }
 .runway-picker .runway-look-browser-listing-thumbs button { height:40px; min-width:32px; width:32px; }
 .runway-picker .runway-look-browser-grid { grid-template-columns:repeat(2,minmax(0,1fr)); }
 .runway-picker-footer { padding:12px 16px; flex-wrap:wrap; gap:10px; }
 .runway-picker-footer p { display:none; }
 .runway-picker-footer-actions { width:100%; }
 .runway-picker-footer-actions button { flex:1; min-height:42px !important; }
 .runway-picker .runway-picker-close { height:40px; width:40px; }
}
.listing-curation-actions,.runway-look-browser.runway-picker { font-family:Inter, "Helvetica Neue", Helvetica, Arial, sans-serif; }
.listing-curation-actions button,.runway-picker button,.runway-picker input { font-family:inherit; }
/* Exclude these scoped controls from the legacy high-specificity global button radius. */
#root .runway-picker button { border-radius:8px; }
#root .runway-picker .runway-picker-close,#root .runway-picker .listing-carousel-arrow { border-radius:50%; }
#root .listing-curation-actions .listing-curation-button { border-radius:8px; }
.runway-picker .runway-picker-search input:focus-visible { outline:none; }
.runway-picker-search:has(input:focus-visible) { outline:2px solid #0866c6; outline-offset:2px; }
.runway-picker-footer-actions button { white-space:nowrap; }
@media(max-width:600px) {
 .runway-picker-footer-actions .runway-picker-secondary { flex:.7; }
 .runway-picker-footer-actions .runway-picker-primary { flex:1.3; padding-inline:10px; }
}

.review-missing-badges { display: flex; flex-wrap: wrap; gap: 4px; margin-top: 8px; }
.review-missing-badges span { padding: 4px 6px; border-radius: 4px; background: #f0f2f5; color: #535a65; font-size: 10px; }

.grid-arrange-bar { display:flex; align-items:center; justify-content:space-between; gap:16px; padding:12px 24px; background:#f0f4fa; color:#4b5563; font:13px/1.5 Inter,sans-serif; }
.grid-arrange-bar button { border:1px solid #dce1e8; background:#fff; padding:8px 14px; white-space:nowrap; }
.grid-order-status { padding:0 24px; font:13px/1.5 Inter,sans-serif; color:#4b5563; }
.arrange-card { min-width:0; border:1px dashed #bdc8d9; border-radius:10px; padding:6px; cursor:grab; }
.arrange-card:active { cursor:grabbing; }
.arrange-card-controls { display:flex; gap:4px; align-items:center; padding:4px 0 10px; color:#596372; }
.arrange-card-controls label { display:flex; align-items:center; gap:4px; font:11px Inter,sans-serif; min-width:0; margin-right:auto; }
.arrange-card-controls input { width:46px; min-width:0; border:1px solid #dce1e8; border-radius:5px; padding:5px; font:12px Inter,sans-serif; background:white; color:#1c1e21; }
.arrange-card-controls button { display:flex; align-items:center; justify-content:center; width:28px; height:32px; padding:0; border:0; background:#eef1f5; color:#374151; }
.arrange-card-preview { pointer-events:none; }
@media(max-width:700px) { .grid-arrange-bar { align-items:flex-start; padding:12px 16px; } .arrange-card-controls { flex-wrap:wrap; } .arrange-card-controls label { flex:1; } }

.arrange-card-preview :is(.delete-listing-button,.favorite-button) { display:none; }
@media(max-width:700px) {
 .arrange-card-controls { display:grid; grid-template-columns:16px minmax(0,1fr) 28px 28px; gap:4px; }
 .arrange-card-controls > svg { grid-column:1; }
 .arrange-card-controls label { grid-column:2 / -1; justify-content:space-between; }
 .arrange-card-controls input { flex-shrink:0; width:48px; }
 .arrange-card-controls button { min-height:36px; }
 .arrange-card-controls button:first-of-type { grid-column:3; }
 .arrange-card-controls button:last-of-type { grid-column:4; }
}

/* Reserve the final number’s width so the heading never reflows during counting. */
.discovery-home .archive-count {
  display: inline-grid;
  color: #1F62E8;
  font-weight: 750;
  font-variant-numeric: tabular-nums;
  white-space: nowrap;
  vertical-align: baseline;
}

.discovery-home .archive-count > span {
  grid-area: 1 / 1;
}

.discovery-home .archive-count__width {
  visibility: hidden;
}

.discovery-home .archive-count__value {
  text-align: right;
}

/* Keep the entire heading reserved until its count is known; reveal in one render. */
.discovery-home .archive-heading--loading {
  visibility: hidden;
}

/* Keep the signed-in homepage's three header regions separate on narrow phones. */
@media (max-width: 400px) {
  .discovery-home .app-top-nav {
    padding-inline: 16px;
  }

  .discovery-home .app-top-nav nav {
    gap: 10px;
  }
}

/* Brand browsing is navigation: a spacious grouped panel, not a form selector. */
.app-top-nav .brand-nav-menu summary {
  position: relative;
  border-radius: 0;
  background: transparent;
}
.app-top-nav .brand-nav-menu[open] summary,
.app-top-nav .brand-nav-menu summary:hover {
  border-radius: 8px;
  background: #f0f2f5;
}
#root .app-top-nav .brand-nav-dropdown {
  width: min(720px, calc(100vw - 60px));
  top: calc(100% + 9px);
  padding: 24px;
  border: 1px solid #eceef1;
  border-radius: 0 0 16px 16px;
  background: #fafbfc;
  box-shadow: 0 12px 24px rgb(28 30 33 / 7%);
}
.app-top-nav .brand-nav-options {
  display: grid;
  grid-template-columns: 1.3fr 1fr 1fr;
  gap: 24px;
  max-height: min(520px, calc(100dvh - 120px));
}
/* Keep the trigger and panel one hover region across their visual gap. */
@media (hover: hover) and (pointer: fine) {
  .app-top-nav .brand-nav-dropdown::before {
    content: "";
    position: absolute;
    top: -12px;
    left: -1px;
    right: -1px;
    height: 12px;
  }
}
.app-top-nav .brand-nav-group + .brand-nav-group { margin: 0; padding: 0; border: 0; }
.app-top-nav .brand-nav-group-heading { padding: 0 10px 12px; font-size: 13px; font-weight: 600; color: #65676b; }
#root .app-top-nav .brand-nav-group button {
  min-height: 44px;
  padding: 10px;
  font-size: 14px;
  font-weight: 500;
  line-height: 1.45;
  background: transparent;
}
#root .app-top-nav .brand-nav-group button[aria-current="true"],
#root .app-top-nav .brand-nav-group button:hover:not(:disabled) { background: #eceff3; }
#root .app-top-nav .brand-nav-group button em { font-size: 10px; font-weight: 400; }
@media (max-width: 600px) {
  #root .app-top-nav .brand-nav-dropdown {
    position: fixed;
    top: 64px;
    left: 12px;
    width: calc(100vw - 24px);
    padding: 16px;
    border-radius: 0 0 14px 14px;
  }
  .app-top-nav .brand-nav-options { grid-template-columns: 1fr; gap: 20px; max-height: calc(100dvh - 120px); }
  .app-top-nav .brand-nav-group-heading { padding-bottom: 6px; }
  .app-top-nav .brand-nav-group + .brand-nav-group { padding-top: 16px; border-top: 1px solid #e5e7eb; }
}

@media (max-width: 400px) {
  .discovery-home .app-top-nav .account-loading-placeholder {
    min-width: 54px;
    gap: 14px;
  }
}
/* Admin-only design system. Blue is reserved for selection and primary actions;
   white canvas and evidence surfaces blend with product photography. */
:where(.manual-review-page,.manual-review-detail-page,.admin-tools-panel,.manual-review-move-panel,.delete-confirm-modal) {
  --review-canvas:#fff; --review-text:#1c1e21; --review-muted:#606770;
  --review-line:#dce0e5; --review-blue:#0866ff; --review-selected:#eaf2ff; --review-danger:#b42332;
  color:var(--review-text); font-family:Inter,-apple-system,BlinkMacSystemFont,"Segoe UI",sans-serif;
}
#root :is(.manual-review-page,.manual-review-detail-page) { background:var(--review-canvas); padding-bottom:0; }
#root .manual-review-page { display:flex; flex-direction:column; min-height:100dvh; }
#root .manual-review-page > .site-footer { margin-top:48px; background:#fff; }
#root .manual-review-header { width:min(100%,1440px); padding:34px 32px 22px; border:0; align-items:center; }
#root .manual-review-header .eyebrow { display:block; margin-bottom:8px; color:var(--review-blue); font:600 12px/1.4 Inter,sans-serif; letter-spacing:0; text-transform:none; }
#root .manual-review-header h1 { font:650 clamp(24px,2.5vw,32px)/1.2 Inter,sans-serif; letter-spacing:-.7px; text-transform:none; }
#root .manual-review-header p { color:var(--review-muted); font-size:14px; font-weight:400; letter-spacing:0; text-transform:none; }
#root .manual-review-count { flex-shrink:0; display:grid; gap:4px; padding:12px 18px; border:1px solid var(--review-line); border-radius:12px; background:#fff; color:var(--review-muted); font:400 12px/1.4 Inter,sans-serif; text-transform:none; }
#root .manual-review-count strong { color:var(--review-text); font-size:24px; font-weight:650; font-variant-numeric:tabular-nums; }
#root .manual-review-brand-tabs { width:min(100%,1440px); margin:0 auto; padding:0 32px 12px; gap:6px; }
#root .manual-review-brand-tabs a { min-height:40px; padding:8px 12px; border:1px solid transparent; border-radius:8px; background:transparent; color:var(--review-muted); font:600 12px/1.35 Inter,sans-serif; text-transform:none; }
#root .manual-review-brand-tabs a:hover { background:#e4e7ec; }
#root .manual-review-brand-tabs a.active { color:#0754ce; background:#fff; border-color:var(--review-line); box-shadow:0 1px 2px #1c1e2108; }
#root .manual-review-brand-tabs em { border-radius:5px; padding:2px 6px; background:#edf0f4; color:var(--review-muted); font-size:11px; }
#root .manual-review-type-grid { width:min(100%,1440px); grid-template-columns:repeat(3,minmax(0,1fr)); gap:18px; margin:14px auto 0; padding:0 32px; }
#root .manual-review-type-card { min-height:210px; gap:14px; padding:22px; border:1px solid var(--review-line); border-radius:12px; background:#fff; box-shadow:0 1px 2px #1c1e2105; }
#root .manual-review-type-card:hover:not(:disabled) { border-color:#8db7ff; background:#fff; box-shadow:0 3px 12px #1c1e2110; }
#root .manual-review-type-card .manual-review-queue-label { display:flex; justify-content:space-between; gap:12px; color:var(--review-text); font-size:14px; font-weight:600; letter-spacing:0; text-transform:none; }
#root .manual-review-queue-label svg { flex-shrink:0; color:var(--review-blue); }
#root .manual-review-type-card strong { color:var(--review-text); font:600 38px/1.1 Inter,sans-serif; letter-spacing:-1px; font-variant-numeric:tabular-nums; }
#root .manual-review-type-card em { color:var(--review-muted); font-size:13px; line-height:1.6; }
#root .manual-review-filter-bar { width:min(calc(100% - 64px),1376px); margin:14px auto 0; padding:20px; gap:18px; border:1px solid var(--review-line); border-radius:12px; background:#fff; }
#root .manual-review-filter-heading { padding-bottom:14px; border-color:#edf0f4; }
#root .manual-review-filter-title { display:flex; align-items:center; flex-wrap:wrap; gap:8px; }
#root .manual-review-filter-title > span { color:var(--review-text); font-size:14px; font-weight:650; text-transform:none; letter-spacing:0; }
#root .manual-review-filter-title small { margin-left:8px; color:var(--review-muted); font-size:12px; }
#root .manual-review-filter-group { grid-template-columns:80px minmax(0,1fr); gap:12px; }
#root .manual-review-filter-group > span { padding-top:10px; color:var(--review-muted); font-size:12px; font-weight:600; letter-spacing:0; text-transform:none; }
#root .manual-review-filter-options { gap:7px; }
#root .manual-review-filter-options button { min-height:36px; border:1px solid var(--review-line); border-radius:7px; padding:7px 11px; color:#4b5260; background:#fff; font:500 12px/1.4 Inter,sans-serif; text-transform:none; }
#root .manual-review-filter-options button:hover { background:#f0f2f5; border-color:#aeb6c2; }
#root .manual-review-filter-options button.active { color:#0754ce; border-color:#a9caff; background:var(--review-selected); }
#root .manual-review-filter-options button { display:inline-flex; align-items:center; gap:5px; }
#root .manual-review-filter-options button.excluded { color:var(--review-danger); background:#fff1f3; border-color:#efb8c1; }
#root .manual-review-clear-filters { min-height:36px; padding:0 10px; border:0; border-radius:7px !important; color:#0754ce; text-transform:none; font-size:12px; white-space:nowrap; }
#root .manual-review-clear-filters:hover { background:var(--review-selected); }
#root .manual-review-index { width:min(100%,1440px); margin:24px auto 0; padding:0 32px; }
#root .manual-review-index .listing-grid { grid-template-columns:repeat(6,minmax(0,1fr)); gap:20px; }
#root .manual-review-tile { overflow:hidden; border:1px solid var(--review-line); border-radius:12px; background:#fff; }
#root .manual-review-tile .listing-image-button { display:block; width:100%; padding:0; border:0; border-radius:0; background:#fff; }
#root .manual-review-tile .listing-copy { padding:14px; }
#root .manual-review-card-context { display:flex; flex-wrap:wrap; justify-content:space-between; gap:5px; margin-bottom:10px; color:var(--review-muted); font-size:10px; line-height:1.5; }
#root .manual-review-card-context > span:first-child { color:#0754ce; font-weight:600; }
#root .manual-review-tile .designer-line p { color:var(--review-muted); font-size:10px; line-height:1.5; letter-spacing:0; }
#root .manual-review-tile .product-line { color:var(--review-text); font:600 13px/1.5 Inter,sans-serif; text-transform:none; }
#root .manual-review-card-reason { display:-webkit-box; overflow:hidden; -webkit-line-clamp:2; -webkit-box-orient:vertical; margin:10px 0 0; padding-top:10px; border-top:1px solid #edf0f4; color:var(--review-muted); font:400 11px/1.55 Inter,sans-serif; }
#root .manual-review-tile :is(.delete-listing-button,.accept-review-button) { width:36px; height:36px; opacity:1; border:1px solid var(--review-line); background:#fff; box-shadow:0 2px 6px #1c1e2110; }
#root .manual-review-tile .delete-listing-button { color:var(--review-danger); }
#root .manual-review-tile .accept-review-button { color:#0754ce; }
#root .manual-review-empty { width:min(calc(100% - 64px),1376px); margin:24px auto; border:1px dashed #c7cdd5; border-radius:12px; color:var(--review-muted); background:#fff; }
/* Evidence-first comparison with a distinct decision rail. */
#root .manual-review-detail-page .manual-review-match-detail { max-width:1680px; margin:0 auto; padding:20px 28px 28px; gap:20px; }
#root .manual-review-detail-page .listing-page-nav { margin-bottom:0; }
#root .manual-review-detail-page .back-button { background:#fff; border:1px solid var(--review-line); padding:8px 14px; color:var(--review-text); font-size:12px; text-transform:none; }
#root .manual-review-detail-page .manual-review-detail-content { padding:20px; border:1px solid var(--review-line); border-radius:12px; background:#fff; }
#root .manual-review-detail-page .manual-review-detail-top h1 { color:var(--review-text); font:600 22px/1.3 Inter,sans-serif; letter-spacing:-.4px; text-transform:none; }
#root .manual-review-detail-status { display:flex; flex-wrap:wrap; gap:6px; margin-bottom:14px; color:var(--review-muted); font-size:11px; line-height:1.5; }
#root .manual-review-detail-status > span:first-child { padding:3px 8px; border-radius:5px; color:#0754ce; background:var(--review-selected); font-weight:600; }
#root .manual-review-detail-status > span + span { padding:3px 0; }
#root .manual-review-detail-page .listing-detail-price { margin-top:12px; color:var(--review-muted); font-size:15px; }
#root .manual-review-detail-page .manual-review-comparison-image { position:relative; overflow:hidden; border:1px solid var(--review-line); border-radius:12px; background:#fff; }
#root .manual-review-image-label { position:absolute; z-index:2; left:12px; top:12px; padding:6px 10px; border:1px solid var(--review-line); border-radius:6px; background:#ffffffed; color:var(--review-muted); font:500 11px/1.3 Inter,sans-serif; }
#root .manual-review-detail-page .listing-thumbnail { padding:0; border-radius:7px; background:#fff; }
#root .manual-review-detail-page .listing-thumbnail.active { border-color:var(--review-text); box-shadow:none; }
#root .manual-review-detail-page .listing-info-section { margin-top:20px; padding-top:18px; border-color:var(--review-line); }
#root .manual-review-detail-page .listing-info-section h2 { color:var(--review-text); font:600 14px/1.4 Inter,sans-serif; }
#root :is(.manual-review-detail-page,.admin-tools-panel) .manual-review-neighbour { border-color:var(--review-line); border-radius:9px; background:#fff; }
#root :is(.manual-review-detail-page,.admin-tools-panel) .manual-review-neighbour.active { border-color:#8db7ff; background:var(--review-selected); }
#root .manual-review-neighbour-title { font-size:12px; line-height:1.5; }
#root .manual-review-neighbour-meta { color:var(--review-muted); font-family:Inter,sans-serif; text-transform:none; }
#root .manual-review-selected-match { border-color:var(--review-line); padding:12px 0; }
#root .manual-review-selected-match :is(span,em), #root .manual-review-fields span { color:var(--review-muted); font-size:12px; text-transform:none; letter-spacing:0; }
#root .manual-review-selected-match strong { color:var(--review-text); font-size:14px; }
#root .manual-review-fields input { min-height:42px; padding:10px 12px; border:1px solid #bac2cc; border-radius:7px; background:#fff; color:var(--review-text); font-size:13px; }
#root .manual-review-fields input:focus { border-color:var(--review-text); box-shadow:none; }
#root :is(.manual-review-detail-page,.admin-tools-panel) :is(.collection-key-option,.metadata-size-option,.metadata-category-option) { border:1px solid var(--review-line); border-radius:7px; background:#fff; color:var(--review-text); }
#root :is(.manual-review-detail-page,.admin-tools-panel) :is(.collection-key-option,.metadata-size-option,.metadata-category-option):is(:hover,.active) { border-color:#8db7ff; background:var(--review-selected); color:#0754ce; }
#root .manual-review-metadata-summary { gap:8px; }
#root .manual-review-metadata-summary div { border:1px solid var(--review-line); border-radius:8px; padding:12px; background:#f7f8fa; }
#root .manual-review-metadata-summary span { color:var(--review-muted); letter-spacing:0; text-transform:none; font-size:11px; }
#root .manual-review-resolution-pager { position:static; margin:14px 0 0 auto; min-height:40px; border-color:var(--review-line); box-shadow:none; background:#f7f8fa; }
#root .manual-review-resolution-pager button { width:30px; height:30px; }
#root .manual-review-resolution-pager button:is(:hover,.active) { background:var(--review-blue); color:#fff; }
#root .manual-review-resolution-panel { height:auto; padding-bottom:0; }
#root .manual-review-detail-view-tabs { padding:3px; gap:3px; border-radius:8px; background:#f0f2f5; }
#root .manual-review-detail-view-tabs button { min-height:34px; border-radius:6px; padding:5px 14px; color:var(--review-muted); }
#root .manual-review-detail-view-tabs button.active { background:#fff; color:#0754ce; box-shadow:0 1px 3px #1c1e2112; }
#root .manual-review-detail-view-tabs button::before, #root .manual-review-detail-view-tabs button::after { display:none; }
/* Admin editing panels also appear on listing routes. */
#root :is(.manual-review-resolve-button,.admin-primary-action) { min-height:42px; border:1px solid var(--review-blue,#0866ff); background:var(--review-blue,#0866ff); color:#fff; font:600 13px/1.4 Inter,sans-serif; letter-spacing:0; text-transform:none; }
#root :is(.manual-review-resolve-button,.admin-primary-action):hover:not(:disabled) { background:#0754ce; border-color:#0754ce; }
#root .manual-review-move-button { border-color:var(--review-line); background:#f0f2f5; color:var(--review-text); font-weight:600; }
#root .manual-review-trash-button { border-color:#edc8ce; background:#fff; color:var(--review-danger); }
#root .manual-review-trash-button:hover:not(:disabled) { background:#fff1f3; color:#941e2a; }
#root :is(.admin-tools-panel,.manual-review-move-panel,.delete-confirm-modal) { border:1px solid var(--review-line); border-radius:14px; background:#fff; box-shadow:0 16px 56px #1c1e2126; backdrop-filter:none; }
#root .admin-tools-panel { min-width:min(360px,calc(100vw - 32px)); }
#root .admin-tools-header { min-height:54px; padding:12px 16px; border-color:var(--review-line); background:#fff; }
#root .admin-tools-header button { width:34px; height:34px; background:#f0f2f5; }
#root .admin-tools-header span, #root .manual-review-move-panel-body > span { color:var(--review-muted); text-transform:none; letter-spacing:0; font-size:12px; }
#root .admin-tools-tabs { background:#f0f2f5; }
#root .admin-tools-tabs button { color:var(--review-muted); border-radius:7px; }
#root .admin-tools-tabs button.active { color:#0754ce; box-shadow:0 1px 3px #1c1e2110; }
#root .manual-review-move-brand-list button { min-height:44px; border-color:var(--review-line); border-radius:7px; color:var(--review-text); font-weight:500; }
#root .manual-review-move-brand-list button:hover { border-color:#8db7ff; background:var(--review-selected); color:#0754ce; }
#root .manual-review-source-link.panel, #root .manual-review-image-order-thumb { background:#f0f2f5; }
#root .manual-review-image-order-item.active { border-color:var(--review-text); box-shadow:inset 0 0 0 1px var(--review-text); }
#root :is(.manual-review-page,.manual-review-detail-page,.admin-tools-panel,.manual-review-move-panel,.delete-confirm-modal) :is(button,a,input):focus-visible { outline:2px solid var(--review-text); outline-offset:3px; }
#root :is(.manual-review-page,.manual-review-detail-page,.admin-tools-panel) button:disabled { opacity:.48; cursor:not-allowed; }
#root .manual-review-page .listing-skeleton, #root .manual-review-detail-page [class*="manual-review-skeleton-"] { background:linear-gradient(100deg,#e4e8ee 25%,#f8f9fb 45%,#e4e8ee 65%); background-size:200% 100%; }
@media (max-width:1100px) {
  #root .manual-review-type-grid { grid-template-columns:repeat(2,minmax(0,1fr)); }
  #root .manual-review-index .listing-grid { grid-template-columns:repeat(3,minmax(0,1fr)); }
}
@media (max-width:1180px) {
  #root .manual-review-detail-page .manual-review-match-detail { height:auto; min-height:calc(100dvh - 54px); overflow:visible; grid-template-columns:minmax(0,1fr); padding:16px; }
  #root .manual-review-detail-page .manual-review-detail-content { height:auto; max-height:none; overflow:visible; }
  #root .manual-review-detail-page .manual-review-match-stage .listing-detail-image { min-height:0; height:460px; }
  #root .manual-review-detail-page .manual-review-match-media { min-height:0; }
}
@media (max-width:600px) {
  #root .manual-review-header { padding:24px 16px 18px; align-items:flex-start; gap:12px; }
  #root .manual-review-header h1 { font-size:24px; }
  #root .manual-review-count { padding:9px 12px; font-size:10px; }
  #root .manual-review-count strong { font-size:22px; }
  #root .manual-review-brand-tabs { padding:0 16px 10px; }
  #root .manual-review-brand-tabs a { min-height:44px; }
  #root .manual-review-type-grid { padding:0 16px; gap:12px; grid-template-columns:minmax(0,1fr); }
  #root .manual-review-type-card { min-height:170px; padding:18px; gap:10px; }
  #root .manual-review-filter-bar { width:calc(100% - 32px); padding:16px; gap:16px; }
  #root .manual-review-filter-title small { display:none; }
  #root .manual-review-filter-group { grid-template-columns:minmax(0,1fr); gap:8px; }
  #root .manual-review-filter-group > span { padding-top:0; }
  #root .manual-review-filter-options button { min-height:44px; padding:8px 11px; }
  #root .manual-review-index { padding:0 16px; }
  #root .manual-review-index .listing-grid { grid-template-columns:repeat(2,minmax(0,1fr)); gap:12px; }
  #root .manual-review-tile .listing-copy { padding:10px; }
  #root .manual-review-card-context { display:grid; gap:2px; }
  #root .manual-review-detail-page .manual-review-detail-content { padding:16px; }
  #root .manual-review-detail-page .manual-review-match-stage .listing-detail-image { height:330px; }
  #root .manual-review-detail-page .manual-review-match-stage { gap:8px; }
  #root .manual-review-image-label { top:8px; left:8px; padding:4px 6px; font-size:10px; }
  #root .manual-review-move-panel { inset:auto 16px 16px; width:auto; max-height:calc(100dvh - 100px); overflow-y:auto; }
  #root .manual-review-empty { width:calc(100% - 32px); }
  #root .manual-review-resolve-actions.with-route { grid-template-columns:minmax(0,1fr); }
}
@media (prefers-reduced-motion:reduce) {
  #root :is(.manual-review-page,.manual-review-detail-page) *, #root .admin-tools-panel * { animation:none; scroll-behavior:auto; transition:none; }
}
/* Keep navigation outside the evidence, and source before reference on small screens. */
#root .manual-review-detail-page .manual-review-match-detail { width:100%; grid-template-rows:auto minmax(0,1fr); background:transparent; border-radius:0; }
#root .manual-review-detail-page .listing-page-nav { position:static; grid-column:1 / -1; }
#root .manual-review-detail-page .manual-review-detail-content { font-family:Inter,sans-serif; }
#root .manual-review-detail-page .manual-review-match-stage > .manual-review-comparison-image { order:0; }
#root .manual-review-detail-page .manual-review-matched-view { order:1; }
#root .manual-review-detail-page .manual-review-matched-view:has(> .listing-detail-image > svg.lucide-image-off) { color:var(--review-muted); }
#root .manual-review-detail-page .manual-review-metadata-summary strong { overflow:visible; white-space:normal; line-height:1.4; }
#root .manual-review-selected-match strong { font-family:Inter,sans-serif; line-height:1.5; }
#root .manual-review-tile .title-button { grid-template-rows:auto auto; }
#root .manual-review-tile .product-line { height:auto; max-height:none; white-space:normal; display:-webkit-box; -webkit-box-orient:vertical; -webkit-line-clamp:2; }
#root .manual-review-tile :is(.designer-line p,.card-size-line,.card-price-line) { font-family:Inter,sans-serif; letter-spacing:0; }
#root .manual-review-move-panel .admin-tools-header { justify-content:space-between; }
#root .manual-review-move-panel { top:auto; bottom:24px; max-height:calc(100dvh - 100px); overflow-y:auto; }
@media (max-width:1180px) {
  #root .manual-review-detail-page .manual-review-match-detail { grid-template-rows:auto auto auto; }
}
#root .manual-review-detail-page .manual-review-comparison-image img { width:100%; height:100%; object-fit:contain; border-radius:0; }
#root .manual-review-detail-page :is(.image-order-toolbar,.collection-assignment-heading) strong { color:var(--review-text); font:600 14px/1.4 Inter,sans-serif; letter-spacing:0; text-transform:none; }
#root .manual-review-detail-page :is(.image-order-toolbar,.collection-assignment-heading) button { border-color:var(--review-line); background:#f0f2f5; color:var(--review-muted); font:500 12px/1.4 Inter,sans-serif; letter-spacing:0; text-transform:none; }
@media (max-width:680px) {
  #root .manual-review-detail-page .manual-review-matched-view:has(svg.lucide-image-off) .listing-detail-image { height:120px; }
}

#root .manual-review-detail-page .manual-review-detail-content { width:100%; }

/* Product photography is commonly white-backed: keep every media well white. */
#root :is(.manual-review-page,.manual-review-detail-page) :is(.manual-review-image,.manual-review-comparison-image,.listing-detail-image,.listing-thumbnail,.listing-image,.listing-image-button,.manual-review-neighbour-thumb,.manual-review-image-order-thumb) { background:#fff; }

/* Compact, searchable queue filters; keep the garments in view. */
#root .manual-review-filter-bar { padding:10px 12px; gap:10px; border-radius:10px; }
#root .manual-review-filter-toolbar { display:flex; align-items:center; flex-wrap:wrap; gap:8px; }
#root .manual-review-filter-label { display:inline-flex; align-items:center; gap:7px; margin-right:4px; color:var(--review-muted); font-size:12px; font-weight:600; }
#root .review-filter-picker { position:relative; }
#root .review-filter-trigger { display:flex; align-items:center; gap:8px; min-height:36px; padding:7px 10px; border:1px solid var(--review-line); border-radius:7px; background:#fff; color:var(--review-text); font:500 12px/1.4 Inter,sans-serif; text-transform:none; letter-spacing:0; }
#root .review-filter-trigger > span { color:var(--review-muted); font-variant-numeric:tabular-nums; }
#root .review-filter-trigger:is(.active,[aria-expanded="true"]) { border-color:#a9caff; background:var(--review-selected); color:#0754ce; }
#root .review-filter-popover { position:absolute; top:calc(100% + 8px); left:0; z-index:20; width:280px; padding:8px; border:1px solid var(--review-line); border-radius:10px; background:#fff; box-shadow:0 8px 28px #1c1e2124; }
#root .review-filter-search { display:flex; align-items:center; gap:8px; border:1px solid #bac2cc; border-radius:6px; padding:0 9px; color:var(--review-muted); }
#root .review-filter-search input { width:100%; min-width:0; height:36px; padding:0; border:0; background:#fff; color:var(--review-text); font:400 13px/1.4 Inter,sans-serif; }
#root .review-filter-search:focus-within { outline:2px solid var(--review-text); outline-offset:1px; }
#root .review-filter-search input:focus-visible { outline:none; }
#root .review-filter-choices { max-height:260px; overflow-y:auto; overscroll-behavior:contain; padding:6px 0; }
#root .review-filter-choice { display:flex; align-items:center; gap:10px; min-height:36px; padding:7px 8px; border-radius:5px; cursor:pointer; color:var(--review-text); font:400 13px/1.4 Inter,sans-serif; }
#root .review-filter-choice:hover { background:#f5f7fa; }
#root .review-filter-choice:has(:checked) { background:var(--review-selected); }
#root .review-filter-choice input { width:16px; height:16px; margin:0; flex-shrink:0; accent-color:var(--review-blue); }
#root .review-filter-footer { display:flex; justify-content:space-between; padding-top:8px; border-top:1px solid var(--review-line); }
#root .review-filter-footer button { min-height:32px; padding:6px 8px; border:0; border-radius:6px; background:#fff; color:#0754ce; font:600 12px/1.4 Inter,sans-serif; text-transform:none; }
#root .review-filter-footer button:hover { background:var(--review-selected); }
#root .review-filter-no-results { padding:16px 8px; color:var(--review-muted); font-size:13px; }
#root .manual-review-active-filters { display:flex; flex-wrap:wrap; gap:6px; }
#root .manual-review-active-filters button { display:flex; align-items:center; gap:7px; min-height:28px; padding:4px 8px; border:1px solid #caddfa; border-radius:6px; background:var(--review-selected); color:#0754ce; font:500 11px/1.4 Inter,sans-serif; text-transform:none; }
@media (max-width:600px) {
  #root .manual-review-filter-toolbar { position:relative; gap:6px; }
  #root .manual-review-filter-label { display:none; }
  #root .review-filter-picker { position:static; }
  #root .review-filter-popover { left:0; width:100%; }
  #root .review-filter-trigger { min-height:44px; }
  #root .review-filter-choice { min-height:44px; }
  #root .review-filter-choices { max-height:min(264px,40dvh); }
  #root .review-filter-footer button, #root .manual-review-clear-filters { min-height:44px; }
  #root .manual-review-active-filters button { min-height:36px; }
}

/* Single-item metadata reviews use document flow, not the comparison viewport's
   clipped rail. Keep the decision controls reachable on short laptop screens. */
#root .manual-review-detail-page .manual-review-metadata-detail {
  grid-template-columns:minmax(0,1fr) minmax(360px,440px);
  grid-template-rows:auto auto;
  height:auto; min-height:calc(100dvh - 106px); overflow:visible;
  align-items:start;
}
#root .manual-review-metadata-detail .manual-review-match-media { height:clamp(440px,calc(100dvh - 190px),760px); }
#root .manual-review-metadata-detail .manual-review-detail-content { height:auto; max-height:none; overflow:visible; gap:20px; scrollbar-gutter:auto; }
#root .manual-review-metadata-detail .manual-review-detail-top h1 { max-width:none; margin-top:0; }
#root .manual-review-metadata-detail .manual-review-detail-top { padding-right:24px; }
#root .manual-review-metadata-detail .manual-review-detail-bottom { gap:0; }
#root .manual-review-metadata-navigation { display:flex; gap:6px; padding:4px; border-radius:9px; background:#f0f2f5; }
#root .manual-review-metadata-navigation button { flex:1; min-height:40px; padding:8px 12px; border:0; border-radius:6px; background:transparent; color:var(--review-muted); font:600 12px/1.4 Inter,sans-serif; text-transform:none; }
#root .manual-review-metadata-navigation button[aria-pressed="true"] { background:#fff; color:#0754ce; box-shadow:0 1px 3px #1c1e2112; }
#root .manual-review-metadata-detail .manual-review-metadata-panel { margin-top:16px; padding-top:16px; }
#root .manual-review-metadata-detail .manual-review-metadata-summary { margin:12px 0 16px; }
#root .manual-review-metadata-detail .manual-review-metadata-summary div { padding:10px; background:#fff; }
#root .manual-review-metadata-detail .manual-review-metadata-summary strong.missing { color:#0754ce; }
#root .manual-review-metadata-detail .manual-review-resolve-actions.with-route { grid-template-columns:minmax(0,1fr) auto 44px; gap:8px; }
#root .manual-review-metadata-detail .manual-review-resolve-actions button { min-height:44px; }
#root .manual-review-metadata-detail .manual-review-resolve-button { white-space:nowrap; }
#root .manual-review-metadata-detail .manual-review-move-button { padding-inline:14px; }
#root .manual-review-metadata-detail .manual-review-trash-button { width:44px; }
@media (max-width:1180px) {
  #root .manual-review-detail-page .manual-review-metadata-detail { grid-template-columns:minmax(0,1fr); }
  #root .manual-review-metadata-detail .manual-review-match-media { height:auto; }
}
@media (max-width:600px) {
  #root .manual-review-metadata-detail .manual-review-metadata-navigation button { min-height:44px; }
  #root .manual-review-metadata-detail .manual-review-resolve-actions.with-route { grid-template-columns:minmax(0,1fr) 44px; }
  #root .manual-review-metadata-detail .manual-review-resolve-button { grid-column:1 / -1; }
  #root .manual-review-metadata-detail .metadata-size-option { min-height:44px; }
}

/* Approval and invalid-resolution evidence is a readable document, not a ruled
   table trapped inside the comparison viewport. Scope this to review routes. */
#root .manual-review-detail-page :is(.manual-review-approval-detail,.manual-review-invalid-detail) {
  grid-template-columns:minmax(0,1fr) minmax(360px,440px);
  grid-template-rows:auto auto;
  height:auto; min-height:calc(100dvh - 106px); overflow:visible; align-items:start;
}
#root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-match-media { height:clamp(440px,calc(100dvh - 190px),760px); }
#root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-detail-content { height:auto; max-height:none; overflow:visible; gap:20px; scrollbar-gutter:auto; }
#root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-detail-top h1 { margin-top:0; max-width:none; }
#root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-detail-bottom { gap:0; }
#root .manual-review-approval-panel { height:auto; padding-bottom:0; gap:18px; }
#root .manual-review-approval-panel > :is(.manual-review-invalid-resolution-details,.manual-review-suggested-neighbours,.manual-review-approval-manual) { flex:none; overflow:visible; }
#root .manual-review-evidence-navigation { display:flex; gap:4px; padding:4px; border-radius:9px; background:#f0f2f5; }
#root .manual-review-evidence-navigation button { flex:1; min-height:40px; padding:8px; border:0; border-radius:6px; background:transparent; color:var(--review-muted); font:600 12px/1.4 Inter,sans-serif; text-transform:none; }
#root .manual-review-evidence-navigation button[aria-pressed="true"] { background:#fff; color:#0754ce; box-shadow:0 1px 3px #1c1e2112; }
#root .manual-review-detail-page .manual-review-invalid-resolution-details { display:grid; gap:18px; margin:0; padding:0; border:0; }
#root .manual-review-detail-page .manual-review-invalid-resolution-details .manual-review-selected-match { gap:6px; padding:0; border:0; }
#root .manual-review-detail-page .manual-review-invalid-resolution-details .manual-review-selected-match em { font-size:13px; line-height:1.65; white-space:pre-wrap; overflow-wrap:anywhere; }
#root .manual-review-detail-page .manual-review-invalid-resolution-details .manual-review-resolve-heading { margin:0; }
#root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-resolve-actions.with-route { grid-template-columns:minmax(0,1fr) auto 44px; gap:8px; margin-top:6px; padding-top:18px; border-top:1px solid var(--review-line); }
#root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-resolve-actions button { min-height:44px; }
#root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-move-button { padding-inline:14px; }
#root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-trash-button { width:44px; }
#root .manual-review-invalid-detail .manual-review-info-actions { margin-top:20px; }
@media (max-width:1180px) {
  #root .manual-review-detail-page :is(.manual-review-approval-detail,.manual-review-invalid-detail) { grid-template-columns:minmax(0,1fr); }
  #root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-match-media { height:auto; }
}
@media (max-width:600px) {
  #root .manual-review-evidence-navigation button { min-height:44px; }
  #root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-resolve-actions.with-route { grid-template-columns:minmax(0,1fr) 44px; }
  #root :is(.manual-review-approval-detail,.manual-review-invalid-detail) .manual-review-resolve-button { grid-column:1 / -1; }
}
#root .manual-review-approval-panel > :is(.manual-review-suggested-neighbours,.manual-review-approval-manual) { margin:0; padding:0; border:0; }
#root .manual-review-approval-panel .manual-review-neighbour-empty { border:0; padding:12px 0; color:var(--review-muted); }

/* Compact seller copy, with the complete text available on demand. */
#root .manual-review-detail-page .expandable-description { min-width:0; }
#root .manual-review-detail-page .expandable-description .description {
  margin:0; color:var(--review-muted); font:400 13px/1.65 Inter,sans-serif;
  white-space:pre-wrap; overflow-wrap:anywhere;
}
#root .manual-review-detail-page .expandable-description .description-toggle { color:#0754ce; }

/* Every review reason shares the same readable document and action geometry.
   Previously only metadata/approval/year branches escaped the clipped rail. */
#root .manual-review-detail-page .manual-review-match-detail {
  grid-template-columns:minmax(0,1fr) minmax(360px,440px);
  grid-template-rows:auto auto;
  height:auto; min-height:calc(100dvh - 106px); overflow:visible; align-items:start;
}
#root .manual-review-detail-page .manual-review-match-media { height:clamp(440px,calc(100dvh - 190px),760px); }
#root .manual-review-detail-page .manual-review-detail-content { height:auto; max-height:none; overflow:visible; gap:20px; scrollbar-gutter:auto; }
#root .manual-review-detail-page .manual-review-detail-top h1 { margin-top:0; max-width:none; overflow-wrap:anywhere; }
#root .manual-review-detail-page .manual-review-detail-bottom { gap:0; margin-top:0; }
#root .manual-review-detail-page .manual-review-resolve-actions.with-route {
  grid-template-columns:minmax(0,1fr) auto 44px; gap:8px; margin-top:18px;
  padding-top:18px; border-top:1px solid var(--review-line);
}
#root .manual-review-detail-page .manual-review-resolve-actions > button,
#root .manual-review-detail-page .manual-review-resolve-actions > .manual-review-move-menu > button {
  display:inline-flex; align-items:center; justify-content:center; gap:8px;
  min-width:0; min-height:44px; padding:10px 14px; font:600 13px/1.4 Inter,sans-serif;
}
#root .manual-review-detail-page .manual-review-resolve-actions button > svg { flex:0 0 auto; }
#root .manual-review-detail-page .manual-review-resolve-actions.with-route .manual-review-trash-button { width:44px; padding:10px; }
#root .manual-review-detail-page .manual-review-line-actions { margin:0; padding:0; border:0; }
#root .manual-review-incorrect-detail .manual-review-line-actions .manual-review-selected-match { border:0; padding:12px 0 18px; }
#root .manual-review-detail-page .manual-review-line-actions .manual-review-resolve-actions { grid-template-columns:repeat(2,minmax(0,1fr)); }
#root .manual-review-detail-page .manual-review-order-panel { min-width:0; padding:0; border:0; }
#root .manual-review-detail-page .image-order-toolbar { gap:12px; align-items:center; }
#root .manual-review-detail-page .image-order-actions .icon-text-button { display:inline-flex; align-items:center; gap:8px; min-height:36px; padding:8px 12px; }
#root .manual-review-detail-page .image-order-thumb { padding:0; background:#fff; border-color:var(--review-line); }
#root .manual-review-detail-page .image-order-thumb.hero { border-color:var(--review-text); box-shadow:none; }
#root .manual-review-detail-page .manual-review-resolution-panel > .manual-review-neighbours { overflow:visible; }
#root .manual-review-detail-page .manual-review-resolve-form { margin-top:0; padding-top:0; border:0; }
#root :is(.manual-review-detail-page,.manual-review-page) :is(button,a) > svg { flex-shrink:0; }
@media (max-width:1180px) {
  #root .manual-review-detail-page .manual-review-match-detail { grid-template-columns:minmax(0,1fr); }
  #root .manual-review-detail-page .manual-review-match-media { height:auto; }
}
@media (max-width:600px) {
  #root .manual-review-detail-page .manual-review-resolve-actions.with-route { grid-template-columns:minmax(0,1fr) 44px; }
  #root .manual-review-detail-page .manual-review-resolve-actions.with-route .manual-review-resolve-button { grid-column:1 / -1; }
  #root .manual-review-detail-page .image-order-actions .icon-text-button { min-height:44px; }
}

#root .manual-review-detail-page .manual-review-metadata-summary strong { overflow-wrap:anywhere; }
#root .manual-review-detail-page .metadata-category-option { white-space:normal; height:auto; min-height:44px; line-height:1.4; padding:10px; }
@media (max-width:380px) {
  #root .manual-review-detail-page .manual-review-metadata-summary { grid-template-columns:minmax(0,1fr); }
  #root :is(.manual-review-page,.manual-review-detail-page) .app-top-nav { grid-template-columns:auto minmax(0,1fr) auto; padding-inline:12px; gap:8px; }
  #root :is(.manual-review-page,.manual-review-detail-page) .app-top-nav nav { gap:10px; }
}

/* Queue navigation retains native new-tab and link interactions. */
#root .manual-review-brand-tabs a,
#root .manual-review-type-card { text-decoration:none; }
#root .manual-review-brand-tabs a:focus-visible,
#root .manual-review-type-card:focus-visible { outline:2px solid var(--review-text); outline-offset:3px; }

/* Keep long category lists compact while retaining native keyboard selection. */
#root .metadata-category-select { display:grid; gap:8px; min-width:0; color:var(--review-text, #1c1e21); font:500 13px/1.5 Inter,sans-serif; }
#root .metadata-category-control { position:relative; display:block; min-width:0; }
#root .metadata-category-control > svg { position:absolute; top:50%; right:12px; width:16px; height:16px; transform:translateY(-50%); pointer-events:none; color:var(--review-muted, #656b73); }
#root .metadata-category-select select { appearance:none; -webkit-appearance:none; width:100%; min-width:0; min-height:42px; padding:10px 40px 10px 12px; text-align:left; border:1px solid var(--review-line, #dce0e5); border-radius:8px; background:#fff; color:inherit; font:inherit; cursor:pointer; }
/* Native selects match :focus-visible on pointer clicks too; only keyboard interaction gets an indicator. */
#root .metadata-category-select select:focus { border-color:var(--review-line, #dce0e5); outline:none; box-shadow:none; }
#root .metadata-category-select select[data-keyboard-focus]:focus-visible { outline:2px solid #8696a8; outline-offset:2px; }

#root .review-metadata-picker { position: relative; }
#root .review-metadata-picker .review-filter-trigger { min-width: 104px; justify-content: space-between; }
#root .review-metadata-menu { position: absolute; top: calc(100% + 6px); left: 0; z-index: 30; width: 190px; padding: 5px; background: #fff; border: 1px solid #e4e6eb; border-radius: 10px; box-shadow: 0 8px 24px rgb(28 30 33 / 12%); }
#root .review-metadata-menu button { display: flex; justify-content: space-between; align-items: center; width: 100%; min-height: 38px; padding: 9px 10px; border: 0; border-radius: 6px; background: #fff; color: #303640; text-align: left; font: 500 12px/1.4 Inter,sans-serif; letter-spacing: 0; text-transform: none; box-shadow: none; }
#root .review-metadata-menu button:hover, #root .review-metadata-menu button:focus-visible { background: #f0f2f5; outline: none; }
#root .review-metadata-menu button[aria-checked="true"] { color: #0866d9; background: #edf4ff; }
@media(max-width:700px) { #root .review-metadata-menu button { min-height: 44px; } }